Packman Build Service PMBS

Changes of Revision 2

devede.changes Changed

devede.spec Changed

@@ -1,44 +1,57 @@
-# vim: set sw=4 ts=4 et:
+#
+# spec file for package devede
+#
+# Copyright (c) 2014 SUSE LINUX Products GmbH, Nuernberg, Germany.
 # Copyright (c) 2006-2010 oc2pus
-# This file and all modifications and additions to the pristine
-# package are under the same license as the package itself.
 #
-# Please submit bugfixes or comments to packman@links2linux.de
+# All modifications and additions to the file contributed by third parties
+# remain the property of their copyright owners, unless otherwise agreed
+# upon. The license for this file, and modifications and additions to the
+# file, is the same license as for the pristine package itself (unless the
+# license for the pristine package is not an Open Source License, in which
+# case the license is the MIT License). An "Open Source License" is a
+# license that conforms to the Open Source Definition (Version 1.9)
+# published by the Open Source Initiative.
+
+# Please submit bugfixes or comments via http://bugs.opensuse.org/
+#
+
 
 Name:           devede
+Version:        3.23.0
+Release:        0
 Summary:        Video DVD creator
-Version:        3.22.0
-Release:        0.pm.1
-License:        GPL
+License:        GPL-3.0+
 Group:          Productivity/Multimedia/Video/Editors and Convertors
-URL:            http://www.rastersoft.com/programas/devede.html
+Url:            http://www.rastersoft.com/programas/devede.html
 Source:         http://www.rastersoft.com/descargas/%{name}-%{version}.tar.bz2
 Patch1:         devede-gtk-2.20.patch
-BuildRoot:      %{_tmppath}/%{name}-%{version}-build
-Requires:       dvdauthor
-Requires:       mkisofs
+Patch2:         fix-filefolder-is-None.patch
+BuildRequires:  MPlayer
+BuildRequires:  dvdauthor
+BuildRequires:  fdupes
+BuildRequires:  hicolor-icon-theme
+BuildRequires:  python-devel
+BuildRequires:  python-gtk >= 2.17
+BuildRequires:  update-desktop-files
 Requires:       MPlayer
-%if %suse_version >= 1110
+Requires:       dvdauthor
+Requires:       /usr/bin/mkisofs
+Requires:       python-gtk >= 2.17
+Requires:       vcdimager
+Recommends:     ffmpeg
+BuildRoot:      %{_tmppath}/%{name}-%{version}-build
+BuildArch:      noarch
+%if 0%{?suse_version} >= 1110
 Requires:       python-base
 %else
 Requires:       python
 %endif
-Requires:       python-gtk >= 2.17
-Requires:       vcdimager
-BuildRequires:  python-devel
-BuildRequires:  python-gtk >= 2.17
-BuildRequires:  fdupes
-BuildRequires:  hicolor-icon-theme
-BuildRequires:  update-desktop-files
-BuildArch:      noarch
-BuildRequires:  dvdauthor
 %if 0%{?suse_version} <= 1230
 BuildRequires:  mkisofs
 %else
 BuildRequires:  cdrkit-cdrtools-compat
 %endif
-BuildRequires:  MPlayer
-Recommends:     ffmpeg
 
 %description
 DeVeDe is a program that allows you to create a video DVD from
@@ -52,47 +65,45 @@
 %prep
 %setup -q
 %patch1
+%patch2
 
-find . -type f -name '*~' -exec %__rm {} \;
+find . -type f -name '*~' -exec rm {} \;
 
-%__sed -i -e 's/\r$//' docs/html/psf.html
-%__chmod 644 docs/html/psf.html
+sed -i -e 's/\r$//' docs/html/psf.html
+chmod 644 docs/html/psf.html
 
-%__sed -i -e 's|/usr/share/doc/devede|%{_docdir}/%{name}|g' \
+sed -i -e 's|%{_datadir}/doc/devede|%{_docdir}/%{name}|g' \
     %{name}.py
 
 # note: devede is always looking in /usr/lib even on 64bit machines ...
-%__sed -i -e 's|sys.path.append("/usr/lib/devede")|sys.path.append("/usr/share/devede")|g' \
+sed -i -e 's|sys.path.append("/usr/lib/devede")|sys.path.append("/usr/share/devede")|g' \
     %{name}.py
 
-%__grep -rl /usr/local . | %__grep '\.py$' | xargs %__perl -p -i -e 's,/usr/local,%{_prefix},g'
+grep -rl /usr/local . | grep '\.py$' | xargs perl -p -i -e 's,/usr/local,%{_prefix},g'
 
 %build
-%__python ./setup.py build
+python ./setup.py build
 
 %install
-%__python ./setup.py install \
+python ./setup.py install \
     --prefix="%{_prefix}" \
-    --root="%{buildroot}" \
+    --root=%{buildroot} \
     --record-rpm=files.lst
 
-%__perl -n -i -e 'print unless m,^%dir\s+%{_datadir}/(pixmaps|applications)/*$,' files.lst
+perl -n -i -e 'print unless m,^%dir\s+%{_datadir}/(pixmaps|applications)/*$,' files.lst
 
-%__rm -rf "%{buildroot}%{_datadir}/doc"
-%__perl -n -i -e 'print unless m,^(?:%dir\s+)?%{_datadir}/doc,' files.lst
+rm -rf "%{buildroot}%{_datadir}/doc"
+perl -n -i -e 'print unless m,^(?:%dir\s+)?%{_datadir}/doc,' files.lst
 
-%__install -D -m0644 devede.svg "%{buildroot}%{_datadir}/icons/hicolor/scalable/apps/%{name}.svg"
+install -D -m0644 devede.svg "%{buildroot}%{_datadir}/icons/hicolor/scalable/apps/%{name}.svg"
 %suse_update_desktop_file -r "%{name}" AudioVideo AudioVideoEditing
 
 %find_lang %{name}
-%__perl -n -i -e 'print unless m,^%{_datadir}/locale,' files.lst
+perl -n -i -e 'print unless m,^%{_datadir}/locale,' files.lst
 
 %fdupes -s '%{buildroot}%{_datadir}/'
 
-%__rm -f docs/html/*~
-
-%clean
-%{?buildroot:%__rm -rf "%{buildroot}"}
+rm -f docs/html/*~
 
 %files lang -f %{name}.lang
 %defattr(-,root,root)

fix-filefolder-is-None.patch Added

devede-3.23.0.tar.bz2/build Added

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7 Added

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_avconv_convert.py Added

@@ -0,0 +1,614 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+import signal
+import os
+import sys
+import re
+import shutil
+import math
+
+import devede_other
+
+import devede_executor
+
+if (sys.platform == "win32") or (sys.platform=="win64"):
+	import win32file
+
+
+class video_converter_ffmpeg(devede_executor.executor):
+	
+	def adjust_audiorate(self,audiorate,isdvd):
+		
+		""" Just in case, we choose the nearest legal value """
+
+		if isdvd:
+			values=448,384,320,256,224,192,160,128,112,96,80,64,56,48,32
+		else:
+			values=384,320,256,224,192,160,128,112,96,80,64,56,48,32
+		
+		for element in values:
+			if audiorate>=element:
+				return element
+
+		return 32
+
+	
+	def __init__(self,global_vars,videofile,filename,filefolder,progresbar,proglabel,disctype,title,chapter,threads,seconds,encpass,fix_ac3):
+
+		""" This class converts a video file to MPEG-1 or MPEG-2 format
+
+		VIDEOFILE contains the parameters to convert the video
+		FILENAME is the generic file name given by the user
+		FILEFOLDER is the path where all the temporary and finall files will be created
+		PROGRESBAR is the progress bar where the class will show the progress
+		PROGLABEL is the label where the class will show what is it doing
+		DISCTYPE can be dvd, vcd, svcd, cvd or divx
+		TITLE and CHAPTER are the numbers used to identify the TITLE and CHAPTER number for this file
+		THREADS is the number of threads to use
+		SECONDS is the number of seconds we want to convert (for previews) 
+		ENCPASS is the number of encoding pass"""
+		
+		devede_executor.executor.__init__(self,filename,filefolder,progresbar)
+		self.printout=False
+
+		self.percent2=120
+		self.film_length=float(videofile"olength")
+		if seconds==0:
+			self.divide=float(videofile"olength")
+			if (videofile"cutting"==1) or (videofile"cutting"==2): # if we want only one half of the file
+				self.divide/=2
+		else:
+			self.divide=float(seconds)
+
+		if self.divide==0:
+			self.divide=1
+
+		self.error=""
+		progresbar.set_fraction(0)
+		progresbar.set_text("")
+		
+		if videofile"ismpeg": # if the file hasn't to be converted, we simply copy or link it
+			self.pulse=True
+			self.print_error=_("File copy failed\nMaybe you ran out of disk space?")
+			if seconds==0:
+				texto=_("Copying the file")+"\n"
+			else:
+				texto=_("Creating preview")+"\n"
+			proglabel.set_text(texto+videofile"filename")
+			currentfile=self.create_filename(filefolder+filename,title,chapter,disctype=="divx")
+		
+			print "\ncurrentfile is: ", currentfile , "\n" 
+
+			try:
+				os.remove(currentfile)
+			except:
+				pass
+
+			if (sys.platform=="win32") or (sys.platform=="win64"):
+				# links do not work on windows, so just copy the file
+				# self.launch_shell('copy "'+videofile"path".replace('"','""')+'" "'+currentfile+'"',output=False)
+				# Only hardlinks are available on 2000 and XP, reparse points are available from vista onwards.
+				win32file.CreateHardLink(currentfile, videofile"path".replace('"','""'))
+			else:
+				if len(videofile"sub_list")==0:
+					self.launch_shell('ln -s "'+videofile"path".replace('"','\\"')+'" "'+currentfile+'"',output=False)
+				else:
+					self.launch_shell('cp "'+videofile"path".replace('"','\\"')+'" "'+currentfile+'"',output=False)
+			return
+
+		isvob=videofile"isvob"
+
+		self.pulse=False
+		if seconds==0:
+			texto=(_("Converting files from title %(title_number)s (pass %(pass_number)s)\n\n%(file_name)s") % {"title_number":str(title),"pass_number":str(encpass),"file_name":videofile"filename"} )
+			proglabel.set_text(texto) #+" "+str(title)+" Pass: "+ str(encpass) +"\n\n"+videofile"filename" )
+		else:
+			texto=_("Creating preview")
+			proglabel.set_text(texto+"\n"+videofile"filename")
+
+		addbars=False
+		framerate=int(videofile"ofps")
+		videorate=int(videofile"vrate")
+		audiorate=self.adjust_audiorate(int(videofile"arate"),disctype=="dvd")
+		
+		audio_final_rate=int(videofile"arateunc")
+		audiodelay=float(videofile"adelay")
+		final_framerate=float(videofile"fps")
+		aspect_ratio_original=videofile"oaspect"
+		aspect_ratio_final=videofile"aspect"
+		resx_final=videofile"width"
+		resy_final=videofile"height"
+		resx_original=videofile"owidth"
+		resy_original=videofile"oheight"
+		copy_audio=videofile"copy_audio"
+		sound51=videofile"sound51"
+		gop12=videofile"gop12"
+		audiostream=videofile"audio_stream"
+		swap_fields=videofile"swap_fields"
+		volume=videofile"volume"
+		audio_tracks=len(videofile"audio_list")
+
+		if (videofile"resolution"==0) and (disctype=="divx"):
+			default_res=True
+		else:
+			default_res=False
+		
+		speed1,speed2=devede_other.get_speedup(videofile)
+		if speed1==speed2:
+			speedup=None
+		else:
+			speedup=str(speed1)+":"+str(speed2)
+	
+		if aspect_ratio_original<1.3:
+			aspect_ratio_original=float(videofile"owidth")/(float(videofile"oheight"))
+		if aspect_ratio_original<1.33333333:
+			aspect_ratio_original=1.33333333
+	
+		max_videorate=int(videorate*2)
+		min_videorate=int(videorate*0.75)
+		
+		dsize,minvid,maxvid=devede_other.get_dvd_size(None,disctype)
+		
+		if max_videorate>maxvid:
+			max_videorate=maxvid
+		if min_videorate<minvid:
+			min_videorate=minvid
+			
+		if videofile"blackbars"==0: # check if has to add black bars
+			addbars=True
+			if (videofile"rotate"==90) or (videofile"rotate"==270):
+				resx_original2=resy_original
+				resy_original2=resx_original
+				aratio=1/aspect_ratio_original
+			else:
+				resx_original2=resx_original
+				resy_original2=resy_original
+				aratio=aspect_ratio_original
+
+			if (resx_original2%2)==1:
+				resx_original2+=1
+			if (resy_original2%2)==1:
+				resy_original2+=1
+			
+			resy_tmp = int(resy_final*aspect_ratio_final/aratio)
+			resx_tmp = int(resx_final*aratio/aspect_ratio_final)
+			
+			
+			if (resx_tmp>resx_final):
+				resx_inter=resx_final
+				resy_inter=resy_tmp
+			else:
+				resx_inter=resx_tmp
+				resy_inter=resy_final
+			
+			#resx_inter=resx_original2
+			#resy_inter=int((resy_original2*aspect_ratio_original)/aspect_ratio_final)
+			if (resx_inter%2)==1:
+				resx_inter-=1
+			if (resy_inter%2)==1:
+				resy_inter-=1
+			
+			#if ((resy_inter<resy_original) or (resy_original+5>resy_inter)):
+			#	addbars=False
+
+		if addbars==False:
+			resx_inter=resx_final
+			resy_inter=resy_final
+		else:
+			if (resx_inter==resx_final):
+				addx=0
+				addy=int((resy_final-resy_inter)/2)
+				if(addy%2)==1:
+					addy+=1
+			else:
+				addy=0
+				addx=int((resx_final-resx_inter)/2)
+				if(addx%2)==1:
+					addx+=1
+					
+		
+		command_var="avconv"
+		#command_var="avconv"
+
+		command_var.append("-i")
+		command_var.append(videofile"path")
+		
+		if (volume!=100):
+			command_var.append("-vol")
+			command_var.append(str((256*volume)/100))
+		
+		if (audiodelay!=0.0) and (copy_audio==False) and (isvob==False):
+			command_var.append("-itsoffset")
+			command_var.append(str(audiodelay))
+			command_var.append("-i")
+			command_var.append(videofile"path")
+			command_var.append("-map")
+			command_var.append("1:0")
+			for l in range(audio_tracks):
+				command_var.append("-map")
+				command_var.append("0"+":"+str(l+1))
+		
+		if (isvob==False):
+			cmd_line=""
+			
+			extra_params=videofile"params_vf" # take the VF extra params
+			while (extra_params!=""):
+				extra_params,new_param=devede_other.get_new_param(extra_params)
+				if (new_param!="") and (new_param!=','):
+					while (len(new_param)>1) and (new_param0==','):
+						new_param=new_param1:
+					while (len(new_param)>1) and (new_param-1==','):
+						new_param=new_param:-1
+					if new_param=="fifo":
+						continue
+					if cmd_line!="":
+						cmd_line+=",fifo,"
+					cmd_line+=new_param
+			
+			if videofile"deinterlace"=="yadif":
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="yadif"
+			
+			vflip=0
+			hflip=0
+	
+			if (videofile"rotate"==90):
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="transpose=1"
+			elif (videofile"rotate"==270):
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="transpose=2"
+			elif (videofile"rotate"==180):
+				vflip=1
+				hflip=1
+			
+			if (videofile"vmirror"):
+				vflip=1-vflip
+			if (videofile"hmirror"):
+				hflip=1-hflip
+	
+			if (vflip==1):
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="vflip"
+			if (hflip==1):
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="hflip"
+			
+			if addbars and ((resx_inter!=resx_original) or (resy_inter!=resy_original)) and (default_res==False):
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="scale="+str(resx_inter)+":"+str(resy_inter)+",fifo,pad="+str(resx_final)+":"+str(resy_final)+":"+str(addx)+":"+str(addy)+":0x000000"
+			
+			if cmd_line!="":
+				command_var.append("-vf")
+				command_var.append(cmd_line)
+			
+		
+		command_var.append("-y")
+
+		vcd=False
+		
+		if (disctype!="divx"):
+			command_var.append("-target")
+			if (disctype=="dvd"):
+				if final_framerate==30:
+					command_var.append("ntsc-dvd")
+				elif (framerate==24):
+					command_var.append("film-dvd")
+				else:
+					command_var.append("pal-dvd")
+				if (copy_audio==False):
+					command_var.append("-acodec")
+					if fix_ac3:
+						command_var.append("ac3_fixed")
+					else:
+						command_var.append("ac3")
+				#command_var.append("-maxrate")
+				#command_var.append("7000k")
+				#command_var.append("-minrate")
+				#command_var.append("2200k")
+			elif (disctype=="vcd"):
+				vcd=True
+				if final_framerate==30:
+					command_var.append("ntsc-vcd")
+				else:
+					command_var.append("pal-vcd")
+			elif (disctype=="svcd"):
+				if final_framerate==30:
+					command_var.append("ntsc-svcd")
+				else:
+					command_var.append("pal-svcd")
+			elif (disctype=="cvd"):
+				if final_framerate==30:
+					command_var.append("ntsc-svcd")
+				else:
+					command_var.append("pal-svcd")
+		else: # DivX
+			command_var.append("-vcodec")
+			command_var.append("mpeg4")
+			command_var.append("-acodec")
+			command_var.append("libmp3lame")
+			command_var.append("-f")
+			command_var.append("avi")
+		
+		if  (not isvob):
+			command_var.append("-sn") # no subtitles
+
+		if copy_audio or isvob:
+			command_var.append("-acodec")
+			command_var.append("copy")
+		#else:
+		#	if (disctype=="divx"):
+		#		command_var.append("-acodec")
+		#		command_var.append("mp3")
+
+		#if (audiostream!=10000):
+		#	command_var.append("-aid")
+		#	command_var.append(str(audiostream))
+
+		if isvob:
+			command_var.append("-vcodec")
+			command_var.append("copy")
+		
+		if (vcd==False):
+			if final_framerate==30:
+				if (framerate==24) and ((disctype=="dvd") or (disctype=="divx")):
+					str_final_framerate="24000/1001"
+					keyintv=15
+					telecine=True
+				else:
+					str_final_framerate="30000/1001"
+					keyintv=18
+			else:
+				str_final_framerate=str(int(final_framerate))
+				keyintv=15
+		
+		if (disctype=="divx"):
+			command_var.append("-g")
+			command_var.append("300")
+		elif gop12 and (isvob==False):
+			command_var.append("-g")
+			command_var.append("12")
+		
+		command_var.append("-bf")
+		command_var.append("2")
+		command_var.append("-strict")
+		command_var.append("1")
+		
+		if seconds!=0:
+			command_var.append("-t")
+			command_var.append(str(seconds))
+		else:
+			if videofile"cutting"==1: # first half only
+				command_var.append("-t")
+				command_var.append(str(videofile"olength"/2))
+			elif videofile"cutting"==2: # second half only
+				command_var.append("-ss")
+				command_var.append(str((videofile"olength"/2)-5)) # start 5 seconds before
+
+		#if (audiodelay!=0.0) and (copy_audio==False) and (isvob==False):
+		#	command_var.append("-delay")
+		#	command_var.append(str(audiodelay))
+
+		command_var.append("-ac")
+		if (sound51) and ((disctype=="dvd") or (disctype=="divx")):
+			command_var.append("6")
+		else:
+			command_var.append("2")
+
+		#if (isvob==False) and (default_res==False):
+		#	command_var.append("-ofps")
+		#	command_var.append(str_final_framerate)
+
+		if disctype=="divx":
+			command_var.append("-vtag")
+			command_var.append("DX50")
+
+		lineatemp=""
+		acoma=False;
+		
+		#if swap_fields:
+		#	lineatemp+="phase=a"
+		#	acoma=True
+		
+		passlog_var = None
+		
+		if (videofile"deinterlace"!="none") and (videofile"deinterlace"!="yadif") and (isvob==False):
+			command_var.append("-deinterlace")
+			
+		print "Addbars "+str(addbars)+" resx_o "+str(resx_original)+" resy_o "+str(resy_original)
+		print "resx_i "+str(resx_inter)+" resy_i "+str(resy_inter)
+ 
+ 		if (isvob==False) and (vcd==False):
+				command_var.append("-s")
+				command_var.append(str(resx_final)+"x"+str(resy_final))
+
+		# Currently Mencoder supports up to 8 threads
+		if isvob==False:
+			threads
+			
+			if threads>1:
+				command_var.append("-threads")
+				command_var.append(str(threads))
+
+			command_var.append("-trellis")
+			if videofile"trellis":
+				command_var.append("1")
+			else:
+				command_var.append("0")
+		
+			if videofile"mbd"==0:
+				command_var.append("-mbd")
+				command_var.append("0")
+			elif videofile"mbd"==1:
+				command_var.append("-mbd")
+				command_var.append("1")
+			elif videofile"mbd"==2:
+				command_var.append("-mbd")
+				command_var.append("2")
+	
+			if (vcd==False):
+				command_var.append("-b:v")
+				command_var.append(str(videorate)+"k")
+		
+			#if disctype!="divx":
+			#	lavcopts+=":keyint="+str(keyintv)
+			if(copy_audio==False) and (vcd==False):
+#					lavcopts+=":acodec="
+#					if disctype=="dvd":
+#						if fix_ac3:
+#							lavcopts+="ac3_fixed"
+#						else:
+#							lavcopts+="ac3"
+#					else:
+#						lavcopts+="mp2"
+					#lavcopts+=":abitrate="+str(audiorate)
+				command_var.append("-b:a")
+				command_var.append(str(audiorate)+"k")
+
+			if (default_res==False):
+				command_var.append("-aspect")
+				if aspect_ratio_final>1.4:
+					command_var.append("16:9")
+				else:
+					command_var.append("4:3")
+			
+			passlog_var=None
+			if (encpass>0)  and (isvob==False):
+				command_var.append("-pass")
+				command_var.append(str(encpass))
+				passlog_var=os.path.join(filefolder,filename)+".log"
+				if encpass==1:
+					try:
+						os.remove(passlog_var)
+					except:
+						 pass
+					#if videofile"turbo1stpass":
+					#	lavcopts+=":turbo"
+
+#	
+#		if (disctype=="divx") and (copy_audio==False) and (isvob==False):
+#			lameopts="abr:br="+str(audiorate)
+#			command_var.append("-lameopts")
+#			extra_params=videofile"params_lame" # take the LAME extra params
+#			while (extra_params!=""):
+#				extra_params,new_param=devede_other.get_new_param(extra_params)
+#				if (new_param!="") and (new_param!=':'):
+#					while (len(new_param)>1) and (new_param0==':'):
+#						new_param=new_param1:
+#					while (len(new_param)>1) and (new_param-1==':'):
+#						new_param=new_param:-1
+#					lameopts+=":"+new_param
+#			command_var.append(lameopts)
+	
+		currentfile=self.create_filename(filefolder+filename,title,chapter,disctype=="divx")
+
+		if (passlog_var != None) and (isvob==False):
+			command_var.append("-passlogfile")
+			command_var.append(passlog_var)
+
+		if (encpass==1) and (isvob==False):
+			command_var.append("-y")
+			command_var.append("/dev/null")
+		else:
+			command_var.append(currentfile)
+		
+		at=audio_tracks
+		while (at>1):
+			if (volume!=100):
+				command_var.append("-vol")
+				command_var.append(str((256*volume)/100))
+			command_var.append("-newaudio")
+			at-=1
+			
+
+		extra_params=videofile"params" # take the extra params
+		while (extra_params!=""):
+			extra_params,new_param=devede_other.get_new_param(extra_params)
+			if new_param!="":
+				command_var.append(new_param)
+
+		self.print_error=_("Conversion failed.\nIt seems a bug of Mencoder.")
+		if (videofile"params"!="") or (videofile"params_vf"!="") or (videofile"params_lame"!=""):
+			self.print_error+="\n"+_("Also check the extra params passed to Mencoder for syntax errors.")
+		self.error_not_done=True
+		self.launch_program(command_var,read_chars=300)
+		
+
+
+	def end_process(self,eraser,erase_temporal_files):
+
+		return
+
+
+	def getfloat(self,cadena,upper=0):
+		
+		pos=cadena.find(":")
+		upper*=60
+		if (pos==-1):
+			try:
+				val=upper+float(cadena)
+			except:
+				val=upper
+		else:
+			try:
+				val2=upper+float(cadena:pos)
+			except:
+				val2=upper
+			val=self.getfloat(cadenapos+1:,val2)
+		return val
+
+
+	def set_progress_bar(self):
+
+		if self.pulse:
+			self.bar.pulse()
+			return True
+
+		pos=self.cadena.find("time=")
+		if pos==-1:
+			return False # don't erase the string
+		pos2=self.cadena.find("bitrate",pos+5)
+		if pos2==-1:
+			return False
+		
+		cadena2=self.cadenapos+5:pos2
+		
+		valuetemp=self.getfloat(cadena2)
+		
+		value=(100.0*valuetemp)/self.divide
+		if (value!=self.percent2) or (self.percent2==120):
+			if (value)>100.0:
+				value=100.0
+			self.bar.set_fraction(value/100.0)
+			self.bar.set_text(str(int(value))+"%")
+			self.percent2=value
+			if self.error_not_done:
+				self.error_not_done=False
+				self.print_error=_("Conversion failed\nMaybe you ran out of disk space?")
+		return True

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_bincue.py Added

@@ -0,0 +1,102 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2007 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+import signal
+import os
+import sys
+import re
+import shutil
+
+import devede_executor
+
+class xvcd_generator(devede_executor.executor):
+	
+	""" This class creates BIN/CUE images for VCD, sVCD or CVD """
+	
+	def __init__(self,filename,filefolder,progresbar,proglabel,structure,disctocreate):
+		
+		devede_executor.executor.__init__(self,filename,filefolder,progresbar)
+		
+		proglabel.set_text(_("Creating BIN/CUE files"))
+	
+		cantidad=len(structure0)-1
+		if (sys.platform!="win32") and (sys.platform!="win64"):
+			lista="vcdimager","-c",filefolder+filename+".cue","-b",filefolder+filename+".bin","-t"
+		else:
+			lista="vcdimager.exe","-c",filefolder+filename+".cue","-b",filefolder+filename+".bin","-t"
+
+		if disctocreate=="vcd":
+			lista.append("vcd2")
+		else:
+			lista.append("svcd")
+	
+		for variable in range(cantidad):
+			currentfile=self.create_filename(filefolder+filename,1,variable+1,False)
+			lista.append(currentfile)
+			
+		self.print_error=_("Failed to create the BIN/CUE files\nMaybe you ran out of disk space")
+		self.launch_program(lista,output=False)
+
+
+	def end_process(self,eraser,erase_temporal_files):
+
+		print "End process bin/cue"
+		if erase_temporal_files:
+			eraser.delete_mpg()
+			eraser.delete_menu()
+			eraser.delete_xml()
+
+
+class iso_generator(devede_executor.executor):
+	
+	""" This class generates the ISO image for DVDs """
+	
+	def __init__(self,filename,filefolder,progresbar,proglabel,command):
+		
+		devede_executor.executor.__init__(self,filename,filefolder,progresbar)
+		
+		proglabel.set_text(_("Creating ISO file"))
+		progresbar.set_fraction(0.0)
+		progresbar.set_text("0%")
+	
+		volume="DVDVIDEO"
+		self.print_error=_("Failed to create the ISO image\nMaybe you ran out of disk space")
+		self.launch_program(command,"-dvd-video","-V",volume,"-v","-udf","-o",filefolder+filename+".iso",filefolder+filename)
+
+
+	def set_progress_bar(self):
+		
+		punto=self.cadena.find("done, estimate")
+		if (punto!=-1):
+			if ((self.cadenapunto-6.isdigit()) and ((self.cadenapunto-7.isdigit()) or (self.cadenapunto-7==" "))):
+				value=self.cadenapunto-7:punto-2
+				percent2=float(value.replace(",","."))
+				self.bar.set_fraction(percent2/100)
+				self.bar.set_text(str(int(percent2))+"%")
+			return True
+		return False
+
+
+	def end_process(self,eraser,erase_temporal_files):
+		print "intento borrar"
+		if erase_temporal_files:
+			eraser.delete_directory()

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_convert.py Added

@@ -0,0 +1,656 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+#################################################################
+# This block contains all the functions to convert a video file #
+# into an MPEG2-PS DVD-compliant file                           #
+#################################################################
+
+import time
+import select
+import signal
+import subprocess
+import sys
+import os
+import re
+import shutil
+import glob
+import posixpath
+import gtk
+import devede_other
+import gobject
+import cairo
+import dbus
+
+if (sys.platform=="win32") or (sys.platform=="win64"):
+	import win32api
+
+import devede_other
+import devede_video_convert
+import devede_ffmpeg_convert
+import devede_avconv_convert
+import devede_subtitles
+import devede_xml_menu
+import devede_delete
+import devede_dvd
+import devede_bincue
+import devede_executor
+import devede_dialogs
+
+import gc
+
+class create_all:
+
+	def cancel_clicked(self,widget,temp=False):
+		
+		newtree=devede_other.create_tree(self,"wcancel_job_dialog",self.gladefile,False)
+		window=newtree.get_object("wcancel_job_dialog")
+		window.show()
+		value=window.run()
+		window.hide()
+		window.destroy()
+		if value!=-5: # no
+			return True
+
+		self.runner.cancel()
+		self.runner.wait_end()
+		gobject.source_remove(self.timer)
+		self.window.hide()
+		self.window.destroy()
+		newtree=devede_other.create_tree(self,"waborted_dialog",self.gladefile,False)
+		window=newtree.get_object("waborted_dialog")
+		window.show()
+		window.run()
+		window.hide()
+		window.destroy()
+		window=None
+		gc.collect()
+		(self.main_window_callback)() # show the main window
+		return True
+
+
+	def iso_changed(self,args,arbol):
+
+		iso_name=arbol.get_object("iso_filename")
+		iso_folder=arbol.get_object("final_directory")
+	
+		w=arbol.get_object("button_folder_accept")
+	
+		mode=True
+	
+		if iso_name.get_text()=="":
+			mode=False
+		
+		folder=iso_folder.get_current_folder()
+		if folder==None:
+			mode=False
+		elif folder=="":
+			mode=False
+		
+		w.set_sensitive(mode)
+
+
+	def check_free_space(self,filefolder,structure,actions,erase_temporary_files,sound_duration):
+
+		""" Returns TRUE if the free space in FILEFOLDER is insuficient to generate
+		the disk STRUCTURE """
+		# TODO Windows Stuff
+		estado=''
+		freespace=''
+		if (sys.platform!="win32") and (sys.platform!="win64"):
+			try:
+				print "Checking "+str(filefolder)
+				estado=os.statvfs(filefolder) # eg. f="C:\Documents and Settings\User name\Desktop"
+				freespace=95*estado.f_bsize*estado.f_bavail/100000
+			except ImportError:
+				print "Error when checking free space"
+				freespace=0
+		else:
+			try:
+				test_drive = os.path.splitdrive(filefolder)0 + "\\" # So it will also work on Windows 2000 
+				spc, bps, fc, tc = win32api.GetDiskFreeSpace(test_drive)
+				freespace=fc * spc * bps
+			except ImportError:
+				freespace=0
+		print "Free space in "+str(filefolder)+": "+str(freespace)
+		print "estatus ", estado, "\n"
+	
+		total=devede_other.calcula_tamano_total(structure,sound_duration,self.disk_type)
+
+		print "Free: "+str(freespace)
+		print "Needed: "+str(total)
+	
+		if (actions!=3):
+			total*=actions # if we only create the MPEG files or the DVD structure...
+		else:
+			if erase_temporary_files: # or if we create the ISO image
+				total*=2
+			else:
+				total*=3
+		total*=1.1 # a safe margin of 10%
+
+		if (freespace<total):
+			return True,_("Insuficient free space. To create this disc\n%(total)d MBytes are needed, but only %(free)d MBytes are available.") % {'total':int(total/1000),'free':int(freespace/1000)}
+		else:
+			return False,""
+
+	def check_mp3lame(self):
+		runner=devede_executor.executor()
+		runner.launch_program("ffmpeg","-codecs",sep_stderr=True,keep_out=True)
+		runner.wait_end2()
+		
+		print "Salida "+str(runner.cadena)
+		pos=runner.cadena.find("mp3lame")
+		if (pos==-1):
+			tree=devede_other.create_tree(self,"wno_mp3lame",self.gladefile)
+			w=tree.get_object("nomp3lame")
+			w.show()
+			w.run()
+			w.destroy()
+			self.has_mp3lame=False
+			return False
+		else:
+			self.has_mp3lame=True
+			return True
+	
+	def __init__(self,gladefile,structure,global_vars,callback):
+		
+		if (0!=devede_other.check_program("k3b -v")):
+			self.k3b_available=False
+		else:
+			self.k3b_available=True
+		
+		if (0!=devede_other.check_program("brasero --help")):
+			self.brasero_available=False
+		else:
+			self.brasero_available=True
+		
+		self.gladefile=gladefile
+		self.structure=structure
+		self.global_vars=global_vars
+		
+		self.has_mp3lame=True
+		if (global_vars"disctocreate"=="divx") and ((global_vars"encoder_video"=="ffmpeg") or (global_vars"encoder_video"=="avconv")):
+			if (False==self.check_mp3lame()):
+				return
+		
+		self.tree=devede_other.create_tree(self,"wprogress",self.gladefile)
+		
+		self.window=self.tree.get_object("wprogress")
+		self.partial=self.tree.get_object("progresspartial")
+		self.erase_temp=global_vars"erase_temporary_files"
+		self.iso_creator=global_vars"iso_creator"
+
+		self.queue=
+		self.current_action=0
+		self.actions=global_vars"number_actions"
+		self.total=self.tree.get_object("progress_total")
+		self.label=self.tree.get_object("lcreating")
+		self.total.set_fraction(0)
+		self.partial.set_fraction(0)
+		self.partial.set_text("0%")
+		self.label.set_text("")
+		self.start_time=time.time()
+		self.disk_type=global_vars"disctocreate"
+		self.main_window_callback=callback
+		self.tiempo=time.time()
+
+
+	def init_queue(self):
+
+		total=0
+		title=0
+		for element in self.structure:
+			chapter=0
+			for element2 in element1::
+				if self.structuretitlechapter+1"twopass" == True:
+					self.queue.append("C1",title,chapter)
+					self.queue.append("C2",title,chapter)
+				else:
+					self.queue.append("C",title,chapter)
+				stream=0
+				for element3 in element2"sub_list":
+					self.queue.append("S",title,chapter,stream)
+					stream+=1
+
+				#if self.structuretitlechapter+1"twopass" == True:
+				#	self.queue.append("C2",title,chapter)
+				#	stream=0
+				#	for element3 in element2"sub_list":
+				#		self.queue.append("S",title,chapter,stream)
+				#		stream+=1
+						
+				chapter+=1
+			title+=1
+
+
+	def preview(self,filefolder):
+		
+		if (self.has_mp3lame==False):
+			self.window.destroy()
+			return
+		
+		self.init_queue()
+		newtree=devede_other.create_tree(self,"wpreview_dialog",self.gladefile,False)
+		timev=newtree.get_object("seconds_preview")
+		timev.set_value(60)
+		
+		w=newtree.get_object("wpreview_dialog")
+		w.show()
+		ret=w.run()
+		w.hide()
+		self.filefolder=filefolder
+		if self.filefolder-1!=os.sep:
+			self.filefolder+=os.sep
+		self.seconds=timev.get_value()
+		w.destroy()
+		if ret!=-6:
+			self.window.destroy()
+			return
+
+		self.runner=None
+		self.queue.append("PREVIEW") # Preview
+		self.total_done=0.0
+		self.filename="previewfile"
+		
+		try:
+			fichero=open(self.filefolder+"write_check","w")
+			fichero.write("Testing")
+			fichero.close()
+		except:
+			self.show_error(_("Failed to write to the destination directory.\nCheck that you have privileges and free space there."))
+			self.window.destroy()
+			return
+		
+		try:
+			os.remove(self.filefolder+"write_check")
+		except:
+			print "Failed to erase the write check file"
+		
+		self.eraser=devede_delete.delete_files(self.filename,self.filefolder)
+		self.erase_temp=True
+		self.timer=gobject.timeout_add(250,self.time_callback)
+		self.window.show()
+		return
+		
+
+	def on_iso_filename_activate(self,widg,ventana):
+		
+		ventana.response(-6)
+
+
+	def create_disc(self):
+		
+		self.time=0
+		
+		if (self.has_mp3lame==False):
+			self.window.hide()
+			self.window.destroy()
+			(self.main_window_callback)()
+			return False
+		
+		# first, check for empty titles
+		
+		empty=False
+		for element in self.structure:
+			if len(element)<2:
+				empty=True
+				break
+			
+		if empty:
+			newtree=devede_other.create_tree(self,"wempty_titles_dialog",self.gladefile,False)
+			w=newtree.get_object("wempty_titles_dialog")
+			w.show()
+			value=w.run()
+			w.hide()
+			w.destroy()
+			if value!=-6:
+				self.window.hide()
+				self.window.destroy()
+				(self.main_window_callback)()
+				return False
+
+		# ask the folder and filename
+		
+		newtree=devede_other.create_tree(self,"wfolder_dialog",self.gladefile,False)
+		wdir=newtree.get_object("final_directory")
+		if self.global_vars"finalfolder"!="":
+			wdir.set_current_folder(self.global_vars"finalfolder")
+		wfile=newtree.get_object("iso_filename")
+		wfolder_dialog=newtree.get_object("wfolder_dialog")
+		do_shdw=newtree.get_object("do_shutdown")
+		wfile.set_text("movie")
+		wfile.connect("activate",self.on_iso_filename_activate,wfolder_dialog)
+		wfile.connect("changed",self.iso_changed,newtree)
+		wdir.connect("current-folder-changed",self.iso_changed,newtree)
+		#self.iso_changed("",newtree)
+
+		wfolder_dialog.show()
+		wfile.grab_focus()
+		print "Entro en RUN"
+		value=wfolder_dialog.run()
+		print "Salgo de RUN"
+		self.global_vars"shutdown_after_disc"=do_shdw.get_active()
+		self.filename=wfile.get_text()
+		self.filename.replace("/","_")
+		self.filename.replace("|","_")
+		self.filename.replace("\\","_")
+		
+		filefolder=wdir.get_current_folder()
+		
+		wfolder_dialog.hide()
+		wfolder_dialog.destroy()
+		if value!=-6:
+			self.window.hide()
+			self.window.destroy()
+			(self.main_window_callback)()
+			return False
+		
+		self.global_vars"finalfolder"=filefolder
+		
+		filefolder2=os.path.join(filefolder,self.filename)
+		
+		self.filefolder=filefolder2
+		
+		if self.filefolder-1!=os.sep:
+			self.filefolder+=os.sep
+		
+		if (os.path.exists(filefolder2)):
+			newtree=devede_other.create_tree(self,"wfolder_exists",self.gladefile,False)
+			w=newtree.get_object("wfolder_exists")
+			wtext=newtree.get_object("folder_exists_label")
+			wtext.set_text(_("The file or folder\n\n%(folder)s\n\nalready exists. If you continue, it will be deleted.") % {'folder':filefolder2})
+			w.show()
+			value=w.run()
+			w.hide()
+			w.destroy()
+			if value!=2:
+				self.window.hide()
+				self.window.destroy()
+				(self.main_window_callback)()
+				return False
+		
+		try:
+			os.remove(filefolder2)
+		except:
+			pass
+		
+		try:
+			os.makedirs(filefolder2)
+		except:
+			pass
+	
+		self.eraser=devede_delete.delete_files(self.filename,self.filefolder)
+		hasfree,msg=self.check_free_space(self.filefolder,self.structure,self.actions,self.erase_temp,self.global_vars"menu_sound_duration")
+		if hasfree:
+			self.window.hide()
+			self.window.destroy()
+			self.show_error(msg)
+			(self.main_window_callback)()
+			return False
+	
+		# erase all conflicting files
+		
+		self.eraser.delete_all()
+		
+		# now, create the XML files (even with VCD, SVCD or CVD, to check if we have write permissions)
+
+		xml_files=devede_xml_menu.xml_files(self.partial,self.filename,self.filefolder,self.structure,self.global_vars,self.label)
+
+		counter=0
+		counter2=0
+		if (self.disk_type=="dvd"):
+			if xml_files.do_menus():
+				nelements=xml_files.get_elements_per_menu()
+				while (len(self.structurecounter:)!=0):
+					self.queue.append("M1",xml_files,counter,counter2)
+					counter+=nelements
+					counter2+=1
+
+		self.init_queue()
+
+		retorno=xml_files.create_files()
+		if retorno!=None:
+			self.window.hide()
+			self.window.destroy()
+			self.show_error(retorno)
+			(self.main_window_callback)()
+			return False
+		
+		self.runner=None
+		if self.actions!=1: # want to do, at least, the DVD structure, or the VCD image
+			if self.disk_type=="dvd":
+				self.queue.append("DVD_STRUCTURE")
+				if self.actions==3: # do DVD image too
+					self.queue.append("DVD_IMAGE")
+			else:
+				self.queue.append("CD_IMAGE")
+		
+		self.queue.append("END")
+		self.seconds=0
+		self.total_done=0.0
+		self.timer=gobject.timeout_add(250,self.time_callback)
+		self.window.show()
+		return True
+
+
+	def time_callback(self):
+
+		""" This method launches all the conversion stages when needed, using the standard executor
+		interface to manage all of them in an easy way """
+
+		self.total.set_text(str(self.current_action)+"/"+str(len(self.queue)-1))
+		self.total.set_fraction(float(self.current_action)/(float(len(self.queue)-1)))
+		if self.runner!=None:
+			if self.runner.initerror:
+				retval=-1;
+			else:
+				retval=self.runner.refresh()
+			if retval==0: # no error, still running
+				return True
+			else:
+				self.current_action+=1
+				retval=self.runner.wait_end()
+				if (retval!=0) or (self.runner.initerror):
+					self.window.hide()
+					self.window.destroy()
+					if self.runner.print_error==None:
+						self.runner.print_error=_("Unknown error")
+					self.show_error(self.runner.print_error)
+					(self.main_window_callback)()
+					return False
+				else:
+					self.runner.end_process(self.eraser,self.erase_temp)
+				self.runner=None
+		
+		action=self.queueself.current_action
+		
+		if (self.global_vars"multicore"!=1) and (self.global_vars"hyperthreading"==False):
+			cores=self.global_vars"hypercores"
+		else:
+			cores=self.global_vars"cores"
+		
+		if action0=="M1":
+			self.runner=action1
+			self.runner.create_menu1(action2,action3,cores)
+			return True
+		
+		if (action0=='C') or (action0=='C1') or (action0=='C2'):
+			title=action1
+			chapter=action2
+			if action0=="C":
+				encpass = 0
+			else:
+				encpass = int(action01)
+			print "Segundos "+str(self.seconds)
+			if (self.global_vars"encoder_video"=="ffmpeg"):
+				self.runner=devede_ffmpeg_convert.video_converter_ffmpeg(self.global_vars,self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, encpass,self.global_vars"AC3_fix_ffmpeg")
+			elif (self.global_vars"encoder_video"=="avconv"):
+				self.runner=devede_avconv_convert.video_converter_ffmpeg(self.global_vars,self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, encpass,self.global_vars"AC3_fix_avconv")
+			else:
+				self.runner=devede_video_convert.video_converter(self.global_vars,self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, encpass,self.global_vars"AC3_fix")
+			return True
+		
+		if action0=="C2":
+			title=action1
+			chapter=action2
+			if (self.global_vars"encoder_video"=="ffmpeg"):
+				self.runner=devede_ffmpeg_convert.video_converter_ffmpeg(self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, 2,self.global_vars"AC3_fix_ffmpeg")
+			elif (self.global_vars"encoder_video"=="avconv"):
+				self.runner=devede_avconv_convert.video_converter(self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, 2,self.global_vars"AC3_fix_avconv")
+			else:
+				self.runner=devede_video_convert.video_converter(self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, 2,self.global_vars"AC3_fix")
+			return True
+		
+		if action0=="S":
+			title=action1
+			chapter=action2
+			sub_stream=action3
+			self.runner=devede_subtitles.subtitles_adder(self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,sub_stream)
+			return True
+		
+		if action0=="PREVIEW":
+			self.window.hide()
+			self.window.destroy()
+			if (sys.platform=="win32") or (sys.platform=="win64"):
+				mplay="mplayer.exe"
+			else:
+		 		mplay="mplayer"
+		 	fname=self.filefolder+"previewfile_01_01."
+		 	if self.disk_type=="divx":
+		 		fname+="avi"
+		 	else:
+		 		fname+="mpg"
+			parameters=mplay,"-sid","0",fname,"-loop","1"
+			newtree=devede_other.create_tree(self,"wpreviewagain_dialog",self.gladefile,False)
+			w=newtree.get_object("wpreviewagain_dialog")
+			while True:
+				salida=devede_executor.executor("previewfile",self.filefolder,None)
+				salida.launch_program(parameters,output=False)
+				salida.wait_end()
+				w.show()
+				ret=w.run()
+				w.hide()
+				if ret!=-6:
+					break
+				while gtk.events_pending():	
+					gtk.main_iteration()
+			w.destroy()
+			os.remove(fname)
+			return False
+		
+		if action0=="DVD_STRUCTURE":
+			self.runner=devede_dvd.dvd_generator(self.filename,self.filefolder,self.partial,self.label)		
+			return True
+		
+		if action0=="CD_IMAGE":
+			self.runner=devede_bincue.xvcd_generator(self.filename,self.filefolder,self.partial,self.label,self.structure,self.disk_type)
+			return True
+
+		if action0=="DVD_IMAGE":
+			self.runner=devede_bincue.iso_generator(self.filename,self.filefolder,self.partial,self.label,self.iso_creator)
+			return True
+		
+		if action0=="END":
+			self.show_final_time()
+			return False
+		return True
+
+
+	def show_final_time(self):
+		if (self.erase_temp):
+			self.eraser.delete_xml()
+
+		self.window.hide()
+		self.window.destroy()
+		if (self.global_vars"shutdown_after_disc"):
+			print "\n\nApago el ordenador\n\n"
+			failure=False
+			
+			# First, try with ConsoleKit
+			try:
+				bus = dbus.SystemBus()
+				bus_object = bus.get_object("org.freedesktop.ConsoleKit", "/org/freedesktop/ConsoleKit/Manager")
+				bus_object.Stop(dbus_interface="org.freedesktop.ConsoleKit.Manager")
+			except:
+				failure=True
+			if (failure):
+				failure=False
+				
+				# If it fails, try with HAL
+				try:
+					bus = dbus.SystemBus()
+					bus_object = bus.get_object("org.freedesktop.Hal", "/org/freedesktop/Hal/devices/computer")
+					bus_object.Shutdown(dbus_interface="org.freedesktop.Hal.Device.SystemPowerManagement")
+				except:
+					failure=True
+
+			if (failure==False):
+				gtk.main_quit()
+
+		newtree=devede_other.create_tree(self,"wend_dialog",self.gladefile,False)
+		label=newtree.get_object("elapsed")
+		tiempo2=devede_other.return_time(time.time()-self.tiempo,True)
+		label.set_text(tiempo2)
+		window=newtree.get_object("wend_dialog")
+		burn = newtree.get_object("burn_button")
+		# only enable button if k3b is available
+		# TODO: support other burners
+		
+		if (self.k3b_available==False) and (self.brasero_available==False):
+			burn.set_sensitive(False)
+		
+		burn.connect('clicked', self.burn)
+		window.show()
+		window.run()
+		window.hide()
+		window.destroy()
+		window = None
+		newtree = None
+		gc.collect()
+		(self.main_window_callback)()
+
+	def burn(self, widget):
+
+		"""Burns resulting iso"""
+
+		path = self.filefolder + self.filename + ".iso"
+		print path
+		parameters = 
+		if (self.brasero_available):
+			parameters.append("brasero")
+			parameters.append("--image="+path)
+		else:
+			parameters.append("k3b")
+			parameters.append("--burn")
+			parameters.append(path)
+		runner=devede_executor.executor()
+		runner.launch_program(parameters,output=False)
+		runner.wait_end()
+
+
+	def show_error(self,message):
+		
+		self.window.hide()
+		self.window.destroy()
+		devede_dialogs.show_error(self.gladefile,message)
+		return
+

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_delete.py Added

@@ -0,0 +1,223 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2007 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2007 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+import os
+import shutil
+import glob
+
+class delete_files:
+
+	""" This class allows to delete temporary files and directories """
+	
+	def __init__(self,filename,filefolder):
+		
+		self.filename=filename
+		self.filefolder=filefolder
+		self.filepath=os.path.join(filefolder,filename)
+		print "Path para borrar: "+str(self.filepath)
+
+
+	def delete_all(self):
+		
+		self.delete_avi()
+		self.delete_bin_cue()
+		self.delete_directory()
+		self.delete_iso()
+		self.delete_menu_temp()
+		self.delete_menu()
+		self.delete_mpg()
+		self.delete_log()
+		self.delete_sub_xml()
+		self.delete_xml()
+		self.delete_main_dir()
+
+
+	def delete_mpg(self):
+
+		print "Deleting "+self.filename+"_??_??.mpg"
+		try:
+			listfiles=glob.glob(self.filepath+"_0-90-9_0-90-9"+".mpg")
+			for afile in listfiles:
+				print "Trying to delete "+afile
+				try:
+					os.remove(afile)
+				except OSError:
+					print str(afile.strip())+" not found to remove"
+		except OSError:
+			print self.filepath+"._??_??.mpg not found"
+	
+	
+	def delete_log(self):
+
+		print "Deleting "+self.filename+".log"
+		try:
+			os.remove(self.filename+".log")
+		except OSError:
+			print self.filepath+".log not found"
+	
+	
+	def delete_avi(self):
+
+		try:
+			listfiles=glob.glob(self.filepath+"_01_0-90-9"+".avi")
+			for afile in listfiles:
+				try:
+					os.remove(afile)
+				except OSError:
+					print str(afile.strip())+" not found to remove"
+		except OSError:
+			print self.filepath+"._01_??.avi not found"
+			
+	
+	def delete_xml(self):
+		
+		try:
+			os.remove(self.filepath+".xml")
+			listfiles=glob.glob(self.filepath+"_menu_0-9"+".xml")
+			for afile in listfiles:
+				try:
+					os.remove(afile)
+				except OSError:
+					print str(afile.strip())+" not found to remove"
+		except OSError:
+			print self.filepath+".xml not found"
+
+
+	def delete_menu_temp(self):
+	
+		print "delete menu temp"
+		try:
+			listfiles=glob.glob(self.filepath+"_menu0-9"+"_bg.png")
+			for afile in listfiles:
+				try:
+					os.remove(afile)
+				except OSError:
+					print str(afile.strip())+" not found to remove"
+		except OSError:
+			print "Can't delete "+self.filepath+"_menu?_bg.png"
+
+		try:
+			listfiles=glob.glob(self.filepath+"_menu0-9"+"_bg_active_out.png")
+			for afile in listfiles:
+				try:
+					os.remove(afile)
+				except OSError:
+					print str(afile.strip())+" not found to remove"
+		except OSError:
+			print "Can't delete "+self.filepath+"_menu?_bg_active_out.png"
+
+		try:
+			listfiles=glob.glob(self.filepath+"_menu0-9"+"_bg_inactive_out.png")
+			for afile in listfiles:
+				try:
+					os.remove(afile)
+				except OSError:
+					print str(afile.strip())+" not found to remove"
+		except OSError:
+			print "Can't delete "+self.filepath+"_menu?_bg_inactive_out.png"
+			
+		try:
+			listfiles=glob.glob(self.filepath+"_menu0-9"+"_bg_select_out.png")
+			for afile in listfiles:
+				try:
+					os.remove(afile)
+				except OSError:
+					print str(afile.strip())+" not found to remove"
+		except OSError:
+			print "Can't delete "+self.filepath+"_menu?_bg_select_out.png"
+
+		try:
+			listfiles=glob.glob(self.filepath+"_menu_0-9"+".mpg")
+			for afile in listfiles:
+				try:
+					os.remove(afile)
+				except OSError:
+					print str(afile.strip())+" not found to remove"
+		except OSError:
+			print "Can't delete "+self.filepath+"_menu_?.mpg"
+
+
+	def delete_menu(self):
+		
+		print "delete menu"
+		
+		try:
+			listfiles=glob.glob(self.filepath+"_menu2_0-9"+".mpg")
+			for afile in listfiles:
+				try:
+					os.remove(afile)
+				except OSError:
+					print str(afile.strip())+" not found to remove"
+		except OSError:
+			print "Can't delete "+self.filepath+"_menu2_?.mpg"
+
+
+	def delete_sub_xml(self,xtrasub=""):
+
+		try:
+			os.remove(self.filepath+"_sub.xml")
+		except OSError:
+			print self.filepath+".xml not found"
+		if xtrasub!="":
+			try:
+				os.remove(xtrasub)
+			except OSError:
+				print str(xtrasub)+" not found"
+		
+	
+	def delete_iso(self):
+		
+		try:
+			os.remove(self.filepath+".iso")
+		except OSError:
+			print self.filepath+".iso not found"
+
+
+	def delete_bin_cue(self):
+		
+		try:
+			os.remove(self.filepath+".cue")
+		except OSError:
+			print self.filepath+".cue not found"
+			
+		try:
+			os.remove(self.filepath+".bin")
+		except OSError:
+			print self.filepath+".bin not found"
+
+
+	def delete_directory(self):
+
+		try:
+			shutil.rmtree(self.filepath)
+		except OSError:
+			print self.filepath+os.sep+" not found"
+			
+	def delete_main_dir(self):
+
+		print "Borro principal"
+		return
+
+		try:
+			shutil.rmtree(self.filepath)
+		except OSError:
+			print self.filepath+os.sep+" not found"

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_dialogs.py Added

@@ -0,0 +1,157 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2007 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2007 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+import pygtk # for testing GTK version number
+pygtk.require ('2.0')
+import gtk
+import devede_other
+
+class show_error:
+	
+	def __init__(self,gladefile,message):
+		
+		""" Shows a window with an error """
+		
+		self.newtree=devede_other.create_tree(self,"werror_dialog",gladefile,False)
+		label=self.newtree.get_object("label_error_dialog")
+		label.set_text(message)
+		window=self.newtree.get_object("werror_dialog")
+		window.show()
+		window.run()
+		window.hide()
+		window.destroy()
+		window=None
+
+
+class show_warning:
+	
+	def __init__(self,gladefile,message):
+		
+		""" Shows a window with an error """
+		
+		self.newtree=devede_other.create_tree(self,"wwarning_dialog",gladefile,False)
+		label=self.newtree.get_object("wwarning_dialog_text")
+		label.set_text(message)
+		window=self.newtree.get_object("wwarning_dialog")
+		window.show()
+		window.run()
+		window.hide()
+		window.destroy()
+		window=None
+
+
+class ask_exit:
+	
+	def __init__(self,gladefile):
+	
+		self.newtree=devede_other.create_tree(self,"wcancel_dialog",gladefile,False)
+		self.window=self.newtree.get_object("wcancel_dialog")
+		
+	def run(self):
+		self.window.show()
+		retval=self.window.run()
+		self.window.hide()
+		self.window.destroy()
+		self.window=None
+		return retval
+
+
+class ask_overwrite_onload:
+	
+	def __init__(self,gladefile):
+	
+		self.newtree=devede_other.create_tree(self,"wloosecurrent",gladefile,False)
+		self.window=self.newtree.get_object("wloosecurrent")
+		
+	def run(self):
+		self.window.show()
+		retval=self.window.run()
+		self.window.hide()
+		self.window.destroy()
+		self.window=None
+		return retval
+
+
+class ask_delete_title:
+	
+	def __init__(self,titlename,gladefile):
+		
+		self.newtree=devede_other.create_tree(self,"wdel_title_dialog",gladefile,False)
+		self.window=self.newtree.get_object("wdel_title_dialog")
+		label=self.newtree.get_object("what_title")
+		label.set_text(titlename)
+	
+	def run(self):
+		self.window.show()
+		retval=self.window.run()
+		self.window.hide()
+		self.window.destroy()
+		self.window=None
+		return retval
+
+
+class ask_delete_chapter:
+	
+	def __init__(self,titlename,gladefile):
+		
+		self.newtree=devede_other.create_tree(self,"wdel_chapter_dialog",gladefile,False)
+		self.window=self.newtree.get_object("wdel_chapter_dialog")
+		label=self.newtree.get_object("labelchapter")
+		label.set_text(titlename)
+	
+	def run(self):
+		self.window.show()
+		retval=self.window.run()
+		self.window.hide()
+		self.window.destroy()
+		self.window=None
+		return retval
+
+
+class ask_erase_all:
+	
+	def __init__(self,gladefile):
+		
+		self.newtree=devede_other.create_tree(self,"werase_dialog",gladefile,False)
+		self.window=self.newtree.get_object("werase_dialog")
+
+	def run(self):
+		self.window.show()
+		retval=self.window.run()
+		self.window.hide()
+		self.window.destroy()
+		self.window=None
+		return retval
+
+
+class show_about:
+
+	def __init__(self,gladefile):
+
+		""" Shows the About dialog """
+	
+		self.newtree=devede_other.create_tree(self,"aboutdialog1",gladefile,False)
+		window=self.newtree.get_object("aboutdialog1")
+		window.show()
+		window.run()
+		window.hide()
+		window.destroy()
+		window=None

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_disctype.py Added

@@ -0,0 +1,117 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+import pygtk # for testing GTK version number
+pygtk.require ('2.0')
+import gtk
+import devede_main
+import devede_dialogs
+import os
+import devede_other
+
+class disctype:
+	
+	def __init__(self,global_vars):
+
+		self.gladefile=global_vars"gladefile"
+		self.global_vars=global_vars
+		
+		self.tree=devede_other.create_tree(self,"wdisk_type",self.gladefile)
+		self.window=self.tree.get_object("wdisk_type")
+		self.main_window=None
+		self.window.show()
+
+	
+	def on_wdisk_type_delete_event(self,widget,signal):
+		""" Callback which shows the "Are you sure?" window """
+	
+		return self.ask_cancel()
+	
+	
+	def on_wdisk_type_cancel_clicked(self,widget):
+		""" Callback which shows the "Are you sure?" window """
+	
+		return self.ask_cancel()
+	
+	
+	def ask_cancel(self):
+	
+		window=devede_dialogs.ask_exit(self.gladefile)
+		retval=window.run()
+		window=None
+		print "Retorno: ",
+		print retval
+		if retval==-5:
+			gtk.main_quit()
+			return False
+		return True
+
+	
+	def on_disctype_dvd(self,widget):
+	
+		self.global_vars"disctocreate"="dvd"
+		self.global_vars"menu_top_margin"=0.125
+		self.global_vars"menu_bottom_margin"=0.125
+		self.global_vars"menu_left_margin"=0.1
+		self.global_vars"menu_right_margin"=0.1
+		self.set_disk_type()
+
+		
+	def on_disctype_vcd(self,widget):
+	
+		self.global_vars"disctocreate"="vcd"
+		self.set_disk_type()
+
+		
+	def on_disctype_svcd(self,widget):
+	
+		self.global_vars"disctocreate"="svcd"
+		self.set_disk_type()
+
+		
+	def on_disctype_cvd(self,widget):
+	
+		self.global_vars"disctocreate"="cvd"
+		self.set_disk_type()
+
+		
+	def on_disctype_divx(self,widget):
+	
+		self.global_vars"disctocreate"="divx"
+		self.set_disk_type()
+	
+		
+	def set_disk_type(self):
+		
+		if self.main_window==None:
+			self.main_window=devede_main.main_window(self.global_vars,self.show_again)
+		self.main_window.set_disc_type(True)
+		self.main_window.show()
+		self.window.hide()
+
+
+	def show_again(self):
+		
+		""" Callback which is called from main window when the user wants to change the
+			disk type """
+		
+		self.main_window.hide()	
+		self.window.show()

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_dvd.py Added

@@ -0,0 +1,80 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2007 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2007 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+import signal
+import os
+import sys
+import re
+import shutil
+
+import devede_executor
+
+class dvd_generator(devede_executor.executor):
+	
+	def __init__(self,filename,filefolder,progresbar,proglabel):
+		
+		devede_executor.executor.__init__(self,filename,filefolder,progresbar)
+		proglabel.set_text(_("Creating DVD tree structure"))
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			command="dvdauthor.exe"
+		else:
+			command="dvdauthor"
+
+		self.print_error=_("Failed to create the DVD tree\nMaybe you ran out of disk space")
+		self.launch_program(command,"-x",filefolder+filename+".xml")
+		
+
+	def set_progress_bar(self):
+		
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			# This seems to be about all that can be done with dvdauthor on windows
+			self.bar.pulse()
+			return True
+		
+		if self.cadena.find("INFO: Video")!=-1:
+			self.bar.pulse()
+			return True
+		else:
+			position=self.cadena.find("STAT: VOBU ")
+			if position!=-1:
+				self.bar.pulse()
+				self.bar.set_text("VOBU "+self.cadenaposition+11:self.cadena.find(" ",position+11))
+				return True
+			else:
+				position=self.cadena.find("STAT: fixing VOBU at ")
+				if (position!=-1):
+					position2=self.cadena.find("%",position+21)
+					if (position2!=-1):
+						cadena=self.cadenaposition2-2:position2
+						self.bar.set_text(cadena+"%")
+						self.bar.set_fraction((float(cadena.replace(",",".")))/100.0)
+						self.read_chars=200
+						return True
+		return False
+
+
+	def end_process(self,eraser,erase_temporal_files):
+
+		if erase_temporal_files:
+			eraser.delete_mpg()
+			eraser.delete_menu()
+			eraser.delete_xml()

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_dvdmenu.py Added

@@ -0,0 +1,411 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+import pygtk # for testing GTK version number
+pygtk.require ('2.0')
+import gtk
+import cairo
+import os
+
+import devede_other
+import devede_dialogs
+import devede_xml_menu
+import devede_newfiles
+import devede_help
+
+
+class menu_options:
+
+	def __init__(self,gladefile,structure,global_vars,callback):
+		
+		self.global_vars=global_vars
+		self.gladefile=gladefile
+		self.structure=structure
+		self.callback=callback
+		
+		self.tree=devede_other.create_tree(self,"wmenu_properties",self.gladefile)
+		self.window=self.tree.get_object("wmenu_properties")
+		
+		menu_filename=global_vars"menu_bg"
+		if menu_filename==None:
+			menu_filename=os.path.join(global_vars"path","backgrounds","default_bg.png")
+		w=self.tree.get_object("menu_bg_file")
+		w.set_filename(menu_filename)
+		filter=gtk.FileFilter()
+		filter.add_mime_type("image/*")
+		filter.set_name("Pictures")
+		w.add_filter(filter)
+		
+		self.preview_x=200
+		self.preview_y=200
+		self.sf_final=cairo.ImageSurface(cairo.FORMAT_ARGB32,self.preview_x,self.preview_y)
+		self.preview=gtk.DrawingArea()
+		self.preview.set_size_request(self.preview_x,self.preview_y)
+		self.preview.connect("expose-event",self.repaint_preview)
+		w.set_preview_widget(self.preview)
+
+		self.on_menu_bg_file_update_preview(w,menu_filename)
+		
+		self.adding_sound=True
+		w=self.tree.get_object("menu_sound")
+		print "filtro"
+		filter2=gtk.FileFilter()
+		filter2.add_mime_type("audio/mpeg")
+		filter2.add_mime_type("audio/x-wav")
+		filter2.add_mime_type("application/ogg")
+		filter2.add_mime_type("audio/ogg")
+		filter2.set_name("Audio files")
+		w.add_filter(filter2)
+		print "filtrado"
+		w.set_filename(global_vars"menu_sound")
+		print "Añado"
+		
+		w=self.tree.get_object("menufont")
+		w.set_font_name(global_vars"fontname")
+		
+		w=self.tree.get_object("unselected_color")
+		color=global_vars"menu_font_color"
+		c1=gtk.gdk.Color(color0,color1,color2)
+		w.set_color(c1)
+		w.set_alpha(color3)
+		
+		w=self.tree.get_object("selected_color")
+		color=global_vars"menu_selc_color"
+		c1=gtk.gdk.Color(color0,color1,color2)
+		w.set_color(c1)
+		
+		w=self.tree.get_object("shadow_color")
+		color=global_vars"menu_shadow_color"
+		c1=gtk.gdk.Color(color0,color1,color2)
+		w.set_color(c1)
+		w.set_alpha(color3)
+		
+		w=self.tree.get_object("bg_color")
+		color=global_vars"menu_bgcolor"
+		c1=gtk.gdk.Color(color0,color1,color2)
+		w.set_color(c1)
+		w.set_alpha(color3)
+		
+		if global_vars"menu_alignment"==0:
+			w=self.tree.get_object("menutop")
+		elif global_vars"menu_alignment"==1:
+			w=self.tree.get_object("menubottom")
+		else:
+			w=self.tree.get_object("menumiddle")
+		w.set_active(True)
+		
+		if global_vars"menu_halignment"==0:
+			w=self.tree.get_object("menuleft")
+		elif global_vars"menu_halignment"==1:
+			w=self.tree.get_object("menuright")
+		else:
+			w=self.tree.get_object("menucenter")
+		w.set_active(True)
+		
+		if global_vars"do_menu":
+			w=self.tree.get_object("domenu")
+		else:
+			w=self.tree.get_object("notmenu")
+		w.set_active(True)
+		
+		w=self.tree.get_object("menu_title_text")
+		w.set_text(global_vars"menu_title_text")
+		
+		w=self.tree.get_object("menu_title_color")
+		color=global_vars"menu_title_color"
+		c1=gtk.gdk.Color(color0,color1,color2)
+		w.set_color(c1)
+		w.set_alpha(color3)
+		
+		w=self.tree.get_object("menu_title_shadow")
+		color=global_vars"menu_title_shadow"
+		c1=gtk.gdk.Color(color0,color1,color2)
+		w.set_color(c1)
+		w.set_alpha(color3)
+		
+		w=self.tree.get_object("menu_title_font")
+		w.set_font_name(global_vars"menu_title_fontname")
+		
+		w=self.tree.get_object("margin_top_adj")
+		w.set_value(100.0*global_vars"menu_top_margin")
+		w=self.tree.get_object("margin_bottom_adj")
+		w.set_value(100.0*global_vars"menu_bottom_margin")
+		w=self.tree.get_object("margin_left_adj")
+		w.set_value(100.0*global_vars"menu_left_margin")
+		w=self.tree.get_object("margin_right_adj")
+		w.set_value(100.0*global_vars"menu_right_margin")
+		
+		self.window.show()
+
+
+	def repaint_preview(self,dwidget,evento):
+		try:
+			cr=dwidget.window.cairo_create()
+			cr.set_source_surface(self.sf_final)
+			cr.paint()
+		except:
+			return
+
+
+	def on_menu_bg_file_update_preview(self,widget,filename2=None):
+		try:
+			if filename2==None:
+				filename=widget.get_preview_filename()
+			else:
+				filename=filename2
+
+			print "Using "+str(filename)+" as menu background"
+			
+			pixbuf = gtk.gdk.pixbuf_new_from_file(filename)
+			x = pixbuf.get_width()
+			y = pixbuf.get_height()
+
+			sf_base = cairo.ImageSurface(0,x,y)
+
+			ct = cairo.Context(sf_base)
+			ct2 = gtk.gdk.CairoContext(ct)
+
+			ct2.set_source_pixbuf(pixbuf,0,0)
+			ct2.paint()
+			ct2.stroke()
+
+			xbase=float(sf_base.get_width())
+			ybase=float(sf_base.get_height())
+			
+			cr_final=cairo.Context(self.sf_final)
+			cr_final.set_source_rgb(1.0,1.0,1.0)
+			cr_final.paint()
+			if xbase>ybase:
+				divisor=xbase
+			else:
+				divisor=ybase
+			
+			cr_final.scale(float(self.preview_x)/divisor,float(self.preview_y)/divisor)
+			
+			cr_final.set_source_surface(sf_base)
+			cr_final.paint()
+			self.repaint_preview(self.preview,"")
+			widget.set_preview_widget_active(True)
+		except:
+			widget.set_preview_widget_active(False)
+
+
+	def on_menu_sound_selection_changed(self,widget):
+		
+		print "Entro"
+		
+		if self.adding_sound:
+			self.adding_sound=False
+			return
+		
+		filename=widget.get_filename()
+		if (filename==None) or (filename==""):
+			return
+		
+		test=devede_newfiles.file_get_params()
+		check,channels=test.read_file_values(filename,True)
+		if (check!=False) or (channels!=1):
+			filename=os.path.join(self.global_vars"path","silence.ogg")
+			widget.set_filename(filename)
+			w = devede_dialogs.show_error(self.gladefile,_("The menu soundtrack seems damaged. Using the default silent soundtrack."))
+			w = None
+		test=None
+
+
+	def on_menu_no_sound_clicked(self,widget):
+		
+		w=self.tree.get_object("menu_sound")
+		w.set_filename(os.path.join(self.global_vars"path","silence.ogg"))
+
+	def on_menu_help_clicked(self,widget):
+	
+		help_class=devede_help.show_help(self.gladefile,self.global_vars"help_path","menu.html")
+		
+	def on_menuprop_cancel_clicked(self,widget):
+		
+		self.window.hide()
+		self.window.destroy()
+		self.window=None
+
+
+	def on_menuprop_accept_clicked(self,widget):
+
+		self.set_new_bg(self.global_vars)
+		self.window.hide()
+		self.window.destroy()
+		self.window=None
+		
+	
+	def on_menu_preview_clicked(self,widget):
+	
+		global_vars2={}
+		global_vars2"PAL"=self.global_vars"PAL"
+		global_vars2"with_menu"=True
+		global_vars2"AC3_fix"=self.global_vars"AC3_fix"
+		global_vars2"AC3_fix_ffmpeg"=self.global_vars"AC3_fix_ffmpeg"
+		global_vars2"AC3_fix_avconv"=self.global_vars"AC3_fix_avconv"
+		global_vars2"encoder_video"=self.global_vars"encoder_video"
+		global_vars2"encoder_menu"=self.global_vars"encoder_menu"
+		self.set_new_bg(global_vars2)
+		window=menu_preview(self.gladefile,self.structure,global_vars2)
+		window=None
+	
+	
+	def on_menu_default_bg_clicked(self,widget):
+		
+		self.global_vars"menu_bg"=os.path.join(self.global_vars"path","backgrounds","default_bg.png")
+		w=self.tree.get_object("menu_bg_file")
+		w.set_filename(self.global_vars"menu_bg")
+	
+	
+	def set_new_bg(self,global_vars):
+		
+		w=self.tree.get_object("menu_bg_file")
+		menu_filename=w.get_filename()
+		if menu_filename==None:
+			menu_filename=os.path.join(self.global_vars"path","backgrounds","default_bg.png")
+		global_vars"menu_bg"=menu_filename
+
+		w=self.tree.get_object("menu_sound")
+		sound_filename=w.get_filename()
+		test=devede_newfiles.file_get_params()
+		check,channels=test.read_file_values(sound_filename,True)
+		global_vars"menu_sound"=sound_filename
+		global_vars"menu_sound_duration"=test.length
+		test=None
+
+		w=self.tree.get_object("menufont")
+		global_vars"fontname"=w.get_font_name()
+		
+		w=self.tree.get_object("unselected_color")
+		color=w.get_color()
+		global_vars"menu_font_color"=color.red,color.green,color.blue,w.get_alpha()
+				
+		w=self.tree.get_object("selected_color")
+		color=w.get_color()
+		global_vars"menu_selc_color"=color.red,color.green,color.blue,65535
+		
+		w=self.tree.get_object("shadow_color")
+		color=w.get_color()
+		global_vars"menu_shadow_color"=color.red,color.green,color.blue,w.get_alpha()
+		
+		w=self.tree.get_object("bg_color")
+		color=w.get_color()
+		global_vars"menu_bgcolor"=color.red,color.green,color.blue,w.get_alpha()
+
+		align=0 # top
+		w=self.tree.get_object("menumiddle")
+		if w.get_active():
+			align=2 # middle
+		else:
+			w=self.tree.get_object("menubottom")
+			if w.get_active():
+				align=1 # bottom
+		global_vars"menu_alignment"=align
+		
+		halign=0 # left
+		w=self.tree.get_object("menucenter")
+		if w.get_active():
+			halign=2 # middle
+		else:
+			w=self.tree.get_object("menuright")
+			if w.get_active():
+				halign=1 # right
+		global_vars"menu_halignment"=halign
+		
+		w=self.tree.get_object("domenu")
+		global_vars"do_menu"=w.get_active()
+		
+		w=self.tree.get_object("menu_title_text")
+		global_vars"menu_title_text"=w.get_text()
+		
+		w=self.tree.get_object("menu_title_color")
+		color=w.get_color()
+		global_vars"menu_title_color"=color.red,color.green,color.blue,w.get_alpha()
+		
+		w=self.tree.get_object("menu_title_shadow")
+		color=w.get_color()
+		global_vars"menu_title_shadow"=color.red,color.green,color.blue,w.get_alpha()
+		
+		w=self.tree.get_object("menu_title_font")
+		global_vars"menu_title_fontname"=w.get_font_name()
+		
+		w=self.tree.get_object("margin_top_adj")
+		global_vars"menu_top_margin"=w.get_value()/100.0
+		w=self.tree.get_object("margin_bottom_adj")
+		global_vars"menu_bottom_margin"=w.get_value()/100.0
+		w=self.tree.get_object("margin_left_adj")
+		global_vars"menu_left_margin"=w.get_value()/100.0
+		w=self.tree.get_object("margin_right_adj")
+		global_vars"menu_right_margin"=w.get_value()/100.0
+		
+		# repaint the used size
+		self.callback()
+
+
+class menu_preview:
+	
+	def menu_preview_expose(self,widget,event):
+
+		""" Callback to repaint the menu preview window when it
+			sends the EXPOSE event """
+
+		if self.menu_preview==None:
+			return
+		cr=self.menu_preview.window.cairo_create()
+		cr.set_source_surface(self.sf)
+		cr.paint()
+		   
+	
+	def __init__(self,gladefile,structure,global_vars):
+		
+		""" Shows a window with a preview of the disc menu """
+		
+		self.menu_preview=None
+		if global_vars"PAL":
+			newtree=devede_other.create_tree(self,"wmenu_preview_pal",gladefile)
+			window=newtree.get_object("wmenu_preview_pal")
+			self.menu_preview=newtree.get_object("preview_draw_pal")
+		else:
+			newtree=devede_other.create_tree(self,"wmenu_preview_ntsc",gladefile)
+			window=newtree.get_object("wmenu_preview_ntsc")
+			self.menu_preview=newtree.get_object("preview_draw_ntsc")
+		print self.menu_preview
+
+		if global_vars.has_key("install_path")==False:
+			global_vars"install_path"=None
+		if global_vars.has_key("path")==False:
+			global_vars"path"=""
+		if global_vars.has_key("menu_sound")==False:
+			global_vars"menu_sound"=""
+		if global_vars.has_key("menu_sound_duration")==False:
+			global_vars"menu_sound_duration"=1
+		clase=devede_xml_menu.xml_files(None,None,None,structure,global_vars,"","")
+		self.sf=clase.create_menu_bg(0,0,0,True)
+
+		if self.sf==None:
+			devede_dialogs.show_error(gladefile,_("Can't find the menu background.\nCheck the menu options."))
+		else:
+			window.show()
+			window.run()
+			window.hide()
+		window.destroy()
+		window=None

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_executor.py Added

@@ -0,0 +1,462 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+import signal
+import os
+import sys
+import subprocess
+import select
+import time
+if (sys.platform=="win32") or (sys.platform=="win64"):
+	import win32api
+	import win32process
+	import win32con
+	import time
+
+import threading
+import gobject
+
+class executor:
+
+	""" Base class for all launchers (Mplayer, Mencoder, SPUmux, DVDauthor, mkisofs...). """
+
+	def __init__(self,filename=None,filefolder=None,progresbar=None):
+
+		# FILENAME is the generic file name given by the user
+		# FILEFOLDER is the path where all the temporary and finall files will be created
+		# PROGRESBAR is the GtkProgressBar where the class will show the progress
+
+		self.initerror=False
+		self.handle=None
+		self.cadena=""
+		self.err_cadena=""
+		self.sep_stderr=False
+		self.platform_win32=((sys.platform=="win32") or (sys.platform=="win64"))
+		self.print_error="Undefined error"
+		self.keep_output=False
+
+		if filename!=None:
+			self.bar=progresbar
+			if progresbar!=None:
+				progresbar.set_text(" ")
+			self.filefolder=filefolder
+			self.filename=filename
+			self.printout=True
+		else:
+			self.bar=None
+			self.filename=None
+			self.filefolder=None
+			self.printout=True
+
+	def cancel(self):
+
+		""" Called to kill this process. """
+
+		if self.handle==None:
+			return
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			try:
+				win32api.TerminateProcess(int(self.handle._handle), -1)
+			except Exception , err:
+				print "Error: ", err
+		else:
+			os.kill(self.handle.pid,signal.SIGKILL)
+		
+	
+	def wait_end(self):
+		
+		""" Wait until the process ends """
+		
+		if self.handle==None:
+			return 0
+		
+		self.handle.wait()
+		return self.handle.returncode
+	
+	
+	def wait_end2(self):
+		
+		r1,r2=self.handle.communicate()
+		self.cadena=r1
+		if (self.sep_stderr):
+			self.err_cadena=r2
+		else:
+			self.cadena+=r2
+		if (self.printout):
+			print r1,
+		print r2,
+
+
+	def launch_shell(self,program,read_chars=80,output=True,stdinout=None):
+		
+		""" Launches a program from a command line shell. Usefull for programs like SPUMUX, which
+		takes the input stream from STDIN and gives the output stream to STDOUT, or for programs
+		like COPY, CP or LN """
+		
+		self.read_chars=read_chars
+		self.output=output
+		self.handle=None
+				
+		if stdinout!=None: # we want to apply a file as STDIN and another one as STDOUT
+			lprogram=program+' < "'+stdinout0+'" > "'+stdinout1+'"'
+			if (sys.platform=="win32") or (sys.platform=="win64"):
+				try:
+					pos=program.find(" ")
+					if pos==-1:
+						command=program
+					else:
+						command=program:pos # get the command itself (usually SPUMUX.EXE)
+					wd=sys.path-1: # Current working Directory.  To work with py2exe
+					b=os.path.join(wd0, "bin", command)
+					lprogram=lprogram.replace(command, '"' + b + '"')
+					batfile=open(os.path.join(wd0,"menu.bat"),"w")
+					batfile.write(lprogram)
+					batfile.close()
+				except:
+					return None
+				lprogram=os.path.join(wd0,"menu.bat")
+		else:
+			lprogram=program
+
+		print "Launching shell program: "+str(lprogram)
+		print
+
+		try:
+			if output:
+				if (sys.platform=="win32") or (sys.platform=="win64"):
+					handle=MyPopen(lprogram,shell=False,bufsize=32767,stdout=subprocess.PIPE, stderr=subprocess.PIPE, creationflags=win32process.CREATE_NO_WINDOW)
+				else:
+					handle=subprocess.Popen(lprogram,shell=True,bufsize=32767,stdout=subprocess.PIPE,stderr=subprocess.PIPE)
+			else:
+				if (sys.platform=="win32") or (sys.platform=="win64"):
+					handle=subprocess.Popen(lprogram,shell=True,stdin=subprocess.PIPE, stdout=subprocess.PIPE, creationflags=win32process.CREATE_NO_WINDOW)
+				else:
+					handle=subprocess.Popen(lprogram,shell=True)
+		except OSError:
+			print "error launching shell\n\n\n\n"
+			pass
+		else:
+			self.handle=handle
+			return handle
+
+		print "Fallo"
+		return None
+
+
+	def launch_program(self,program,read_chars=80,output=True,win32arg=True,with_stderr=True, sep_stderr=False,keep_out=False):
+
+		""" Launches a program that can be located in any of the directories stored in PATHLIST """
+
+		self.read_chars=read_chars
+		self.output=output
+		self.handle=None
+		
+		self.sep_stderr=sep_stderr
+		self.keep_output=keep_out
+
+		wd=sys.path-1: # working directory.  This works with py2exe
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			pathlist=os.path.join(wd0,"bin"),os.path.join(os.getcwd(),"bin"), r'C:\WINDOWS', r'C:\WINDOWS\system32', r'C:\WINNT'
+		else:
+			pathlist="/usr/bin","/usr/local/bin","/usr/share/bin","/usr/share/local/bin","/bin",os.path.join(wd0,"bin")
+
+		print "Launching program: ",
+		for elemento in program:
+			print str(elemento),
+		print
+
+		for elemento in pathlist:
+			print "elemento: ", elemento
+			if elemento-1!=os.sep:
+				elemento+=os.sep
+			try:
+				program2=program:
+				program20=elemento+program20
+				if output:
+					if with_stderr:
+						if (sys.platform=="win32") or (sys.platform=="win64"):
+							handle=MyPopen(program2,executable=program20,shell=False,stdin=subprocess.PIPE, stdout=subprocess.PIPE, stderr=subprocess.PIPE, creationflags=win32process.CREATE_NO_WINDOW, threaded=win32arg, read=read_chars)
+						else:
+							handle=subprocess.Popen(program2,executable=program0,shell=False,bufsize=32767,stdout=subprocess.PIPE,stderr=subprocess.PIPE)
+					else:
+						if (sys.platform=="win32") or (sys.platform=="win64"):
+							handle=MyPopen(program2,executable=program20,shell=False,stdin=subprocess.PIPE, stdout=subprocess.PIPE, creationflags=win32process.CREATE_NO_WINDOW, threaded=False, read=read_chars)
+						else:
+							handle=subprocess.Popen(program2,executable=program0,shell=False,bufsize=32767,stdout=subprocess.PIPE)
+				else:
+					if (sys.platform=="win32") or (sys.platform=="win64"):
+						handle=MyPopen(program2,executable=program20,shell=False,creationflags=win32process.CREATE_NO_WINDOW, threaded=win32arg, read=read_chars)
+					else:
+						handle=subprocess.Popen(program2,executable=program0,shell=False)
+			except OSError:
+				print "error in launch program\n"
+				pass
+			else:
+				self.handle=handle
+				if (sys.platform=="win32") or (sys.platform=="win64"):
+					handle.set_priority()
+				return handle
+		return None
+
+
+	def refresh(self):
+		
+		""" Reads STDOUT and STDERR and refreshes the progress bar. """
+
+		if self.handle==None:
+			return -1 # there's no program running
+		
+		if self.output==False: # if we don't want to read the output...
+			if (self.bar!=None):
+				self.bar.pulse() # just PULSE the progress bar
+			if self.handle.poll()==None:
+				return 0 # if the program didn't end, return 0
+			else:
+				return 1 # and 1 if the program ended
+		
+		ret_value=1
+		while self.handle.poll()==None:
+			ret_value=0
+			if self.read_line_from_output():
+				break
+			
+		if (self.set_progress_bar()): # progress_bar is defined in each subclass to fit the format
+			self.cadena=""
+		
+		if ret_value==1: # read what remains in the STDOUT and STDERR queues
+			r1,r2=self.handle.communicate()
+			self.cadena+=r1
+			if (self.sep_stderr):
+				self.err_cadena+=r2
+			else:
+				self.cadena+=r2
+			if (self.printout):
+				print r1,
+			print r2,
+		
+		return ret_value # 0: nothing to read; 1: program ended
+
+	
+
+	def read_line_from_output(self):
+		if self.platform_win32:
+			v1 = self.handle.recv_some()
+		else:
+			v1,v2,v3=select.select(self.handle.stderr,self.handle.stdout,,,0)
+
+		if len(v1)==0:
+			return True # nothing to read, so get out of the WHILE loop
+		
+		for element in v1:
+			if (sys.platform=="win32") or (sys.platform=="win64"):
+				readed = element#0,self.read_chars
+				if (self.sep_stderr) and (element==self.handle.stderr):
+					self.err_cadena+=readed
+				else:
+					self.cadena+=readed
+				if (self.printout) or (element==self.handle.stderr):
+					print readed,
+				break # this break statement and setting the priority lower in launch_program makes devede work a lot better on windows
+			else:
+				readed=element.readline(self.read_chars)
+				if (self.sep_stderr) and (element==self.handle.stderr):
+					self.err_cadena+=readed
+				else:
+					self.cadena+=readed
+				if (self.printout) or (element==self.handle.stderr):
+					print readed,
+
+		return False
+	
+
+	def set_progress_bar(self):
+		
+		# By default, just do nothing
+		if self.filename!=None:
+			self.bar.pulse()
+
+		if self.keep_output:
+			return False
+		else:
+			return True
+
+
+	def create_filename(self,filename,title,file,avi):
+
+		""" Starting from the generic filename, adds the title and chapter numbers and the extension """
+
+		currentfile=filename+"_"
+		if title<10:
+			currentfile+="0"
+		currentfile+=str(title)+"_"
+
+		if file<10:
+			currentfile+="0"
+
+		if avi:
+			currentfile+=str(file)+'.avi'
+		else:
+			currentfile+=str(file)+'.mpg'
+		return currentfile
+
+
+	def remove_ansi(self,line):
+		
+		output=""
+		while True:
+			pos=line.find("\033") # try with double-byte ESC
+			jump=2
+			if pos==-1:
+				pos=line.find("\233") # if not, try with single-byte ESC
+				jump=1
+			if pos==-1: # no ANSI characters; we ended
+				output+=line
+				break
+			
+			output+=line:pos
+			line=linepos+jump:
+
+			while True:
+				if len(line)==0:
+					break
+				if (ord(line0)<64) or (ord(line0)>126):
+					line=line1:
+				else:
+					line=line1:
+					break
+		return output
+
+
+class MyPopen(subprocess.Popen):
+
+	class Sender(gobject.GObject):
+		def __init__(self):
+			self.__gobject_init__()
+	
+	class PipeThread(threading.Thread):
+		def __init__(self, parent, fin, chars=80):
+			threading.Thread.__init__(self)
+			self.chars=chars
+			self.fin = fin
+			self.sout = 
+			self.parent = parent
+			self.sender = parent.Sender()
+			self.sender.connect("z_signal", parent.read_callback)
+			#self.sout = ""
+			
+		def run(self):
+			self.sender.connect("z_signal", self.parent.read_callback)
+			while True:
+				try:
+					timer = threading.Timer(10, self.__alarm_handler)
+					temp=self.fin.read(self.chars)
+					if not temp: self.sout.append("")
+					if not temp: break
+					self.sender.emit("z_signal", temp)
+					timer.cancel()
+				except Exception, e:
+					if not str(e) == 'timeout':  # something else went wrong ..
+						pass
+						#raise # got the timeout exception from alarm .. proc is hung; kill it
+					break
+					
+		def __alarm_handler(self):
+			print "Process read timeout exception"
+			raise Exception("timeout")
+
+		def get_output(self):
+			return self.sout
+				
+		def reset(self):
+			self.sout = 
+			#self.sout = ""
+		
+	def __init__(self, args=None, bufsize=0, executable=None, stdin=None, stdout=None, stderr=None, preexec_fn=None, close_fds=False, shell=False, cwd=None, env=None, universal_newlines=False, startupinfo=None, creationflags=0, threaded=True, read=80):
+		subprocess.Popen.__init__(self,args=args, bufsize=bufsize, executable=executable, stdin=stdin, stdout=stdout, stderr=stderr, preexec_fn=preexec_fn, close_fds=close_fds, shell=shell, cwd=cwd, env=env, universal_newlines=universal_newlines, startupinfo=startupinfo, creationflags=creationflags)
+		
+		self.sout = 
+		self.lock = threading.Lock()
+		
+		if not threaded:
+			pass
+		else:
+			try:
+				gobject.type_register(self.Sender)
+				gobject.signal_new("z_signal", self.Sender, gobject.SIGNAL_RUN_FIRST, gobject.TYPE_NONE, (object,))
+			except:
+				print "Error registering z_signal"
+			
+			self.out_pipe, self.err_pipe = self.PipeThread(self, self.stdout, read), self.PipeThread(self, self.stderr)
+			self.out_pipe.start(), self.err_pipe.start()
+	
+	def read_callback(self, object, data):
+		self.__set_data(data)
+		#print "Data Received:", data
+	
+	def __set_data(self, data):
+		
+		self.lock.acquire()
+		self.sout.append(data)
+		self.lock.release()
+		
+	def __get_data(self):
+		self.lock.acquire()
+		out = self.sout
+		self.sout = 
+		self.lock.release()
+		return out
+	
+	def is_data(self):
+		self.lock.acquire()
+		value = self.sout
+		self.lock.release()
+		if len(value) > 0:
+			return True
+		return False
+	
+	def recv_some(self):
+		"""
+		Returns a copy of the lists holding stdout and stderr
+		Before returning it clears the original lists
+		"""
+
+		out = self.__get_data()
+		time.sleep(0.02)
+		return out #out, err
+
+
+	def set_priority(self, pid=None, priority=0):
+
+		"""
+		Set the Priority of a Windows Process.  Priority is a value between 0-5 where
+		2 is normal priority.  Defaults to lowest Priority.
+		"""
+		priority_classes=win32process.IDLE_PRIORITY_CLASS,
+						  win32process.BELOW_NORMAL_PRIORITY_CLASS,
+						  win32process.NORMAL_PRIORITY_CLASS,
+						  win32process.ABOVE_NORMAL_PRIORITY_CLASS,
+						  win32process.HIGH_PRIORITY_CLASS,
+						  win32process.REALTIME_PRIORITY_CLASS
+		if pid == None:
+			pid=self.pid
+		handle = win32api.OpenProcess(win32con.PROCESS_ALL_ACCESS, True, pid)
+		win32process.SetPriorityClass(handle, priority_classespriority)

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_ffmpeg_convert.py Added

@@ -0,0 +1,614 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+import signal
+import os
+import sys
+import re
+import shutil
+import math
+
+import devede_other
+
+import devede_executor
+
+if (sys.platform == "win32") or (sys.platform=="win64"):
+	import win32file
+
+
+class video_converter_ffmpeg(devede_executor.executor):
+	
+	def adjust_audiorate(self,audiorate,isdvd):
+		
+		""" Just in case, we choose the nearest legal value """
+
+		if isdvd:
+			values=448,384,320,256,224,192,160,128,112,96,80,64,56,48,32
+		else:
+			values=384,320,256,224,192,160,128,112,96,80,64,56,48,32
+		
+		for element in values:
+			if audiorate>=element:
+				return element
+
+		return 32
+
+	
+	def __init__(self,global_vars,videofile,filename,filefolder,progresbar,proglabel,disctype,title,chapter,threads,seconds,encpass,fix_ac3):
+
+		""" This class converts a video file to MPEG-1 or MPEG-2 format
+
+		VIDEOFILE contains the parameters to convert the video
+		FILENAME is the generic file name given by the user
+		FILEFOLDER is the path where all the temporary and finall files will be created
+		PROGRESBAR is the progress bar where the class will show the progress
+		PROGLABEL is the label where the class will show what is it doing
+		DISCTYPE can be dvd, vcd, svcd, cvd or divx
+		TITLE and CHAPTER are the numbers used to identify the TITLE and CHAPTER number for this file
+		THREADS is the number of threads to use
+		SECONDS is the number of seconds we want to convert (for previews) 
+		ENCPASS is the number of encoding pass"""
+		
+		devede_executor.executor.__init__(self,filename,filefolder,progresbar)
+		self.printout=False
+
+		self.percent2=120
+		self.film_length=float(videofile"olength")
+		if seconds==0:
+			self.divide=float(videofile"olength")
+			if (videofile"cutting"==1) or (videofile"cutting"==2): # if we want only one half of the file
+				self.divide/=2
+		else:
+			self.divide=float(seconds)
+
+		if self.divide==0:
+			self.divide=1
+
+		self.error=""
+		progresbar.set_fraction(0)
+		progresbar.set_text("")
+		
+		if videofile"ismpeg": # if the file hasn't to be converted, we simply copy or link it
+			self.pulse=True
+			self.print_error=_("File copy failed\nMaybe you ran out of disk space?")
+			if seconds==0:
+				texto=_("Copying the file")+"\n"
+			else:
+				texto=_("Creating preview")+"\n"
+			proglabel.set_text(texto+videofile"filename")
+			currentfile=self.create_filename(filefolder+filename,title,chapter,disctype=="divx")
+		
+			print "\ncurrentfile is: ", currentfile , "\n" 
+
+			try:
+				os.remove(currentfile)
+			except:
+				pass
+
+			if (sys.platform=="win32") or (sys.platform=="win64"):
+				# links do not work on windows, so just copy the file
+				# self.launch_shell('copy "'+videofile"path".replace('"','""')+'" "'+currentfile+'"',output=False)
+				# Only hardlinks are available on 2000 and XP, reparse points are available from vista onwards.
+				win32file.CreateHardLink(currentfile, videofile"path".replace('"','""'))
+			else:
+				if len(videofile"sub_list")==0:
+					self.launch_shell('ln -s "'+videofile"path".replace('"','\\"')+'" "'+currentfile+'"',output=False)
+				else:
+					self.launch_shell('cp "'+videofile"path".replace('"','\\"')+'" "'+currentfile+'"',output=False)
+			return
+
+		isvob=videofile"isvob"
+
+		self.pulse=False
+		if seconds==0:
+			texto=(_("Converting files from title %(title_number)s (pass %(pass_number)s)\n\n%(file_name)s") % {"title_number":str(title),"pass_number":str(encpass),"file_name":videofile"filename"} )
+			proglabel.set_text(texto) #+" "+str(title)+" Pass: "+ str(encpass) +"\n\n"+videofile"filename" )
+		else:
+			texto=_("Creating preview")
+			proglabel.set_text(texto+"\n"+videofile"filename")
+
+		addbars=False
+		framerate=int(videofile"ofps")
+		videorate=int(videofile"vrate")
+		audiorate=self.adjust_audiorate(int(videofile"arate"),disctype=="dvd")
+		
+		audio_final_rate=int(videofile"arateunc")
+		audiodelay=float(videofile"adelay")
+		final_framerate=float(videofile"fps")
+		aspect_ratio_original=videofile"oaspect"
+		aspect_ratio_final=videofile"aspect"
+		resx_final=videofile"width"
+		resy_final=videofile"height"
+		resx_original=videofile"owidth"
+		resy_original=videofile"oheight"
+		copy_audio=videofile"copy_audio"
+		sound51=videofile"sound51"
+		gop12=videofile"gop12"
+		audiostream=videofile"audio_stream"
+		swap_fields=videofile"swap_fields"
+		volume=videofile"volume"
+		audio_tracks=len(videofile"audio_list")
+
+		if (videofile"resolution"==0) and (disctype=="divx"):
+			default_res=True
+		else:
+			default_res=False
+		
+		speed1,speed2=devede_other.get_speedup(videofile)
+		if speed1==speed2:
+			speedup=None
+		else:
+			speedup=str(speed1)+":"+str(speed2)
+	
+		if aspect_ratio_original<1.3:
+			aspect_ratio_original=float(videofile"owidth")/(float(videofile"oheight"))
+		if aspect_ratio_original<1.33333333:
+			aspect_ratio_original=1.33333333
+	
+		max_videorate=int(videorate*2)
+		min_videorate=int(videorate*0.75)
+		
+		dsize,minvid,maxvid=devede_other.get_dvd_size(None,disctype)
+		
+		if max_videorate>maxvid:
+			max_videorate=maxvid
+		if min_videorate<minvid:
+			min_videorate=minvid
+			
+		if videofile"blackbars"==0: # check if has to add black bars
+			addbars=True
+			if (videofile"rotate"==90) or (videofile"rotate"==270):
+				resx_original2=resy_original
+				resy_original2=resx_original
+				aratio=1/aspect_ratio_original
+			else:
+				resx_original2=resx_original
+				resy_original2=resy_original
+				aratio=aspect_ratio_original
+
+			if (resx_original2%2)==1:
+				resx_original2+=1
+			if (resy_original2%2)==1:
+				resy_original2+=1
+			
+			resy_tmp = int(resy_final*aspect_ratio_final/aratio)
+			resx_tmp = int(resx_final*aratio/aspect_ratio_final)
+			
+			
+			if (resx_tmp>resx_final):
+				resx_inter=resx_final
+				resy_inter=resy_tmp
+			else:
+				resx_inter=resx_tmp
+				resy_inter=resy_final
+			
+			#resx_inter=resx_original2
+			#resy_inter=int((resy_original2*aspect_ratio_original)/aspect_ratio_final)
+			if (resx_inter%2)==1:
+				resx_inter-=1
+			if (resy_inter%2)==1:
+				resy_inter-=1
+			
+			#if ((resy_inter<resy_original) or (resy_original+5>resy_inter)):
+			#	addbars=False
+
+		if addbars==False:
+			resx_inter=resx_final
+			resy_inter=resy_final
+		else:
+			if (resx_inter==resx_final):
+				addx=0
+				addy=int((resy_final-resy_inter)/2)
+				if(addy%2)==1:
+					addy+=1
+			else:
+				addy=0
+				addx=int((resx_final-resx_inter)/2)
+				if(addx%2)==1:
+					addx+=1
+					
+		
+		command_var="ffmpeg"
+		#command_var="avconv"
+
+		command_var.append("-i")
+		command_var.append(videofile"path")
+		
+		if (volume!=100):
+			command_var.append("-vol")
+			command_var.append(str((256*volume)/100))
+		
+		if (audiodelay!=0.0) and (copy_audio==False) and (isvob==False):
+			command_var.append("-itsoffset")
+			command_var.append(str(audiodelay))
+			command_var.append("-i")
+			command_var.append(videofile"path")
+			command_var.append("-map")
+			command_var.append("1:0")
+			for l in range(audio_tracks):
+				command_var.append("-map")
+				command_var.append("0"+":"+str(l+1))
+		
+		if (isvob==False):
+			cmd_line=""
+			
+			extra_params=videofile"params_vf" # take the VF extra params
+			while (extra_params!=""):
+				extra_params,new_param=devede_other.get_new_param(extra_params)
+				if (new_param!="") and (new_param!=','):
+					while (len(new_param)>1) and (new_param0==','):
+						new_param=new_param1:
+					while (len(new_param)>1) and (new_param-1==','):
+						new_param=new_param:-1
+					if new_param=="fifo":
+						continue
+					if cmd_line!="":
+						cmd_line+=",fifo,"
+					cmd_line+=new_param
+			
+			if videofile"deinterlace"=="yadif":
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="yadif"
+			
+			vflip=0
+			hflip=0
+	
+			if (videofile"rotate"==90):
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="transpose=1"
+			elif (videofile"rotate"==270):
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="transpose=2"
+			elif (videofile"rotate"==180):
+				vflip=1
+				hflip=1
+			
+			if (videofile"vmirror"):
+				vflip=1-vflip
+			if (videofile"hmirror"):
+				hflip=1-hflip
+	
+			if (vflip==1):
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="vflip"
+			if (hflip==1):
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="hflip"
+			
+			if addbars and ((resx_inter!=resx_original) or (resy_inter!=resy_original)) and (default_res==False):
+				if (cmd_line!=""):
+					cmd_line+=",fifo,"
+				cmd_line+="scale="+str(resx_inter)+":"+str(resy_inter)+",fifo,pad="+str(resx_final)+":"+str(resy_final)+":"+str(addx)+":"+str(addy)+":0x000000"
+			
+			if cmd_line!="":
+				command_var.append("-vf")
+				command_var.append(cmd_line)
+			
+		
+		command_var.append("-y")
+
+		vcd=False
+		
+		if (disctype!="divx"):
+			command_var.append("-target")
+			if (disctype=="dvd"):
+				if final_framerate==30:
+					command_var.append("ntsc-dvd")
+				elif (framerate==24):
+					command_var.append("film-dvd")
+				else:
+					command_var.append("pal-dvd")
+				if (copy_audio==False):
+					command_var.append("-acodec")
+					if fix_ac3:
+						command_var.append("ac3_fixed")
+					else:
+						command_var.append("ac3")
+				#command_var.append("-maxrate")
+				#command_var.append("7000k")
+				#command_var.append("-minrate")
+				#command_var.append("2200k")
+			elif (disctype=="vcd"):
+				vcd=True
+				if final_framerate==30:
+					command_var.append("ntsc-vcd")
+				else:
+					command_var.append("pal-vcd")
+			elif (disctype=="svcd"):
+				if final_framerate==30:
+					command_var.append("ntsc-svcd")
+				else:
+					command_var.append("pal-svcd")
+			elif (disctype=="cvd"):
+				if final_framerate==30:
+					command_var.append("ntsc-svcd")
+				else:
+					command_var.append("pal-svcd")
+		else: # DivX
+			command_var.append("-vcodec")
+			command_var.append("mpeg4")
+			command_var.append("-acodec")
+			command_var.append("libmp3lame")
+			command_var.append("-f")
+			command_var.append("avi")
+		
+		if  (not isvob):
+			command_var.append("-sn") # no subtitles
+
+		if copy_audio or isvob:
+			command_var.append("-acodec")
+			command_var.append("copy")
+		#else:
+		#	if (disctype=="divx"):
+		#		command_var.append("-acodec")
+		#		command_var.append("mp3")
+
+		#if (audiostream!=10000):
+		#	command_var.append("-aid")
+		#	command_var.append(str(audiostream))
+
+		if isvob:
+			command_var.append("-vcodec")
+			command_var.append("copy")
+		
+		if (vcd==False):
+			if final_framerate==30:
+				if (framerate==24) and ((disctype=="dvd") or (disctype=="divx")):
+					str_final_framerate="24000/1001"
+					keyintv=15
+					telecine=True
+				else:
+					str_final_framerate="30000/1001"
+					keyintv=18
+			else:
+				str_final_framerate=str(int(final_framerate))
+				keyintv=15
+		
+		if (disctype=="divx"):
+			command_var.append("-g")
+			command_var.append("300")
+		elif gop12 and (isvob==False):
+			command_var.append("-g")
+			command_var.append("12")
+		
+		command_var.append("-bf")
+		command_var.append("2")
+		command_var.append("-strict")
+		command_var.append("1")
+		
+		if seconds!=0:
+			command_var.append("-t")
+			command_var.append(str(seconds))
+		else:
+			if videofile"cutting"==1: # first half only
+				command_var.append("-t")
+				command_var.append(str(videofile"olength"/2))
+			elif videofile"cutting"==2: # second half only
+				command_var.append("-ss")
+				command_var.append(str((videofile"olength"/2)-5)) # start 5 seconds before
+
+		#if (audiodelay!=0.0) and (copy_audio==False) and (isvob==False):
+		#	command_var.append("-delay")
+		#	command_var.append(str(audiodelay))
+
+		command_var.append("-ac")
+		if (sound51) and ((disctype=="dvd") or (disctype=="divx")):
+			command_var.append("6")
+		else:
+			command_var.append("2")
+
+		#if (isvob==False) and (default_res==False):
+		#	command_var.append("-ofps")
+		#	command_var.append(str_final_framerate)
+
+		if disctype=="divx":
+			command_var.append("-vtag")
+			command_var.append("DX50")
+
+		lineatemp=""
+		acoma=False;
+		
+		#if swap_fields:
+		#	lineatemp+="phase=a"
+		#	acoma=True
+		
+		passlog_var = None
+		
+		if (videofile"deinterlace"!="none") and (videofile"deinterlace"!="yadif") and (isvob==False):
+			command_var.append("-deinterlace")
+			
+		print "Addbars "+str(addbars)+" resx_o "+str(resx_original)+" resy_o "+str(resy_original)
+		print "resx_i "+str(resx_inter)+" resy_i "+str(resy_inter)
+ 
+ 		if (isvob==False) and (vcd==False):
+				command_var.append("-s")
+				command_var.append(str(resx_final)+"x"+str(resy_final))
+
+		# Currently Mencoder supports up to 8 threads
+		if isvob==False:
+			threads
+			
+			if threads>1:
+				command_var.append("-threads")
+				command_var.append(str(threads))
+
+			command_var.append("-trellis")
+			if videofile"trellis":
+				command_var.append("1")
+			else:
+				command_var.append("0")
+		
+			if videofile"mbd"==0:
+				command_var.append("-mbd")
+				command_var.append("0")
+			elif videofile"mbd"==1:
+				command_var.append("-mbd")
+				command_var.append("1")
+			elif videofile"mbd"==2:
+				command_var.append("-mbd")
+				command_var.append("2")
+	
+			if (vcd==False):
+				command_var.append("-b")
+				command_var.append(str(videorate)+"000")
+		
+			#if disctype!="divx":
+			#	lavcopts+=":keyint="+str(keyintv)
+			if(copy_audio==False) and (vcd==False):
+#					lavcopts+=":acodec="
+#					if disctype=="dvd":
+#						if fix_ac3:
+#							lavcopts+="ac3_fixed"
+#						else:
+#							lavcopts+="ac3"
+#					else:
+#						lavcopts+="mp2"
+					#lavcopts+=":abitrate="+str(audiorate)
+				command_var.append("-ab")
+				command_var.append(str(audiorate)+"000")
+
+			if (default_res==False):
+				command_var.append("-aspect")
+				if aspect_ratio_final>1.4:
+					command_var.append("16:9")
+				else:
+					command_var.append("4:3")
+			
+			passlog_var=None
+			if (encpass>0)  and (isvob==False):
+				command_var.append("-pass")
+				command_var.append(str(encpass))
+				passlog_var=os.path.join(filefolder,filename)+".log"
+				if encpass==1:
+					try:
+						os.remove(passlog_var)
+					except:
+						 pass
+					#if videofile"turbo1stpass":
+					#	lavcopts+=":turbo"
+
+#	
+#		if (disctype=="divx") and (copy_audio==False) and (isvob==False):
+#			lameopts="abr:br="+str(audiorate)
+#			command_var.append("-lameopts")
+#			extra_params=videofile"params_lame" # take the LAME extra params
+#			while (extra_params!=""):
+#				extra_params,new_param=devede_other.get_new_param(extra_params)
+#				if (new_param!="") and (new_param!=':'):
+#					while (len(new_param)>1) and (new_param0==':'):
+#						new_param=new_param1:
+#					while (len(new_param)>1) and (new_param-1==':'):
+#						new_param=new_param:-1
+#					lameopts+=":"+new_param
+#			command_var.append(lameopts)
+	
+		currentfile=self.create_filename(filefolder+filename,title,chapter,disctype=="divx")
+
+		if (passlog_var != None) and (isvob==False):
+			command_var.append("-passlogfile")
+			command_var.append(passlog_var)
+
+		if (encpass==1) and (isvob==False):
+			command_var.append("-y")
+			command_var.append("/dev/null")
+		else:
+			command_var.append(currentfile)
+		
+		at=audio_tracks
+		while (at>1):
+			if (volume!=100):
+				command_var.append("-vol")
+				command_var.append(str((256*volume)/100))
+			command_var.append("-newaudio")
+			at-=1
+			
+
+		extra_params=videofile"params" # take the extra params
+		while (extra_params!=""):
+			extra_params,new_param=devede_other.get_new_param(extra_params)
+			if new_param!="":
+				command_var.append(new_param)
+
+		self.print_error=_("Conversion failed.\nIt seems a bug of Mencoder.")
+		if (videofile"params"!="") or (videofile"params_vf"!="") or (videofile"params_lame"!=""):
+			self.print_error+="\n"+_("Also check the extra params passed to Mencoder for syntax errors.")
+		self.error_not_done=True
+		self.launch_program(command_var,read_chars=300)
+		
+
+
+	def end_process(self,eraser,erase_temporal_files):
+
+		return
+
+
+	def getfloat(self,cadena,upper=0):
+		
+		pos=cadena.find(":")
+		upper*=60
+		if (pos==-1):
+			try:
+				val=upper+float(cadena)
+			except:
+				val=upper
+		else:
+			try:
+				val2=upper+float(cadena:pos)
+			except:
+				val2=upper
+			val=self.getfloat(cadenapos+1:,val2)
+		return val
+
+
+	def set_progress_bar(self):
+
+		if self.pulse:
+			self.bar.pulse()
+			return True
+
+		pos=self.cadena.find("time=")
+		if pos==-1:
+			return False # don't erase the string
+		pos2=self.cadena.find("bitrate",pos+5)
+		if pos2==-1:
+			return False
+		
+		cadena2=self.cadenapos+5:pos2
+		
+		valuetemp=self.getfloat(cadena2)
+		
+		value=(100.0*valuetemp)/self.divide
+		if (value!=self.percent2) or (self.percent2==120):
+			if (value)>100.0:
+				value=100.0
+			self.bar.set_fraction(value/100.0)
+			self.bar.set_text(str(int(value))+"%")
+			self.percent2=value
+			if self.error_not_done:
+				self.error_not_done=False
+				self.print_error=_("Conversion failed\nMaybe you ran out of disk space?")
+		return True

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_fonts.py Added

@@ -0,0 +1,89 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2007 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+import os
+import shutil
+import sys
+
+def prepare_devede_font(home,font_path):
+	
+	""" This function copies the default font for subtitles into $HOME/.spumux
+		It's made this way because Red Hat package mandates removing font files
+		from RPM files, so DeVeDe must search in several directories """
+	
+	path_list=font_path,"/usr/share/fonts/truetype/ttf-dejavu/DejaVuSans.ttf","/usr/share/fonts/truetype/ttf-dejavu/dejavusans.ttf"
+	
+	#if our font for subtitles isn't installed, we install it
+
+	exists=True
+	try:
+		if (sys.platform!="win32") and (sys.platform!="win64"):
+			fichero=open(home+".spumux/devedesans.ttf")
+			fichero.close()
+		else: # get home
+			t=os.path.join(os.environ"WINDIR", "Fonts", "devedesans.ttf")
+			fichero=open(t)
+			fichero.close()
+		return True
+	except:
+		exists=False
+		
+	if exists:
+		return
+
+	if (sys.platform!="win32") and (sys.platform!="win64"):
+		try:
+			t=os.path.join(home,".spumux")
+			print "Creating spumux directory"+str(t)
+			os.mkdir(t)
+		except:
+			print "Already existed"
+			pass
+
+	for element in path_list:
+		print element
+		try:
+			if (sys.platform=="win32") or (sys.platform=="win64"):
+				print "win32"
+				t=os.path.join(os.environ"WINDIR", "Fonts" )#=r'C:\WINDOWS\Fonts\\'
+				t2=os.path.join(t,"devedesans.ttf")
+				# spummux needs font in the windows font directory
+				print "\n\nFont Path: " , element
+				print "\n\nT: " , t
+				shutil.copyfile(element,t2)
+			else:
+				print "Hago"
+				t=os.path.join(home,".spumux")
+				t2=os.path.join(t,"devedesans.ttf")
+				print t2
+				shutil.copyfile(element,t2)
+				print "hecho"
+				#handle=subprocess.Popen("mkdir "+home+".spumux",bufsize=8192,shell=True)
+				#handle.wait()
+				#handle=subprocess.Popen("cp "+font_path+" "+home+".spumux/",bufsize=8192,shell=True)
+				#handle.wait()
+			print "retorno"
+			return True
+		except:
+			print "fallo"
+			pass
+		
+	return False
\ No newline at end of file

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_help.py Added

@@ -0,0 +1,39 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2007 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2007 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+import os
+import sys
+import gtk
+import devede_dialogs
+
+import devede_executor
+
+
+class show_help:
+	
+	def __init__(self,gladefile,installpath,filename):
+		
+		file="file://"+os.path.join(installpath,"html",filename)	
+		
+		retval = gtk.show_uri(None,file,gtk.gdk.CURRENT_TIME)
+		if retval==False:
+			msg=devede_dialogs.show_error(gladefile,_("Can't open the help files."))

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_loadsave.py Added

@@ -0,0 +1,336 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+import pygtk # for testing GTK version number
+pygtk.require ('2.0')
+import gtk
+import pickle
+import os
+
+import devede_other
+import devede_dialogs
+import devede_newfiles
+
+class load_save_config:
+	
+	def __init__(self,gladefile,structure,global_vars,tree):
+		
+		self.tree=tree
+		self.gladefile=gladefile
+		self.structure=structure
+		self.global_vars=global_vars
+		
+	def load(self,file_name):
+		
+		""" This method loads a configuration file """
+		
+		self.done = False
+		
+		if (len(self.structure)>1) or (len(self.structure0)>1):
+			w = devede_dialogs.ask_overwrite_onload(self.gladefile)
+			retval = w.run()
+			w = None
+			if retval!=-8:
+				return
+
+		if file_name==None:
+			tree=devede_other.create_tree(self,"wloadconfig",self.gladefile,False)
+			window = tree.get_object("wloadconfig")
+			
+			filter = gtk.FileFilter()
+			filter.add_pattern("*.devede")
+			filter.set_name(".devede")
+			window.add_filter(filter)
+			
+			window.show()
+			retval = window.run()
+			window.hide()
+			if retval!=-5:
+				window.destroy()
+				window = None
+				return
+			
+			file_name=window.get_filename()
+			window.destroy()
+			window = None
+		
+		try:
+			output=open(file_name)
+		except:
+			w = devede_dialogs.show_error(self.gladefile,_("Can't open the file."))
+			w = None
+			return
+	
+		try:
+			values=pickle.load(output)
+		except:
+			w = devede_dialogs.show_error(self.gladefile,_("That file doesn't contain a disc structure."))
+			w = None
+			return
+		
+		if values!="DeVeDe":
+			w = devede_dialogs.show_error(self.gladefile,_("That file doesn't contain a disc structure."))
+			w = None
+			return
+		
+		global_vars2={}
+		try:
+			values=pickle.load(output)
+			global_vars2=pickle.load(output)
+		except:
+			w = devede_dialogs.show_error(self.gladefile,_("That file doesn't contain a DeVeDe structure."))
+			w = None
+			return
+	
+		
+		output.close()
+		
+		not_found=
+		for element in values:
+			for element2 in element1::
+				try:
+					v=os.stat(element2"path")
+				except:
+					not_found.append(str(element2"path"))
+					continue
+				
+				if False==element2.has_key("copy_audio"):
+					element2"copy_audio"=False # for backward compatibility
+				if False==element2.has_key("sound51"):
+					element2"sound51"=False # for backward compatibility
+				if False==element2.has_key("rotate"):
+					element2"rotate"=0
+				if False==element2.has_key("vmirror"):
+					element2"vmirror"=False
+				if False==element2.has_key("hmirror"):
+					element2"hmirror"=False
+				if False==element2.has_key("gop12"):
+					element2"gop12"=True # for backward compatibility
+				if False==element2.has_key("isvob"):
+					element2"isvob"=False # for backward compatibility
+				if False==element2.has_key("swap_fields"):
+					element2"swap_fields"=False # for backward compatibility
+				if False==element2.has_key("twopass"):
+					element2"twopass"=False # for backward compatibility
+				if False==element2.has_key("turbo1stpass"):
+					element2"turbo1stpass"=False # for backward compatibility
+				if False==element2.has_key("subfont_size"):
+					element2"subfont_size"=28 # subtitle font size
+				if False==element2.has_key("volume"):
+					element2"volume"=100 # default volume (in percentage)
+				if False==element2.has_key("force_subs"):
+					element2"force_subs"=False # by default, subtitles aren't forced
+				
+				if False==element2.has_key("audio_stream"):
+					fileprop=devede_newfiles.newfile("","")
+					(fine,audio)=fileprop.read_file_values(element2"path",0)
+					if fine and (audio==0):
+						element2"audio_list"=fileprop.file_values"audio_list"
+						element2"audio_stream"=fileprop.file_values"audio_stream"
+						fileprop=None
+				
+				if False==element2.has_key("sub_list"):
+					element2"sub_list"=
+					if element2"subtitles"!="":
+						tmp={}
+						tmp"subtitles"=element2"subtitles"
+						tmp"sub_codepage"=element2"sub_codepage"
+						tmp"sub_language"="EN (ENGLISH)"
+						tmp"subtitles_up"=element2"subtitles_up"
+						del element2"subtitles"
+						del element2"sub_codepage"
+						del element2"subtitles_up"
+						element2"sub_list".append(tmp)
+				
+	
+		if len(not_found)!=0:
+			t_string=_("Can't find the following movie files. Please, add them and try to load the disc structure again.\n")
+			for element in not_found:
+				t_string+="\n"+element
+			w = devede_dialogs.show_error(self.gladefile,t_string)
+			w = None
+			return
+		
+		try:
+			os.stat(global_vars2"menu_bg")
+		except:
+			w = devede_dialogs.show_error(self.gladefile,_("Can't find the menu background. I'll open the disc structure anyway with the default menu background, so don't forget to fix it before creating the disc."))
+			w = None
+			global_vars2"menu_bg"=os.path.join(self.global_vars"path","backgrounds","default_bg.png")
+			
+		use_default_sound=False
+	
+		if False==global_vars2.has_key("menu_sound"):
+			use_default_sound=True
+		else:
+			if (global_vars2"menu_sound"-11:=="silence.mp3"):
+				global_vars2"menu_sound"=os.path.join(self.global_vars"path","silence.ogg")
+			try:
+				os.stat(global_vars2"menu_sound")
+			except:
+				use_default_sound=True
+				w = devede_dialogs.show_error(self.gladefile,_("Can't find the menu soundtrack file. I'll open the disc structure anyway with a silent soundtrack, so don't forget to fix it before creating the disc."))
+				w = None
+		
+		if (use_default_sound):
+			global_vars2"menu_sound"=os.path.join(self.global_vars"path","silence.ogg")
+
+		if False==global_vars2.has_key("with_menu"):
+			global_vars2"with_menu"=True
+		
+		if False==global_vars2.has_key("menu_halignment"):
+			global_vars2"menu_halignment"=2 # center
+			
+		if False==global_vars2.has_key("menu_shadow_color"):
+			global_vars2"menu_shadow_color"=0,0,0,0
+			
+		if False==global_vars2.has_key("menu_title_shadow"):
+			global_vars2"menu_title_shadow"=0,0,0,0
+
+		test=devede_newfiles.file_get_params()
+		check,channels=test.read_file_values(global_vars2"menu_sound",True)
+		if (check!=False) or (channels!=1):
+			global_vars2"menu_sound"=os.path.join(self.global_vars"path","silence.ogg")
+			w = devede_dialogs.show_error(self.gladefile,_("The menu soundtrack seems damaged. Using the default silent soundtrack."))
+			w = None
+			check,channels=test.read_file_values(global_vars2"menu_sound",True)
+
+		global_vars2"menu_sound_duration"=test.length
+		test=None
+
+		while (len(self.structure)>0):
+			self.structure.pop()
+		
+		for element in values:
+			self.structure.append(element)
+		for element in global_vars2:
+			self.global_varselement=global_vars2element
+		
+		if self.global_vars.has_key("menu_top_margin")==False:
+			self.global_vars"menu_top_margin"=0.125
+			self.global_vars"menu_bottom_margin"=0.125
+			self.global_vars"menu_left_margin"=0.1
+			self.global_vars"menu_right_margin"=0.1
+		
+		if self.global_vars.has_key("menu_bgcolor")==False:
+			self.global_vars"menu_bgcolor"=0,0,0,49152
+			self.global_vars"menu_font_color"=65535,65535,65535
+			self.global_vars"menu_selc_color"=0,65535,65535,65535
+			self.global_vars"menu_alignment"=2 # middle
+
+		if self.global_vars.has_key("menu_title_text")==False:
+			self.global_vars"menu_title_color"=0,0,0,65535
+			self.global_vars"menu_title_text"=""
+			self.global_vars"menu_title_fontname"="Sans 14"
+
+		if global_vars2.has_key("erase_files")==False:
+			w=self.tree.get_object("create_iso")
+			w.set_active(True)
+
+		self.global_vars"struct_name"=file_name # update the path
+		
+		self.done = True
+
+
+	def save(self,mode):
+	
+		""" This method stores the current disc structure in a file. If MODE is True,
+			it will ask before a new name. If it's False and there's a filename
+			(from a previous save), it will overwrite the old file """
+	
+		if mode or (self.global_vars"struct_name"==""):
+			tree=devede_other.create_tree(self,"wsaveconfig",self.gladefile,False)
+			saveconfig=tree.get_object("wsaveconfig")
+			
+			filter=gtk.FileFilter()
+			filter.add_pattern("*.devede")
+			filter.set_name(".devede")
+			saveconfig=tree.get_object("wsaveconfig")
+			saveconfig.add_filter(filter)
+			saveconfig.set_do_overwrite_confirmation(True)
+
+			saveconfig.show()
+			value=saveconfig.run()
+			saveconfig.hide()
+			if value!=-5:
+				saveconfig.destroy()
+				saveconfig=None
+				return
+			fname=saveconfig.get_filename()
+			saveconfig.destroy()
+			saveconfig=None
+			
+			if fname==None:
+				w=devede_dialogs.show_error(self.gladefile,_("No filename"))
+				w=None
+				return
+
+			if (len(fname)<7) or (fname-7:!=".devede"):
+				fname+=".devede"
+
+			self.global_vars"struct_name"=fname
+		
+		try:
+			output=open(self.global_vars"struct_name","wb")
+			id="DeVeDe"
+			pickle.dump(id,output)
+			pickle.dump(self.structure,output)
+			vars={}
+			vars"disctocreate"=self.global_vars"disctocreate"
+			vars"titlecounter"=self.global_vars"titlecounter"
+			vars"do_menu"=self.global_vars"do_menu"
+			vars"with_menu"=self.global_vars"with_menu"
+			vars"menu_widescreen"=self.global_vars"menu_widescreen"
+			vars"PAL"=self.global_vars"PAL"
+			vars"menu_bg"=self.global_vars"menu_bg"
+			vars"menu_sound"=self.global_vars"menu_sound"
+			vars"menu_bgcolor"=self.global_vars"menu_bgcolor"
+			vars"menu_font_color"=self.global_vars"menu_font_color"
+			vars"menu_selc_color"=self.global_vars"menu_selc_color"
+			vars"menu_shadow_color"=self.global_vars"menu_shadow_color"
+			vars"menu_alignment"=self.global_vars"menu_alignment"
+			vars"menu_halignment"=self.global_vars"menu_halignment"
+			vars"struct_name"=self.global_vars"struct_name"
+			vars"fontname"=self.global_vars"fontname"
+			vars"menu_title_color"=self.global_vars"menu_title_color"
+			vars"menu_title_shadow"=self.global_vars"menu_title_shadow"
+			vars"menu_title_text"=self.global_vars"menu_title_text"
+			vars"menu_title_fontname"=self.global_vars"menu_title_fontname"
+			vars"menu_top_margin"=self.global_vars"menu_top_margin"
+			vars"menu_bottom_margin"=self.global_vars"menu_bottom_margin"
+			vars"menu_left_margin"=self.global_vars"menu_left_margin"
+			vars"menu_right_margin"=self.global_vars"menu_right_margin"
+
+			if self.tree.get_object("create_iso").get_active():
+				vars"action_todo"=2
+			elif self.tree.get_object("create_dvd").get_active():
+				vars"action_todo"=1
+			else:
+				vars"action_todo"=0
+
+			print "Action: "+str(vars"action_todo")
+			print "Variables: "+str(vars)
+			pickle.dump(vars,output)
+			output.close()
+		except:
+			w=devede_dialogs.show_error(self.gladefile,_("Can't save the file."))
+			w=None
+

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_main.py Added

@@ -0,0 +1,1024 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+import pygtk # for testing GTK version number
+pygtk.require ('2.0')
+import gtk
+import gobject
+import os
+import sys
+
+import devede_other
+import devede_newfiles
+import devede_dvdmenu
+import devede_loadsave
+import devede_title_properties
+import devede_dialogs
+import devede_convert
+import devede_help
+import devede_settings
+
+if (sys.platform=="win32") or (sys.platform=="win64"):
+	import win32api
+
+class main_window:
+	
+	def __init__(self,global_vars,callback):
+		
+		self.global_vars=global_vars
+		self.gladefile=global_vars"gladefile"
+		
+		self.tree=devede_other.create_tree(self,"wmain",self.gladefile)
+		self.window=self.tree.get_object("wmain")
+
+		self.window.drag_dest_set(0,,0)
+		self.window.connect('drag_drop', self.drop_cb)
+		self.window.connect('drag_motion', self.motion_cb)
+
+		self.global_vars"main_window"=self.window
+		
+		self.list_titles=gtk.TreeStore(gobject.TYPE_PYOBJECT,gobject.TYPE_STRING)
+		self.list_chapters=gtk.TreeStore(gobject.TYPE_PYOBJECT,gobject.TYPE_STRING)
+		
+		ltitles=self.tree.get_object("ltitles")
+		lchapters=self.tree.get_object("lchapters")
+		
+		ltitles.set_model(self.list_titles)
+		lchapters.set_model(self.list_chapters)
+		
+		renderertitles=gtk.CellRendererText()
+		columntitles = gtk.TreeViewColumn("Title", renderertitles, text=1)
+		ltitles.append_column(columntitles)
+		
+		rendererchapters=gtk.CellRendererText()
+		columnchapters = gtk.TreeViewColumn("Title", rendererchapters, text=1)
+		lchapters.append_column(columnchapters)
+		
+		#ltitles.connect("button_release_event",self.on_titleclick)
+		#lchapters.connect("button_release_event",self.on_chapterclick)
+		
+		self.set_default_global()
+		
+		self.callback=callback # callback to call to show again the SELECT_DISK dialog
+		
+		if global_vars"PAL":
+			w=self.tree.get_object("default_pal")
+			os.environ"VIDEO_FORMAT"="PAL"
+		else:
+			w=self.tree.get_object("default_ntsc")
+			os.environ"VIDEO_FORMAT"="NTSC"
+		w.set_active(True)
+		
+		w=self.tree.get_object("add_title")
+		w.get_settings().props.gtk_button_images = True
+		
+		self.window.show()
+
+
+	def motion_cb(self,wid, context, x, y, time):
+		context.drag_status(gtk.gdk.ACTION_COPY, time)
+		return True
+
+
+	def hide(self):
+		if self.window!=None:
+			self.window.hide()
+
+
+	def show(self):
+		if self.window!=None:
+			self.window.show()
+
+
+	def drop_cb(self, wid, context, x, y, time):
+		# Used with windows drag and drop
+		print 'drop'
+		self.have_drag = False
+		if context.targets:
+			wid.drag_get_data(context, context.targets0, time)
+			return True
+		return False
+
+
+	def set_default_global(self):
+		
+		""" Sets the default GLOBAL vars each time the user wants to create a new disc """
+		
+		self.global_vars"action_todo"=2
+		self.global_vars"struct_name"=""
+		self.global_vars"do_menu"=True
+		self.global_vars"with_menu"=True
+		self.global_vars"menu_bg"=os.path.join(self.global_vars"path","backgrounds","default_bg.png")
+		self.global_vars"menu_sound"=os.path.join(self.global_vars"path","silence.ogg")
+		test=devede_newfiles.file_get_params()
+		check,channels=test.read_file_values(self.global_vars"menu_sound",True)
+		if (check!=False) or (channels!=1):
+			self.global_vars"menu_sound_duration"=20
+		else:
+			self.global_vars"menu_sound_duration"=test.length
+		print "Longitud sonido: "+str(test.length)
+		test=None
+		self.global_vars"titlecounter"=2
+		self.current_title_selected=-1
+		self.current_file_selected=-2
+		self.global_vars"fontname"="Sans 12"
+		self.global_vars"menu_bgcolor"=0,0,0,49152
+		self.global_vars"menu_font_color"=65535,65535,65535,65535
+		self.global_vars"menu_selc_color"=0,65535,65535,65535
+		self.global_vars"menu_shadow_color"=0,0,0,0
+		self.global_vars"menu_alignment"=2 # middle
+		self.global_vars"menu_halignment"=2 # center
+		self.global_vars"menu_title_color"=0,0,0,65535
+		self.global_vars"menu_title_shadow"=0,0,0,0
+		self.global_vars"menu_title_text"=""
+		self.global_vars"menu_title_fontname"="Sans 14"
+		
+
+	def set_disc_type(self,delete_structure):
+		
+		""" Changes the interface to adjust to the disk type """
+		
+		if delete_structure:
+			self.structure=
+			self.structure.append(self.create_new_structure(1))
+			self.set_default_global()
+		
+		self.disctocreate = self.global_vars"disctocreate"
+		
+		# choose the default disk type
+		w = self.tree.get_object("dvdsize")
+		if (self.disctocreate == "dvd") or (self.disctocreate == "divx"):
+			w.set_active(4)
+		else:
+			w.set_active(2)
+		
+		w = self.tree.get_object("autosize")
+		if (self.disctocreate == "vcd"):
+			w.hide()
+		else:
+			w.show()
+		
+		w = self.tree.get_object("include_menu")
+		if (self.disctocreate == "dvd"):
+			w.show()
+		else:
+			w.hide()
+		
+		w1 = self.tree.get_object("frame1") # contains the titles
+		w2 = self.tree.get_object("create_dvd") # toggle to create the DVD structure
+		w5 = self.tree.get_object("menuoptions") # button to show the menu options
+		w6 = self.tree.get_object("menu_preview") # button to preview the menu
+		
+		if self.disctocreate == "dvd":
+			w1.show()
+			w2.show()
+			w5.show()
+			w6.show()
+		else:
+			self.global_vars"do_menu" = False
+			w1.hide()
+			w2.hide()
+			w5.hide()
+			w6.hide()
+		
+		w1 = self.tree.get_object("frame5") # ACTION frame
+		w2 = self.tree.get_object("expander2")
+		if self.disctocreate == "divx":
+			w1.hide()
+			self.global_vars"action_todo"=0
+			w = self.tree.get_object("only_convert")
+			w.set_active(True)
+			w2.hide()
+		else:
+			w1.show()
+			if self.global_vars"action_todo"==2:
+				w=self.tree.get_object("create_iso")
+			elif self.global_vars"action_todo"==1:
+				w=self.tree.get_object("create_dvd")
+			else:
+				w=self.tree.get_object("only_convert")
+				self.global_vars"action_todo"=0
+			w.set_active(True)
+			w2.show()
+	
+		# now select the first title and chapter
+		
+		ltitles=self.tree.get_object("ltitles")
+		ltitles.get_selection().select_path( (0,))
+		
+		lchapters=self.tree.get_object("lchapters")
+		lchapters.get_selection().select_path( (0,))
+		
+		# refresh the title and chapter lists		
+		self.refresh_titles()
+		self.refresh_chapters()
+		
+		# set the window title
+		self.set_title()
+		
+		# and set the buttons'status
+		self.set_buttons()
+		
+
+	def get_surface(self,element):
+		
+		""" Return data from a video, to be able to compute the optimal bitrate to fullfill the disk.
+			SIZE is the size in kbytes
+			SURFACE is the surface in square pixels
+			LENGTH is the efective length in seconds
+			AUDIORATE is the audio rate """
+		
+		length = float(element"olength")
+		speed1,speed2=devede_other.get_speedup(element)
+		if (speed1!=speed2): # we are speeding up the film, so we must take it into account
+			length*=((float(speed2))/(float(speed1)))
+
+		if element"cutting"!=0: # we want only half the file
+			length/=2
+
+		surface = float(element"width"*element"height")
+		
+		surface/=84480.0 # normalize surface respect to 352x240
+		
+		if (element"copy_audio"):
+			audiorate=element"oarate"
+		else:
+			audiorate=element"arate"
+
+		if (element"ismpeg"):
+			size=element"filesize"/1000
+		else:
+			size=(length*(element"vrate"+audiorate))/8
+
+		return size,surface,length,audiorate
+	
+
+	# Callbacks
+
+	def on_autosize_clicked(self,widget):
+		
+		""" Adjust the videorate of each file to ensure that the disk usage is optimal """
+		
+		fixed_size=
+		variable_size=
+		
+		# First, set the non-adjustable bitrate videos in a different list
+		
+		for element in self.structure:
+			for element2 in element1::
+				if (element2"ismpeg") or (element2"isvob"):
+					fixed_size.append(element2)
+				else:
+					variable_size.append(element2)
+		
+		discsize,minrate,maxrate=devede_other.get_dvd_size(self.tree,self.disctocreate)	
+		discsize*=1000 # size in kbytes
+		# remove the space needed by menus
+		discsize-=devede_other.calcule_menu_size(self.structure,self.global_vars"menu_sound_duration")
+		
+		size_error=False
+		dowhile=True
+		while(dowhile):
+			dowhile=False
+			v_fixed_size=0
+			for element in fixed_size:
+				size,surface,length,arate = self.get_surface(element)
+				subrate=8*len(element"sub_list")
+				v_fixed_size+=size+int((subrate*element"olength")/8)
+
+			available_size=discsize-v_fixed_size
+				
+			if (available_size<0): # the fixed_size videos need more disk space than the currently available
+				size_error=True
+				break
+			
+			if (len(variable_size)==0):
+				break
+			
+			total_len=0.0
+			total_surface=0.0
+			for element in variable_size:
+				size,surface,length,arate = self.get_surface(element)
+				total_len+=length
+				total_surface+=surface*length
+				
+			for element in variable_size:
+				subrate=8*len(element"sub_list")
+				size,surface,length,arate = self.get_surface(element)
+				videorate=8*(float(available_size))*((surface*length)/total_surface)
+				videorate/=length
+				videorate-=(arate+subrate)
+				element"vrate"=int(videorate)
+				print int(videorate)
+				if videorate<minrate:
+					element"vrate"=minrate
+					dowhile=True
+					fixed_size.append(element)
+					variable_size.remove(element)
+					break
+				if videorate>maxrate:
+					element"vrate"=maxrate
+					dowhile=True
+					fixed_size.append(element)
+					variable_size.remove(element)
+					break
+
+		if size_error:
+			devede_dialogs.show_error(self.gladefile,_("Too many videos for this disc size.\nPlease, select a bigger disc type or remove some videos."))
+		
+		self.set_video_values()
+
+
+	def wmain_delete_event_cb(self,widget,signal):
+	
+		""" Delete callback for main window """
+	
+		self.on_main_cancel_clicked(widget)
+		return True
+	
+	
+	def on_main_cancel_clicked(self,widget):
+	
+		""" Callback for Exit button (in main window) and Quit menu item,
+			where it shows the "Are you sure?" window """
+	
+		window=devede_dialogs.ask_exit(self.gladefile)
+		retval=window.run()
+		window=None
+		if retval==-5:
+			gtk.main_quit()
+		return
+	
+
+	def draganddrop(self,widget,drag_context, x, y, selection, info, time):
+	
+		""" Manages the Drag&Drop in the main window """
+		
+		converter=devede_newfiles.newfile(self.global_vars"PAL",self.disctocreate)
+		
+		list=converter.split_dnd(selection.data)
+		
+		if (len(list)==1): # check if it's a configuration file
+			filename=list0.lower()
+			if len(filename)>6:
+				if filename-7:==".devede":
+					self.on_devede_open_activate(None, list0)
+					drag_context.finish(True,False,time)
+					return
+		
+		fine=True
+		list2=
+		for element in list:
+			done,audio=converter.create_default_video_parameters(element) # check if files are videos
+			print done
+			print audio
+			if (done==False):
+				fine=False
+				break
+			list2.append(converter.file_properties)
+		
+		if fine:
+			title,chapter=self.get_marked()
+			element=self.structuretitle
+			for element2 in list2:
+				element.append(element2)
+			self.refresh_chapters()
+			self.set_buttons()
+		else:
+			error=devede_dialogs.show_error(self.gladefile,_("Some files weren't video files.\nNone added."))
+			error=None
+		drag_context.finish(True,False,time)
+	
+	
+	def on_default_pal_toggled(self,widget):
+		
+		if widget.get_active():
+			self.global_vars"PAL"=True
+			os.environ"VIDEO_FORMAT"="PAL"
+		else:
+			self.global_vars"PAL"=False
+			os.environ"VIDEO_FORMAT"="NTSC"
+		print "PAL: "+str(self.global_vars"PAL")
+	
+	
+	def on_chapterclick(self,widget,event,step=None):
+	
+		""" Callback for click event in the chapter list. It
+		sets the buttons and film info """
+	
+		self.set_buttons()
+	
+	
+	def on_dvdsize_changed(self,widget):
+
+		""" This function is called when the user changes the media size """
+
+		self.set_video_values()
+	
+	
+	def on_include_menu_toggled(self,widget):
+		
+		w1=self.tree.get_object("menuoptions")
+		w2=self.tree.get_object("menu_preview")
+		status=widget.get_active()
+		w1.set_sensitive(status)
+		w2.set_sensitive(status)
+		self.global_vars"with_menu"=status
+	
+	
+	def on_main_go_clicked(self,widget):
+
+		total=0
+		for title in self.structure:
+			total+=len(title)-1
+	
+		maxtitles=devede_other.get_max_titles(self.disctocreate)
+		if total>maxtitles:
+			devede_dialogs.show_error(self.gladefile,(_("Your project contains %(X)d movie files, but the maximum is %(MAX)d. Please, remove some files and try again.")) % {"X":total , "MAX":maxtitles})
+			return
+	
+		actions=0	
+		w=self.tree.get_object("only_convert")
+		if w.get_active():
+			actions=1
+		else:
+			w=self.tree.get_object("create_dvd")
+			if (w.get_active()) or ((self.disctocreate!="dvd") and (self.disctocreate!="divx")):
+				actions=2
+			else:
+				actions=3
+	
+		self.global_vars"number_actions"=actions
+		
+		self.global_vars"erase_temporary_files"=self.global_vars"erase_files"
+		
+		print "Threads: "+str(self.global_vars"multicore")
+		conversor=devede_convert.create_all(self.gladefile,self.structure,self.global_vars,self.callback2)
+		if conversor.create_disc():
+			self.window.hide()
+	
+	
+	# titles-related callbacks
+	
+	
+	def on_titleclick(self,widget,event,step=None):
+	
+		""" Callback for click event in the title list. It refreshes the chapters
+		and sets the buttons and film info """
+	
+		self.refresh_chapters()
+		self.set_buttons()
+	
+	
+	def on_add_title_clicked(self,widget):
+
+		""" Callback for "Add title" button. It adds a new title and
+		refreshes the list of titles """
+	
+		self.structure.append(self.create_new_structure(self.global_vars"titlecounter"))
+		self.global_vars"titlecounter"+=1
+		self.current_title_selected=10000 # to ensure that we select the newly created
+		self.refresh_titles()
+		self.refresh_chapters()
+		self.set_buttons()
+	
+	
+	def on_del_title_clicked(self,widget):
+	
+		""" Callback for "Delete title" button. It asks the user if
+		is sure """
+	
+		title,chapter=self.get_marked()
+		window=devede_dialogs.ask_delete_title(self.structuretitle0"nombre",self.gladefile)
+		retval=window.run()
+		window=None
+		if retval==-6:
+			return
+		title,chapter=self.get_marked()
+		self.structure.pop(title)
+		self.refresh_titles()
+		self.refresh_chapters()
+		self.set_buttons()
+	
+	
+	def on_titleup_clicked(self,widget):
+
+		""" Moves a title up in the list """
+	
+		title,chapter=self.get_marked()
+		
+		temp=self.structuretitle-1
+		self.structuretitle-1=self.structuretitle
+		self.structuretitle=temp
+		
+		self.current_title_selected-=1
+		self.refresh_titles()
+		self.refresh_chapters()
+		self.set_buttons()
+	
+	
+	def on_titledown_clicked(self,widget):
+	
+		""" Moves a title down in the list """
+	
+		title,chapter=self.get_marked()
+		
+		temp=self.structuretitle+1
+		self.structuretitle+1=self.structuretitle
+		self.structuretitle=temp
+		self.current_title_selected+=1
+		self.refresh_titles()
+		self.refresh_chapters()
+		self.set_buttons()
+	
+	
+	def on_prop_titles_clicked(self,widget):
+	
+		title,chapter=self.get_marked()
+		w = devede_title_properties.title_properties(self.gladefile,self.structure,title)
+		w = None
+		self.refresh_titles()
+		self.refresh_chapters()
+	
+	
+	# chapter-related callbacks
+
+
+	def on_add_chapter_clicked(self,widget):
+	
+		""" Callback for the "Add chapter" button """
+	
+		title,chapter=self.get_marked()
+		window=devede_newfiles.file_properties(self.global_vars,title,-1,self.structure,self.refresh_all)
+		
+	
+	def on_prop_chapter_clicked(self,widget):
+	
+		""" Callback for the "Modify chapter" button """
+	
+		title,chapter=self.get_marked()
+		window=devede_newfiles.file_properties(self.global_vars,title,chapter,self.structure,self.refresh_all)
+
+
+	def on_del_chapter_clicked(self,widget):
+		
+		title,chapter=self.get_marked()
+				
+		w=devede_dialogs.ask_delete_chapter(self.structuretitlechapter"filename",self.gladefile)
+		retval=w.run()
+		w=None
+		if retval!=-5:
+			return
+		
+		self.structuretitle.pop(chapter)
+	
+		self.refresh_chapters()
+		self.set_buttons()
+
+
+	def on_main_preview_clicked(self,widget):
+	
+		title,chapter=self.get_marked()
+		self.global_vars"erase_temporary_files"=True
+		self.global_vars"number_actions"=1
+		tmp_structure="",self.structuretitlechapter
+		converter=devede_convert.create_all(self.gladefile,tmp_structure,self.global_vars,self.callback3)
+		converter.preview(self.global_vars"temp_folder")
+
+
+	def callback3(self):
+		
+		""" This method is called after a preview """
+		
+		return None # do nothing
+
+
+	def on_filesup_clicked(self,widget):
+
+		""" Moves a chapter up in the list """
+	
+		title,chapter=self.get_marked()
+		
+		temp=self.structuretitlechapter-1
+		self.structuretitlechapter-1=self.structuretitlechapter
+		self.structuretitlechapter=temp
+		self.current_file_selected-=1
+		self.refresh_chapters()
+		self.set_buttons()
+
+
+	def on_filesdown_clicked(self,widget):
+
+		""" Moves a chapter down in the list """
+	
+		title,chapter=self.get_marked()
+		
+		temp=self.structuretitlechapter+1
+		self.structuretitlechapter+1=self.structuretitlechapter
+		self.structuretitlechapter=temp
+		self.current_file_selected+=1
+		self.refresh_chapters()
+		self.set_buttons()
+
+	
+	# dvd-menu-related callbacks	
+	
+	def on_menu_preview_clicked(self,widget):
+	
+		window=devede_dvdmenu.menu_preview(self.gladefile,self.structure,self.global_vars)
+		window=None
+
+	
+	def on_menuoptions_clicked(self,widget):
+	
+		window=devede_dvdmenu.menu_options(self.gladefile,self.structure,self.global_vars,self.set_video_values)
+		window=None
+	
+
+	# Main menu callbacks
+	
+	def on_devede_about_activate(self,widget):
+		
+		window=devede_dialogs.show_about(self.gladefile)
+		window=None
+	
+	
+	def on_devede_new_activate(self,widget):
+	
+		""" Callback for NEW menu item,	where it asks for confirmation """
+		
+		print self.structure
+		w = devede_dialogs.ask_erase_all(self.gladefile)
+		retval=w.run()
+		w = None
+		if retval==-5:
+			(self.callback)()
+
+	
+	def on_devede_open_activate(self,widget,filename=None):
+		
+		""" Callback for OPEN menu item """
+		
+		load = devede_loadsave.load_save_config(self.gladefile,self.structure,self.global_vars,self.tree)
+		load.load(filename)
+		if load.done==False:
+			load=None
+			return
+		
+		self.set_disc_type(False)
+		self.refresh_titles()
+		self.refresh_chapters()
+		self.set_buttons()
+		self.set_title()
+		if self.global_vars"PAL":
+			w=self.tree.get_object("default_pal")
+			os.environ"VIDEO_FORMAT"="PAL"
+		else:
+			w=self.tree.get_object("default_ntsc")
+			os.environ"VIDEO_FORMAT"="NTSC"
+		w.set_active(True)
+		
+		w=self.tree.get_object("include_menu")
+		print"Con menu: "+str(self.global_vars"with_menu")
+		w.set_active(self.global_vars"with_menu")
+		load=None
+
+	
+	def on_devede_save_activate(self,widget):
+		
+		self.save_file(False)
+
+
+	def on_devede_saveas_activate(self,widget):
+		
+		self.save_file(True)
+
+	
+	def on_main_help_clicked(self,widget):
+		
+		help_class=devede_help.show_help(self.gladefile,self.global_vars"help_path","main.html")
+	
+	
+	def on_help_index_activate(self,widget):
+	
+		help_class=devede_help.show_help(self.gladefile,self.global_vars"help_path","index.html")
+	
+	
+	def on_devede_settings_activate(self,widget):
+		
+		settings=devede_settings.devede_settings(self.gladefile,self.structure,self.global_vars)
+	
+	
+	# help methods
+
+	def callback2(self):
+		
+		""" This method is called when the conversion ends """
+		
+		self.window.show()
+
+
+	def refresh_all(self):
+		
+		self.refresh_chapters()
+		self.set_buttons()
+
+
+	def save_file(self,mode):
+		
+		""" Saves the current structure """
+		
+		save=devede_loadsave.load_save_config(self.gladefile,self.structure,self.global_vars,self.tree)
+		save.save(mode)
+		self.set_title()
+		save=None
+
+
+	def get_marked(self):
+	
+		""" Returns the title and chapter currently marked in the main window """
+	
+		ltitles=self.tree.get_object("ltitles")
+		lchapters=self.tree.get_object("lchapters")
+	
+		try:
+			ctree,iter=ltitles.get_selection().get_selected()
+			title=ctree.get_value(iter,0)
+		except:
+			title=-1
+			
+		try:
+			ctree,iter=lchapters.get_selection().get_selected()
+			chapter=1+ctree.get_value(iter,0) # zero is the Title value
+		except:
+			chapter=-1
+		
+		self.current_title_selected=title
+		self.current_file_selected=chapter
+		
+		return title,chapter
+
+
+	def set_buttons(self):
+	
+		""" Enables or disables the button to create a DVD, and the
+		buttons to move up or down a title or chapter """
+	
+		title,chapter=self.get_marked()
+			
+		if title==-1:
+			title_marked=False
+		else:
+			title_marked=True
+	
+		title_up=self.tree.get_object("titleup")
+		if title==0:
+			title_up.set_sensitive(False)
+		else:
+			title_up.set_sensitive(True)
+		
+		title_down=self.tree.get_object("titledown")
+		if (title+1)==len(self.structure):
+			title_down.set_sensitive(False)
+		else:
+			title_down.set_sensitive(True)
+	
+		if chapter==-1:
+			chapter_marked=False
+		else:
+			chapter_marked=True
+	
+		files_up=self.tree.get_object("filesup")
+		if chapter<2:
+			files_up.set_sensitive(False)
+		else:
+			files_up.set_sensitive(True)
+		
+		files_down=self.tree.get_object("filesdown")
+		if (chapter==-1) or (chapter+1==len(self.structuretitle)):
+			files_down.set_sensitive(False)
+		else:
+			files_down.set_sensitive(True)
+	
+		del_title=self.tree.get_object("del_title")
+		if len(self.structure)>1:
+			del_title.set_sensitive(title_marked)	
+		else:
+			del_title.set_sensitive(False)
+		
+		add_title=self.tree.get_object("add_title")
+		if (len(self.structure)<61):
+			add_title.set_sensitive(True)
+		else:
+			add_title.set_sensitive(False)
+		
+		add_chapter=self.tree.get_object("add_chapter")
+		add_chapter.set_sensitive(title_marked)
+		
+		del_chapter=self.tree.get_object("del_chapter")
+		del_chapter.set_sensitive(chapter_marked)
+		
+		main_preview=self.tree.get_object("main_preview")
+		main_preview.set_sensitive(chapter_marked)
+		
+		prop_chapter=self.tree.get_object("prop_chapter")
+		prop_chapter.set_sensitive(chapter_marked)
+		
+		value=False
+		for element in self.structure:
+			if len(element)>1:
+				value=True
+				break
+	
+		main_go=self.tree.get_object("main_go")
+		main_go.set_sensitive(value)
+		self.set_video_values()
+
+
+	def set_video_values(self):
+	
+		""" Sets the video values in the main window when the user clicks
+		a chapter """
+	
+		title,chapter=self.get_marked()
+		if (chapter!=-1) and (title!=-1) and (title<len(self.structure)) and (chapter<len(self.structuretitle)):
+			found2=self.structuretitle
+			found=found2chapter
+			
+			w=self.tree.get_object("oaspect")
+			if (found"aspect")>1.5:
+				w.set_text("16:9")
+			else:
+				w.set_text("4:3")
+				
+			w=self.tree.get_object("o_size")
+			w.set_text(str(found"owidth")+"x"+str(found"oheight"))
+			
+			w=self.tree.get_object("leng")
+			w.set_text(str(found"olength"))
+			
+			w=self.tree.get_object("vrate")
+			w.set_text(str(found"vrate"))
+			
+			w=self.tree.get_object("arate")
+			w.set_text(str(found"arate"))
+			
+			w=self.tree.get_object("eleng")
+			speed1,speed2=devede_other.get_speedup(found)
+			length=devede_other.calcula_tamano_parcial(found"vrate",found"arate",found"filesize",found"olength",len(found"sub_list"),found"ismpeg",found"isvob",found"cutting",speed1,speed2)
+			#length=int(((found"vrate"+found"arate")*found"olength")/8000)
+			w.set_text(str(int(length/1000)))
+			
+			w=self.tree.get_object("achap")
+			if found"lchapters"==0:
+				w.set_text(_("no chapters"))
+			else:
+				w.set_text(str(int(found"lchapters")))
+			
+			w=self.tree.get_object("video_format")
+			if found"fps"==25:
+				w.set_text("25 (PAL)")
+			elif found"fps"==30:
+				if (found"ofps"==24) and (self.disctocreate!="vcd") and (self.disctocreate!="svcd") and (self.disctocreate!="cvd"):
+					w.set_text("24 (NTSC)")
+				else:
+					w.set_text("30 (NTSC)")
+			else:
+				w.set_text(str(int(found"fps")))
+			
+			w=self.tree.get_object("fsizem")
+			w.set_text(str(found"width")+"x"+str(found"height"))
+
+		else:
+
+			w=self.tree.get_object("oaspect")
+			w.set_text("")
+			w=self.tree.get_object("o_size")
+			w.set_text("")
+			w=self.tree.get_object("leng")
+			w.set_text("")
+			w=self.tree.get_object("vrate")
+			w.set_text("")
+			w=self.tree.get_object("arate")
+			w.set_text("")
+			w=self.tree.get_object("eleng")
+			w.set_text("")
+			w=self.tree.get_object("achap")
+			w.set_text("")
+			w=self.tree.get_object("video_format")
+			w.set_text("")
+			w=self.tree.get_object("fsizem")
+			w.set_text("")
+			
+		total=devede_other.calcula_tamano_total(self.structure,self.global_vars"menu_sound_duration",self.disctocreate)
+		total/=1000
+		
+		tamano,minvrate,maxvrate = devede_other.get_dvd_size(self.tree,self.disctocreate)
+		
+		w=self.tree.get_object("usage")
+		if total>tamano:
+			w.set_fraction(1.0)
+			addv=1
+		else:
+			w.set_fraction(total/tamano)
+			addv=0
+		w.set_text(str(addv+int((total/tamano)*100))+"%")
+
+
+	def set_title(self):
+		
+		""" Sets the window's title, with the current structure name if saved """
+		
+		name=os.path.basename(str(self.global_vars"struct_name"))
+		if name=="":
+			name=_("Unsaved disc structure")
+		self.window.set_title(name+' - DeVeDe')
+
+
+	def refresh_titles(self):
+	
+		""" Refreshes the title list """
+	
+		self.current_file_selected=-1
+		
+		self.list_titles.clear()
+		self.list_chapters.clear()
+			
+		counter=-1
+		for element in self.structure:
+			counter+=1
+			entry=self.list_titles.insert_before(None,None)
+			self.list_titles.set_value(entry,1,element0"nombre")
+			self.list_titles.set_value(entry,0,counter)
+		
+		if counter<self.current_title_selected:
+			self.current_title_selected=counter
+		
+		if self.current_title_selected<0:
+			self.current_title_selected=0
+	
+		ltitles=self.tree.get_object("ltitles")
+		ltitles.get_selection().select_path((self.current_title_selected,))
+
+	
+	def refresh_chapters(self):
+	
+		""" Refreshes the chapter list """
+	
+		file=self.current_file_selected
+		title,file2=self.get_marked()
+		
+		if (title==-1):
+			return
+		
+		if (self.current_file_selected==-1):
+			self.current_file_selected=1
+		else:
+			self.current_file_selected=file
+		
+		self.list_chapters.clear()
+		
+		list=self.structuretitle
+	
+		if len(list)<=1:
+			return
+			
+		counter=0
+		for element in list1::
+			entry=self.list_chapters.insert_before(None,None)
+			self.list_chapters.set_value(entry,1,element"filename")
+			self.list_chapters.set_value(entry,0,counter)
+			counter+=1
+		
+		if counter<self.current_file_selected:
+			self.current_file_selected=counter
+		
+		lchapters=self.tree.get_object("lchapters")
+		lchapters.get_selection().select_path( (self.current_file_selected-1,))
+
+		
+	def create_new_structure(self,number):
+	
+		name=_("Title %(X)d") % {"X":int(number)}
+		var={}
+		var"nombre"=name
+		var"jumpto"="menu" # can be MENU, FIRST, NEXT, LAST or LOOP
+		return var

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_newfiles.py Added

@@ -0,0 +1,1796 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+import os
+import stat
+
+import pygtk # for testing GTK version number
+pygtk.require ('2.0')
+import gtk
+import gobject
+import sys
+import gc
+import copy
+import time
+
+import devede_other
+import devede_executor
+import devede_convert
+import devede_dialogs
+import devede_help
+import math
+
+# How to add new file options:
+
+# In the class NEWFILE, method CREATE_DEFAULT_VIDEO_PARAMETERS, add the new option
+# to the SELF.FILE_PROPERTIES dictionary, setting its default value based in the
+# SELF.FILE_VALUES values (the ones obtained with MPLAYER --IDENTIFY), SELF.PAL (True
+# for PAL output video, False for NTSC output video) and SELF.DISCTOCREATE (DVD, VCD, SVCD
+# CVD or DIVX)
+
+# In the class FILE_PROPERTIES
+
+# In the method GET_WIDGETS, set the parameter value in the SELF.FILE_PROPERTIES
+# dictionary using the widget's current value
+
+# In the method SET_WIDGETS, set the widget's value using the parameter value in
+# SELF.FILE_PROPERTIES
+
+# If the widget must be disabled or enabled under some circumstances (other widgets)
+# set that code in method SET_FILM_BUTTONS
+#
+# Finally, add the needed code in DEVEDE_LOADSAVE.PY to ensure that old project files
+# work fine with the new options
+
+class file_get_params(devede_executor.executor):
+
+
+	def read_file_values(self,filename,check_audio):
+
+		""" Reads the values of the video (width, heigth, fps...) and stores them
+			into file_values.
+		
+		 	Returns (False,AUDIO) if the file is not a video (with AUDIO the number
+		 	of audio tracks)
+		 	
+		 	Returns (True,0) if the file is a right video file """
+		
+		handler=''
+
+		vrate=0
+		arate=0
+		width=0
+		height=0
+		fps=0
+		length=0
+		audio=0
+		video=0
+		audiorate=0
+		aspect_ratio=1.3333333333
+		self.length=0
+
+		# if CHECK_AUDIO is TRUE, we just check if it's an audio file
+
+		if check_audio:
+			nframes=0
+		else:
+			nframes=1
+
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			command="mplayer.exe"
+		else:
+			command="mplayer"
+		launcher=command, "-loop","1","-identify", "-ao", "null", "-vo", "null", "-frames", str(nframes), filename
+		handler=self.launch_program(launcher, win32arg=False,with_stderr=False)
+
+		minimum_audio=10000
+		audio_list=
+		while True:
+			linea=handler.stdout.readline()
+			linea=self.remove_ansi(linea)
+			if linea=="":
+				break
+			position=linea.find("ID_")
+			if position==-1:
+				continue
+			linea=lineaposition:
+			if linea:16=="ID_VIDEO_BITRATE":
+				vrate=int(linea17:)
+			if linea:14=="ID_VIDEO_WIDTH":
+				width=int(linea15:)
+			if linea:15=="ID_VIDEO_HEIGHT":
+				height=int(linea16:)
+			if linea:15=="ID_VIDEO_ASPECT":
+				aspect_ratio=float(linea16:)
+			if linea:12=="ID_VIDEO_FPS":
+				fps2=linea13:
+				while ord(fps2-1)<32:
+					fps2=fps2:-1
+				posic=linea.find(".")
+				if posic==-1:
+					fps=int(linea13:)
+				else:
+					fps=int(linea13:posic)
+					if lineaposic+1=="9":
+						fps+=1
+			if linea:16=="ID_AUDIO_BITRATE":
+				arate=int(linea17:)
+			if linea:13=="ID_AUDIO_RATE":
+				audiorate=int(linea14:)
+			if linea:9=="ID_LENGTH":
+				length=int(float(linea10:))
+			if linea:11=="ID_VIDEO_ID":
+				video+=1
+			if linea:11=="ID_AUDIO_ID":
+				audio+=1
+				audio_track=int(linea12:)
+				if minimum_audio>audio_track:
+					minimum_audio=audio_track
+				audio_list.append(audio_track)
+				
+		handler.wait()
+		
+		if (video==0) or (width==0) or (height==0):
+			if (audio!=0):
+				self.length=length
+				self.audio=audio
+			return False,audio
+		
+		if aspect_ratio==0.0 or math.isnan(aspect_ratio) :
+			aspect_ratio=(float(width))/(float(height))
+			if aspect_ratio<=1.5:
+				aspect_ratio=(4.0/3.0)
+		
+		self.file_values={}
+		self.file_values"vrate"=vrate
+		self.file_values"arate"=arate
+		self.file_values"video_streams"=video
+		self.file_values"audio_streams"=audio
+		self.file_values"width"=width
+		self.file_values"height"=height
+		self.file_values"fps"=fps
+		self.file_values"ofps2"=fps2
+		self.file_values"length"=length
+		self.file_values"aspect_ratio"=aspect_ratio
+		self.file_values"audiorate"=audiorate
+		self.file_values"audio_list"=audio_list
+		self.file_values"audio_stream"=minimum_audio
+		
+		return True,0
+
+class newfile(file_get_params):
+	
+	def __init__(self,pal,disctocreate):
+		""" This class manages every new film added. It reads its parameters (resolution, FPS, number of
+		channels...) and allows to generate the default values, both when choosing manually a file from the
+		Properties window, or when dragging&dropping them into the main window """
+		
+		file_get_params.__init__(self)
+
+		self.pal=pal
+		self.disctocreate=disctocreate
+		self.file_values=None
+		self.file_properties=None
+
+		
+	def get_recomended_resolution(self,vrate,arate,desired_resolution):
+
+		""" Returns the recomended resolution for a video based in its original
+			resolution and the resolution chosed by the user.
+		
+		 	DESIRED_RESOLUTION is a value from 0 to 7:
+		 	0=auto, 1=720x480, 2=704x480, 3=480x480, 4=352x480, 5=352x240
+		 	6=1280x720, 7=1920x1080, 8 160x128
+		 	
+		 	It returns the recomended audio and video rate for that resolution,
+		 	but only if the user hasn't changed them """
+
+		if self.pal:
+			nheigh1=576
+			nheigh2=288
+		else:
+			nheigh1=480
+			nheigh2=240
+
+		if self.file_values==None:
+			return 0,0,False,0,0
+
+		if desired_resolution==0: # default resolution; we have to take the most similar resolution
+			if self.disctocreate=="vcd":
+				resx=352
+				resy=nheigh2
+			elif self.disctocreate=="cvd":
+				resx=352
+				resy=nheigh1
+			elif self.disctocreate=="svcd":
+				resx=480
+				resy=nheigh1
+			else: # dvd o divx
+				if self.file_values"width"<=352:
+					resx=352
+					if self.file_values"height"<=nheigh2:
+						resy=nheigh2
+					else:
+						resy=nheigh1
+				else:
+					resx=720
+					resy=nheigh1
+		elif desired_resolution==1:
+			resx=720
+			resy=nheigh1
+		elif desired_resolution==2:
+			resx=704
+			resy=nheigh1
+		elif desired_resolution==3:
+			resx=480
+			resy=nheigh1
+		elif desired_resolution==4:
+			resx=352
+			resy=nheigh1
+		elif desired_resolution==5:
+			resx=352
+			resy=nheigh2
+		elif desired_resolution==6:
+			resx=1280
+			resy=720
+		elif desired_resolution==7:
+			resx=1920
+			resy=1080
+		elif desired_resolution==8:
+			resx=160
+			resy=128
+	
+		if (((resx==720) and (resy==nheigh1)) or ((self.disctocreate=="divx") and (desired_resolution!=8))) and (self.file_values"aspect_ratio">=1.77):
+			use_widescreen=True
+		else:
+			use_widescreen=False
+
+		if (vrate==5001) or (vrate==3001) or (vrate==2001):
+			if (resx>703):
+				vrate=5001
+			if (resx==480) or ((resx==352) and (resy==nheigh1)):
+				vrate=3001
+			if (resx==352) and (resy==nheigh2):
+				vrate=2001
+			if (self.disctocreate!="dvd") and (self.disctocreate!="divx"):
+				vrate=2001
+		
+		if self.disctocreate=="vcd":
+			vrate=1152
+			arate=224
+
+		return resx,resy,use_widescreen,vrate,arate
+
+
+	def create_default_video_parameters(self,filename):
+
+		""" This method fills the FILE_PROPERTIES property with the default values for the file.
+			It returns False if the file isn't a valid video. The tuple contains the number of sound
+			tracks found, so if it's different from 0, its an audio-only file. """
+
+		if filename==None:
+			return False,0
+
+		isvideo,audio_tracks=self.read_file_values(filename,True)
+		if isvideo==False:
+			return False,audio_tracks
+		isvideo,audio_tracks=self.read_file_values(filename,False) # get all the values in FILE_VALUES
+
+		while filename-1==os.sep:
+			filename=filename:-1
+	
+		nombre=filename
+		while True: # get the filename without the path
+			posic=nombre.find(os.path.sep)
+			if posic==-1:
+				break
+			else:
+				nombre=nombreposic+1:
+	
+		# filename0; path1; width2; heigh3; length4 (seconds); original fps5;
+		# original videorate"oarate"; original audiorate7;
+		# final videorate8; final arate9; final width10; final heigh11;
+		# 0=Black bars, 1=Scale picture 12;
+		# length of chapters13; audio delay"fps"; final fps"arateunc"; original audio rate (uncompressed)"oaspect";
+		# original aspect ratio17; final aspect ratio18;
+		# 0=full length, 1=first half, 2=second half 19;
+		# Resolution: 0=auto, 1=720x480, 2=704x480, 3=480x480, 4=352x480, 5=352x240, 6=1280x720, 7=1920x1080 20
+		# extra parameters 21
+
+		self.file_properties={}
+		self.file_properties"filename"=nombre # filename without path
+		self.file_properties"path"=filename # file with complete path
+		self.file_properties"owidth"=self.file_values"width" # original width
+		self.file_properties"oheight"=self.file_values"height" # original height
+		self.file_properties"olength"=self.file_values"length" # original length (in seconds)
+		self.file_properties"ovrate"=self.file_values"vrate"/1000 # original videorate (in kbytes/second)
+		self.file_properties"oarate"=self.file_values"arate"/1000 # original audiorate (in kbytes/second)
+		self.file_properties"arateunc"=self.file_values"audiorate" # original uncompressed audiorate
+		self.file_properties"oaspect"=self.file_values"aspect_ratio" # original aspect ratio
+		self.file_properties"audio_list"=self.file_values"audio_list":
+		self.file_properties"audio_stream"=self.file_values"audio_stream"
+		
+		if self.pal:
+			self.file_properties"fps"=25
+		else:
+			self.file_properties"fps"=30
+
+		self.file_properties"ofps"=self.file_values"fps"
+		self.file_properties"ofps2"=self.file_values"ofps2"
+		
+		self.file_properties"blackbars"=0 # black bars, no scale
+		self.file_properties"lchapters"=5
+		self.file_properties"adelay"=0 # no audio delay
+		self.file_properties"cutting"=0 # full length
+		self.file_properties"resolution"=0 # output resolution = auto
+		self.file_properties"params"="" # no mencoder extra parameters
+		self.file_properties"params_vf"="" # no mencoder extra VF parameters
+		self.file_properties"params_lavc"="" # no mencoder extra LAVC parameters
+		self.file_properties"params_lame"="" # no mencoder extra LAME parameters
+		self.file_properties"ismpeg"=False # is already an MPEG-2 compliant file
+		self.file_properties"copy_audio"=False # recompress the audio
+		self.file_properties"isvob"=False # recompress both audio and video
+		self.file_properties"swap_fields"=False # swap fields in interlaced videos
+		self.file_properties"subfont_size"=28 # subtitle font size
+		self.file_properties"sound51"=False # don't use 5.1 sound
+		self.file_properties"gop12"=True # GOP of 12 by default to increase compatibility
+		self.file_properties"filesize"=os.stat(filename)stat.ST_SIZE # file size
+		self.file_properties"trellis"=True # use trellis
+		self.file_properties"twopass"=False # two pass encoding
+		self.file_properties"turbo1stpass"=False # use turbo 1st pass on two pass encoding
+		self.file_properties"mbd"=2 # maximum quality
+		self.file_properties"deinterlace"="none" # don't deinterlace
+		self.file_properties"sub_list"=
+		self.file_properties"force_subs"=False
+
+		resx,resy,use_widescreen,vrate,arate=self.get_recomended_resolution(5001, 224, 0)
+		self.file_properties"width"=resx
+		self.file_properties"height"=resy
+		self.file_properties"vrate"=vrate
+		self.file_properties"arate"=arate
+		
+		self.file_properties"rotate"=0 # no rotation
+		self.file_properties"hmirror"=False
+		self.file_properties"vmirror"=False
+
+		if use_widescreen:
+			self.file_properties"aspect"=1.7777777
+		else:
+			self.file_properties"aspect"=1.3333333
+			
+		self.file_properties"volume"=100
+			
+		return True,audio_tracks
+
+
+	def split_dnd(self,data):
+
+		""" Takes the list of files dragged into the window and returns them in a list """
+
+		lista=
+		item=""
+		tempo=""
+		mode=0
+		
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			length=8
+		else:
+			length=7
+		
+		cadena2=""
+		for elemento in data:
+			if (ord(elemento)<32):
+				cadena2+="\n"
+			else:
+				cadena2+=elemento
+		
+		while(True):
+			pos=cadena2.find("file:///")
+			if (pos==-1):
+				break
+			pos2=cadena2.find("\n",pos)
+			if (pos2==-1):
+				cadena=cadena2pos+length:
+				cadena2=""
+			else:
+				cadena=cadena2pos+length:pos2
+				cadena2=cadena2pos2:
+			while (True):
+				pos=cadena.find("%")
+				if (pos==-1):
+					break
+				cadena=cadena:pos+chr(int(cadenapos+1:pos+3,16))+cadenapos+3:
+			lista.append(cadena)
+		
+		
+		print "Dragged files: "+str(lista)
+		return lista
+
+
+##################################################################################
+
+
+class file_properties(newfile):
+
+	""" This class manages the properties window, where the user can choose the properties
+		of each video file """
+	
+	def motion_cb(self,wid, context, x, y, time):
+		context.drag_status(gtk.gdk.ACTION_COPY, time)
+		return True
+	
+	def drop_cb(self, wid, context, x, y, time):
+		# Used with windows drag and drop
+		print 'drop'
+		self.have_drag = False
+		if context.targets:
+			wid.drag_get_data(context, context.targets0, time)
+			return True
+		return False
+	
+	# public methods	
+	
+	def __init__(self,global_vars,title,chapter,structure,callback_refresh):
+		
+		newfile.__init__(self,global_vars"PAL",global_vars"disctocreate")
+		self.gladefile=global_vars"gladefile"
+		self.global_vars=global_vars
+		self.title=title
+		self.chapter=chapter
+		self.structure=structure
+		self.callback_refresh=callback_refresh
+		
+		self.tree=devede_other.create_tree(self,"wfile",self.gladefile)
+		self.window=self.tree.get_object("wfile")
+		self.window.show()
+		self.window.drag_dest_set(0,,0)
+		self.window.connect('drag_drop', self.drop_cb)
+		self.window.connect('drag_motion', self.motion_cb)
+
+		w = self.tree.get_object("expander_advanced")
+		w.set_expanded(self.global_vars"expand_advanced")
+		
+		if global_vars"PAL":
+			w=self.tree.get_object("video_pal")
+		else:
+			w=self.tree.get_object("video_ntsc")
+		w.set_active(True)
+		
+		# Model and view for subtitles
+		# first element: position
+		# second: filename
+		# third: codepage
+		
+		self.sub_model=gtk.ListStore(gobject.TYPE_INT, gobject.TYPE_STRING, gobject.TYPE_STRING, gobject.TYPE_STRING)
+		self.sub_tree=self.tree.get_object("sub_treeview")
+		self.sub_tree.set_model(self.sub_model)
+		render1=gtk.CellRendererText()
+		column1=gtk.TreeViewColumn(_("Subtitle"),render1,text=1)
+		self.sub_tree.append_column(column1)
+		render2=gtk.CellRendererText()
+		column2=gtk.TreeViewColumn(_("Codepage"),render2,text=2)
+		self.sub_tree.append_column(column2)
+		render3=gtk.CellRendererText()
+		column3=gtk.TreeViewColumn(_("Language"),render3,text=3)
+		self.sub_tree.append_column(column3)
+		
+		# Model and view for audio tracks
+		
+		self.audio_model=gtk.ListStore(gobject.TYPE_STRING)
+		self.audio_view=self.tree.get_object("audiotrack")
+		self.audio_view.set_model(self.audio_model)
+		audiorender=gtk.CellRendererText()
+		self.audio_view.pack_start(audiorender,True)
+		self.audio_view.add_attribute(audiorender,"text",0)
+		
+		w1 = self.tree.get_object("subtitles_label")
+		w2 = self.tree.get_object("frame_special")
+		w3 = self.tree.get_object("gop12")
+		w4 = self.tree.get_object("res1280x720")
+		w5 = self.tree.get_object("res1920x1080")
+		w6 = self.tree.get_object("subtitles_list")
+		w7 = self.tree.get_object("res160x128")
+
+		if (self.disctocreate == "divx"):
+			w1.show()
+			w2.hide()
+			w3.hide()
+			w4.show()
+			w5.show()
+			w6.hide()
+			w7.show()
+		else:
+			w1.hide()
+			w2.show()
+			w3.show()
+			w4.hide()
+			w5.hide()
+			w6.show()
+			w7.hide()
+		
+		w=self.tree.get_object("noaudiotracks")
+		w.hide()
+		
+		w=self.tree.get_object("file_split_frame")
+		if (self.disctocreate=="vcd") or (self.disctocreate=="svcd") or (self.disctocreate=="cvd"):
+			w.show()
+		else:
+			w.hide()
+		
+		w = self.tree.get_object("frame_division") # SPLIT THE FILES IN CHAPTERS FOR EASY SEEKING
+		if (self.disctocreate == "dvd"):
+			w.show()
+		else:
+			w.hide()
+		
+		self.set_resolution()
+		self.change_file=False
+		if (self.chapter!=-1): # we want to modify a chapter
+			the_chapter=structuretitlechapter
+			print "Chequeo "+str(the_chapter"path")
+			isvideo,audio_tracks=self.read_file_values(the_chapter"path",True)
+			if isvideo==True:
+				self.read_file_values(the_chapter"path",False) # get all the values in FILE_VALUES
+				self.file_properties=copy.deepcopy(the_chapter)
+				self.change_file=True # we are changing the file name manually
+				w=self.tree.get_object("moviefile")
+				print "Pongo nombre por propiedades"
+				w.set_filename(self.file_properties"path")
+			else:
+				w1.set_sensitive(False)
+		else:
+			if (self.global_vars"filmpath"!=""):
+				w=self.tree.get_object("moviefile")
+				w.set_current_folder(self.global_vars"filmpath")
+		
+		w=self.tree.get_object("moviefile")
+		self.file_filter_videos=gtk.FileFilter()
+		self.file_filter_videos.set_name(_("Video files"))
+		if (sys.platform!="win32") and (sys.platform!="win64"):
+			self.file_filter_videos.add_mime_type("video/*")
+			self.file_filter_videos.add_pattern("*.rmvb")
+		else:
+			self.file_filter_videos.add_custom(gtk.FILE_FILTER_FILENAME|gtk.FILE_FILTER_DISPLAY_NAME, self.custom_video_filter)
+		self.file_filter_all=gtk.FileFilter()
+		self.file_filter_all.set_name(_("All files"))
+		self.file_filter_all.add_pattern("*")
+		print "Anado filtro"
+		w.add_filter(self.file_filter_videos)
+		print "Anado filtro"
+		w.add_filter(self.file_filter_all)
+		self.set_widgets()
+		if (self.chapter!=-1): # we want to modify a chapter
+			self.set_global_values()
+		self.set_film_buttons()
+		if (self.chapter!=-1): # we want to modify a chapter
+			print "Modificando"
+			w=self.tree.get_object("fileaccept")
+			w.set_sensitive(True)
+			w=self.tree.get_object("preview_film")
+			w.set_sensitive(True)
+		
+		print "Fin"
+
+
+	# help methods
+
+	def custom_video_filter(self, filter_info=None, data=None):
+		"""Custom file filter.  Filter for video files when running on win32"""
+		video_types="m2ts","wmv", "avi", "asf", "flv", "bin", "vob", "es", "ps", "pes","qt", "mov", "mp4", "mpg", "mpeg", "rm", "mkv", "nut", "nsv", "vivo", "fli", "yuv4mpeg", "cpk","ogm", "asx", "3gp"
+		if os.path.splitext(filter_info2)11: in video_types:
+			return True
+		return False
+
+
+	def get_desired_resolution(self):
+		
+		""" Returns the resolution desired by the user as a single number """
+		
+		if (self.tree.get_object("res160x128").get_active()):
+			return 8
+		if (self.tree.get_object("res1920x1080").get_active()):
+			return 7
+		if (self.tree.get_object("res1280x720").get_active()):
+			return 6
+		
+		if (self.tree.get_object("res720x480").get_active()):
+			return 1
+		if (self.tree.get_object("res704x480").get_active()):
+			return 2
+		if (self.tree.get_object("res480x480").get_active()):
+			return 3
+		if (self.tree.get_object("res352x480").get_active()):
+			return 4
+		if (self.tree.get_object("res352x240").get_active()):
+			return 5
+		return 0
+
+
+	def adjust_resolution(self):
+		
+		""" Sets the final resolution and bitrate based on the original resolution and the
+			desired one by the user """
+		
+		if self.file_properties==None:
+			return
+		
+		w1=self.tree.get_object("video_rate")
+		vrate=w1.get_value()
+		w2=self.tree.get_object("audio_rate")
+		arate=w2.get_value()
+		resx,resy,use_widescreen,vrate,arate=self.get_recomended_resolution(vrate, arate, self.get_desired_resolution())
+		self.file_properties"width"=resx
+		self.file_properties"height"=resy
+		w1.set_value(vrate)
+		w2.set_value(arate)
+		w=self.tree.get_object("aspect_ratio_4_3")
+		if ((resx<720) or (resy<480)) and (self.disctocreate!="divx"):
+			w.set_active(True)
+
+		if w.get_active():
+			self.file_properties"aspect"=1.3333333
+		else:
+			self.file_properties"aspect"=1.7777777
+			
+
+	def get_widgets(self):
+		
+		""" Fills the file_properties list with the values expressed in the widgets """
+
+		if len(self.file_properties"audio_list")>0:
+			w=self.tree.get_object("audiotrack")
+			pos=w.get_active()
+			if (pos==-1):
+				pos=0
+			self.file_properties"audio_stream"=self.file_properties"audio_list"pos
+			
+
+		w=self.tree.get_object("force_subs")
+		self.file_properties"force_subs"=w.get_active()
+		
+		w=self.tree.get_object("blackbars")
+		if w.get_active():
+			self.file_properties"blackbars"=0
+		else:
+			self.file_properties"blackbars"=1
+	
+		w=self.tree.get_object("trell")
+		self.file_properties"trellis"=w.get_active()
+	
+		w=self.tree.get_object("twopass")
+		self.file_properties"twopass"=w.get_active()
+		
+		w=self.tree.get_object("turbo1stpass")
+		self.file_properties"turbo1stpass"=w.get_active()
+	
+		self.file_properties"mbd"=0
+		w=self.tree.get_object("mbd1")
+		if w.get_active():
+			self.file_properties"mbd"=1
+		w=self.tree.get_object("mbd2")
+		if w.get_active():
+			self.file_properties"mbd"=2
+		
+		self.file_properties"deinterlace"="none"
+		w=self.tree.get_object("deinterlace_lb")
+		if w.get_active():
+			self.file_properties"deinterlace"="lb"
+		w=self.tree.get_object("deinterlace_md")
+		if w.get_active():
+			self.file_properties"deinterlace"="md"
+		w=self.tree.get_object("deinterlace_fd")
+		if w.get_active():
+			self.file_properties"deinterlace"="fd"
+		w=self.tree.get_object("deinterlace_l5")
+		if w.get_active():
+			self.file_properties"deinterlace"="l5"
+		w=self.tree.get_object("deinterlace_yadif")
+		if w.get_active():
+			self.file_properties"deinterlace"="yadif"
+		
+		w=self.tree.get_object("ismpeg")
+		self.file_properties"ismpeg"=w.get_active()
+
+		self.file_properties"swap_fields"=self.tree.get_object("swap_fields").get_active()
+
+		w=self.tree.get_object("copy_audio")
+		self.file_properties"copy_audio"=w.get_active()
+
+		w=self.tree.get_object("isvob")
+		self.file_properties"isvob"=w.get_active()
+
+		w=self.tree.get_object("sound51")
+		self.file_properties"sound51"=w.get_active()
+
+		w=self.tree.get_object("gop12")
+		self.file_properties"gop12"=w.get_active()
+
+		w=self.tree.get_object("do_chapters")
+		if w.get_active():
+			w=self.tree.get_object("chapter_long")
+			self.file_properties"lchapters"=w.get_value()
+		else:
+			self.file_properties"lchapters"=0
+
+		w=self.tree.get_object("subfont_size")
+		self.file_properties"subfont_size"=int(w.get_value())
+	
+		w=self.tree.get_object("audiodelay")
+		self.file_properties"adelay"=float(w.get_value())
+		
+		w=self.tree.get_object("video_rate")
+		self.file_properties"vrate"=int(w.get_value())
+		w=self.tree.get_object("audio_rate")
+		self.file_properties"arate"=int(w.get_value())
+		
+		w=self.tree.get_object("volume_adj")
+		self.file_properties"volume"=int(w.get_value())
+	
+		w=self.tree.get_object("full_length")
+		if w.get_active():
+			self.file_properties"cutting"=0
+		else:
+			w=self.tree.get_object("first_half")
+			if w.get_active():
+				self.file_properties"cutting"=1
+			else:
+				self.file_properties"cutting"=2
+
+		w=self.tree.get_object("video_pal")
+		if w.get_active():
+			self.file_properties"fps"=25
+		else:
+			self.file_properties"fps"=30
+	
+		if (self.disctocreate=="dvd") or (self.disctocreate=="divx"):
+			w=self.tree.get_object("aspect_ratio_16_9")
+			if w.get_active():
+				self.file_properties"aspect"=1.77777777
+			else:
+				self.file_properties"aspect"=1.33333333
+		else:
+			self.file_properties"aspect"=1.33333333
+
+		self.file_properties"resolution"=self.get_desired_resolution()
+	
+		w=self.tree.get_object("custom_params")
+		self.file_properties"params"=w.get_text()
+
+		w=self.tree.get_object("custom_params_vf")
+		self.file_properties"params_vf"=w.get_text()
+		
+		w=self.tree.get_object("custom_params_lavcopts")
+		self.file_properties"params_lavc"=w.get_text()
+		
+		if (self.disctocreate=="divx"):
+			w=self.tree.get_object("custom_params_lameopts")
+			self.file_properties"params_lame"=w.get_text()
+
+		w=self.tree.get_object("rotation0")
+		if w.get_active():
+			self.file_properties"rotate"=0 # no rotation
+		w=self.tree.get_object("rotation90")
+		if w.get_active():
+			self.file_properties"rotate"=90 # rotate 90 degrees clockwise
+		w=self.tree.get_object("rotation180")
+		if w.get_active():
+			self.file_properties"rotate"=180 # rotate 180 degrees
+		w=self.tree.get_object("rotation270")
+		if w.get_active():
+			self.file_properties"rotate"=270 # rotate 90 degrees counter-clockwise
+		
+		w=self.tree.get_object("hmirror")
+		self.file_properties"hmirror"=w.get_active()
+		w=self.tree.get_object("vmirror")
+		self.file_properties"vmirror"=w.get_active()
+
+	# Callbacks
+	
+	def on_reset_volume_clicked(self,widget):
+		w=self.tree.get_object("volume_adj")
+		w.set_value(100)
+		
+	
+	def on_sub_add_clicked(self,widget):
+		
+		window=ask_subtitle(self.gladefile,self.global_vars"filmpath",self.global_vars)
+		ret=window.run()
+		window=None
+		if ret!=None:
+			self.file_properties"sub_list".append(ret)
+			self.refresh_subtitles()
+			self.set_global_values()
+
+	
+	def on_sub_remove_clicked(self,widget):
+		
+		w=self.tree.get_object("sub_treeview")
+		try:
+			ctree,iter=w.get_selection().get_selected()
+			subtitle=ctree.get_value(iter,0)
+		except:
+			subtitle=-1
+			
+		if subtitle==-1:
+			return
+
+		newtree=devede_other.create_tree(self,"wdel_subtitle",self.gladefile,False)
+		window=newtree.get_object("wdel_subtitle")
+		window.show()
+		ret=window.run()
+		window.hide()
+		window.destroy()
+		window=None
+		newtree=None
+		if ret==-5:
+			del (self.file_properties"sub_list")subtitle
+
+		self.refresh_subtitles()
+		self.set_global_values()
+	
+	
+	def on_filecancel_clicked(self,widget):
+
+		w=self.tree.get_object("expander_advanced")
+		self.global_vars"expand_advanced"=w.get_expanded()
+		self.window.destroy()
+		self.window=None
+		gc.collect()
+
+
+	def on_fileaccept_clicked(self,widget):
+		
+		w=self.tree.get_object("expander_advanced")
+		self.global_vars"expand_advanced"=w.get_expanded()
+		self.get_widgets()
+		if self.chapter==-1: # add this file as a new chapter
+			self.structureself.title.append(self.file_properties)
+		else:
+			self.structureself.titleself.chapter=self.file_properties
+		self.window.destroy()
+		self.window=None
+		(self.callback_refresh)()
+		gc.collect()
+
+
+	def on_wfile_delete_event(self,widget,arg2):
+		self.window.destroy()
+		self.window=None
+		gc.collect()
+		return True
+
+
+	def on_wfile_destroy_event(self,widget,arg2):
+		self.window.destroy()
+		self.window=None
+		gc.collect()
+	
+	
+	def on_clear_subtitles_clicked(self,widget):
+		
+		""" clears the subtitle filechooser """
+		
+		w=self.tree.get_object("subtitles_chooser")
+		w.unselect_all()
+	
+
+	def on_moviefile_file_set(self,widget):
+		
+		w=self.tree.get_object("moviefile")
+		filename=widget.get_filename()
+		
+		print "File changed to "+str(filename)
+		
+		if (filename==None) or (filename==""):
+			self.set_widgets()
+			self.set_global_values()
+			self.set_film_buttons()
+			return
+
+		self.global_vars"filmpath"=os.path.split(filename)0
+		
+		if self.change_file:
+			self.set_widgets()
+			self.set_global_values()
+			self.set_film_buttons()
+			self.change_file=False
+			return
+		
+		fine,tracks=self.create_default_video_parameters(filename)
+		if fine==False: # it's not a video file
+			if tracks==0: # it's not a multimedia file
+				devede_dialogs.show_error(self.gladefile,_("File doesn't seem to be a video file."))
+			else:
+				devede_dialogs.show_error(self.gladefile,_("File seems to be an audio file."))
+			w.unselect_all()
+		self.set_widgets()
+		self.set_global_values()
+		self.set_film_buttons()
+
+
+	def on_video_pal_toggled(self,widget):
+		
+		""" Detects the change in the option PAL/NTSC """
+		
+		w=self.tree.get_object("video_pal")
+		self.pal=w.get_active()
+		self.set_resolution()
+		self.adjust_resolution()
+		self.set_global_values()
+
+
+	def on_res_toggled(self,widget):
+		
+		self.adjust_resolution()
+		self.set_global_values()
+		self.set_film_buttons()
+
+
+	def on_length_toggled(self,widget):
+		
+		self.set_global_values()
+
+
+	def on_video_rate_value_changed(self,widget):
+		self.set_global_values()
+		
+
+	def on_audio_rate_value_changed(self,widget):
+		self.set_global_values()
+
+
+	def on_subtitles_chooser_selection_changed(self,widget):
+		self.set_global_values()
+
+
+	def on_aspect_ratio_toggled(self,widget):
+		
+		if self.file_properties==None:
+			return
+		
+		w=self.tree.get_object("aspect_ratio_16_9")
+		if w.get_active()==False:
+			return
+
+		self.set_resolution()
+		if (self.file_properties"width"<720) or (self.file_properties"height"<480):
+			w=self.tree.get_object("res720x480")
+			w.set_active(True)
+
+
+	def on_ismpeg_toggled(self,widget):
+		
+		self.set_film_buttons()
+		self.set_global_values()
+
+
+	def on_copy_audio_toggled(self,widget):
+		
+		self.set_film_buttons()
+		self.set_global_values()
+
+
+	def on_isvob_toggled(self,widget):
+		
+		self.set_film_buttons()
+		self.set_global_values()
+
+	def on_twopass_toggled(self,widget):
+		w = self.tree.get_object("turbo1stpass")
+		if widget.get_active():
+			w.set_sensitive(True)
+		else:
+			w.set_active(False)
+			w.set_sensitive(False)
+			
+	def on_sound51_toggled(self,widget):
+
+		self.set_film_buttons()
+		self.set_global_values()
+
+
+	def on_preview_film_clicked(self,widget):
+
+		self.get_widgets()
+		self.global_vars"erase_temporary_files"=True
+		self.global_vars"number_actions"=1
+		tmp_structure="",self.file_properties
+		converter=devede_convert.create_all(self.gladefile,tmp_structure,self.global_vars,self.callback)
+		converter.preview(self.global_vars"temp_folder")
+
+
+	def on_file_help_clicked(self,widget):
+	
+		help_class=devede_help.show_help(self.gladefile,self.global_vars"help_path","file.html")
+
+
+	def callback(self):
+		
+		""" This method is called after a preview """
+		
+		return None # do nothing
+
+
+	def draganddrop(self,widget,drag_context, x, y, selection, info, time):
+
+		""" Manages the Drag&Drop in the property window """
+
+		sub_extensions3=".sub",".srt",".ssa",".smi",".txt",".aqt",".jss", ".ass"
+		sub_extensions2=".rt",".js"
+
+		lista=self.split_dnd(selection.data)
+
+		if len(lista)==0:
+			return
+
+		if len(lista)>1:
+			devede_dialogs.show_error(self.gladefile,_("Please, add only one file each time."))
+			return
+
+		if self.disctocreate!="divx":
+			print("Entro en subs")
+			filename=str(lista0).lower()
+			if len(filename)>=4:
+				extension3=filename-4:
+				extension2=filename-3:
+				print "Extensiones: "+str(extension3)+" "+str(extension2)
+				if (0!=sub_extensions3.count(extension3)) or (0!=sub_extensions2.count(extension2)): # is a subtitle
+					current_file=self.tree.get_object("moviefile").get_filename()
+					if (current_file=="") or (current_file==None):
+						devede_dialogs.show_error(self.gladefile,_("Please, add a movie file before adding subtitles."))
+						return
+					window=ask_subtitle(self.gladefile,self.global_vars"filmpath",self.global_vars,lista0)
+					ret=window.run()
+					window=None
+					if ret!=None:
+						self.file_properties"sub_list".append(ret)
+						self.refresh_subtitles()
+						self.set_global_values()
+					return
+
+		w=self.tree.get_object("moviefile")
+		print "Adding "+str(lista0)
+		w.set_filename(str(lista0))
+
+
+	# data visualization methods
+
+
+	def set_resolution(self):
+
+		""" Sets the labels with the rigth resolution values, depending
+		if the user selected PAL/SECAM or NTSC """
+
+		if self.pal:
+			res1="288"
+			res2="576"
+		else:
+			res1="240"
+			res2="480"
+
+		w=self.tree.get_object("res720x480")
+		w.set_label("720x"+res2)
+		w=self.tree.get_object("res704x480")
+		w.set_label("704x"+res2)
+		w=self.tree.get_object("res480x480")
+		w.set_label("480x"+res2)
+		w=self.tree.get_object("res352x480")
+		w.set_label("352x"+res2)
+		w=self.tree.get_object("res352x240")
+		w.set_label("352x"+res1)
+
+
+	def set_widgets(self):
+		
+		""" sets the widgets to the values specificated in SELF.FILE_PROPERTIES """
+		
+		dsize,minvid,maxvid=devede_other.get_dvd_size(None,self.disctocreate)
+
+		if self.disctocreate=="vcd":
+			w=self.tree.get_object("video_rate_adj")
+			w.set_value(1152)
+			w=self.tree.get_object("audio_rate_adj")
+			w.set_value(224)
+		elif (self.disctocreate=="svcd") or (self.disctocreate=="cvd"):
+			w=self.tree.get_object("audio_rate_adj")
+			w.set_lower(64)
+			w.set_upper(384)
+			#w.set_range(64,384)
+		else:
+			print "entro en parte critica"
+			w=self.tree.get_object("audio_rate_adj")
+			print "paso por set_lower"
+			w.set_lower(128)
+			w.set_upper(448)
+			#w.set_range(128,448)
+			
+		if self.disctocreate!="vcd":
+			w=self.tree.get_object("video_rate_adj")
+			w.set_lower(minvid)
+			w.set_upper(maxvid)
+			#w.set_range(minvid,maxvid)
+
+		if self.file_properties==None:
+			return
+		
+		w=self.tree.get_object("force_subs")
+		w.set_active(self.file_properties"force_subs")
+
+		w1=self.tree.get_object("aspect_ratio_4_3")
+		w2=self.tree.get_object("aspect_ratio_16_9")
+		w1.set_active(True)
+		print "Activo ASPECT_RATIO"
+		print self.disctocreate
+		if (self.disctocreate=="dvd") or (self.disctocreate=="divx"):
+			w1.set_sensitive(True)
+			w2.set_sensitive(True)
+			if self.file_properties"aspect">1.6:
+				w2.set_active(True)
+			else:
+				w1.set_active(True)
+		else:
+			w1.set_sensitive(False)
+			w2.set_sensitive(False)
+
+		if self.file_properties"resolution"==0: # auto resolution
+			w=self.tree.get_object("resauto")
+		elif self.file_properties"resolution"==1: # 720x480
+			w=self.tree.get_object("res720x480")
+		elif self.file_properties"resolution"==2: # 704x480
+			w=self.tree.get_object("res704x480")
+		elif self.file_properties"resolution"==3: # 480x480
+			w=self.tree.get_object("res480x480")
+		elif self.file_properties"resolution"==4: # 352x480
+			w=self.tree.get_object("res352x480")
+		elif self.file_properties"resolution"==6: # 1280x720
+			w=self.tree.get_object("res1280x720")
+		elif self.file_properties"resolution"==7: # 1920x1080
+			w=self.tree.get_object("res1920x1080")
+		elif self.file_properties"resolution"==8: # 160x128
+			w=self.tree.get_object("res160x128")
+		else:
+			w=self.tree.get_object("res352x240")
+	
+		w.set_active(True)
+	
+		w=self.tree.get_object("trell")
+		w.set_active(self.file_properties"trellis")
+	
+		w=self.tree.get_object("twopass")
+		w.set_active(self.file_properties"twopass")
+		
+		w=self.tree.get_object("turbo1stpass")
+		w.set_active(self.file_properties"turbo1stpass")
+		
+		w.set_sensitive(self.file_properties"twopass")
+		
+		if self.file_properties"mbd"==0:
+			w=self.tree.get_object("mbd")
+		elif self.file_properties"mbd"==1:
+			w=self.tree.get_object("mbd1")
+		else:
+			w=self.tree.get_object("mbd2")
+		w.set_active(True)
+	
+		if self.file_properties"deinterlace"=="none":
+			w=self.tree.get_object("deinterlace")
+		else:
+			w=self.tree.get_object("deinterlace_"+self.file_properties"deinterlace")
+		w.set_active(True)
+	
+		w=self.tree.get_object("volume_adj")
+		w.set_value(self.file_properties"volume")
+	
+		w=self.tree.get_object("ismpeg")
+		w.set_active(self.file_properties"ismpeg")
+
+		w=self.tree.get_object("copy_audio")
+		w.set_active(self.file_properties"copy_audio")
+
+		w=self.tree.get_object("isvob")
+		w.set_active(self.file_properties"isvob")
+	
+		w=self.tree.get_object("sound51")
+		w.set_active(self.file_properties"sound51")
+		
+		w=self.tree.get_object("gop12")
+		w.set_active(self.file_properties"gop12")
+		
+		w=self.tree.get_object("subfont_size")
+		w.set_value(self.file_properties"subfont_size")
+		
+		w=self.tree.get_object("swap_fields")
+		w.set_active(self.file_properties"swap_fields")
+	
+		w=self.tree.get_object("custom_params")
+		w.set_text(self.file_properties"params")
+
+		w=self.tree.get_object("custom_params_lavcopts")
+		w.set_text(self.file_properties"params_lavc")
+		
+		w=self.tree.get_object("custom_params_vf")
+		w.set_text(self.file_properties"params_vf")
+		
+		if (self.disctocreate=="divx"):
+			w=self.tree.get_object("custom_params_lameopts")
+			w.set_text(self.file_properties"params_lame")
+	
+		vrate=self.tree.get_object("video_rate")
+		vrate.set_value(self.file_properties"vrate")
+		arate=self.tree.get_object("audio_rate")
+		arate.set_value(self.file_properties"arate")
+		w=self.tree.get_object("audiodelay")
+		w.set_value(self.file_properties"adelay")
+		if self.file_properties"blackbars"==0:
+			w=self.tree.get_object("blackbars")
+		else:
+			w=self.tree.get_object("scalepict")
+		w.set_active(True)
+		
+		w=self.tree.get_object("do_chapters")
+		if self.file_properties"lchapters"==0:
+			w.set_active(False)
+			w=self.tree.get_object("chapter_long")
+			w.set_sensitive(False)
+		else:
+			w.set_active(True)
+			w=self.tree.get_object("chapter_long")
+			w.set_sensitive(True)
+			w.set_value(self.file_properties"lchapters")
+		
+		if self.file_properties"fps"==25:
+			w=self.tree.get_object("video_pal")
+		else:
+			w=self.tree.get_object("video_ntsc")
+		w.set_active(True)
+	
+		if self.file_properties"cutting"==0:
+			w=self.tree.get_object("full_length")
+		elif self.file_properties"cutting"==1:
+			w=self.tree.get_object("first_half")
+		else:
+			w=self.tree.get_object("second_half")
+		w.set_active(True)
+	
+		print "Rotate: "+str(self.file_properties"rotate")
+		if self.file_properties"rotate"==0:
+			w=self.tree.get_object("rotation0")
+		elif self.file_properties"rotate"==90:
+			w=self.tree.get_object("rotation90")
+		elif self.file_properties"rotate"==180:
+			w=self.tree.get_object("rotation180")
+		elif self.file_properties"rotate"==270:
+			w=self.tree.get_object("rotation270")
+		w.set_active(True)
+		
+		w=self.tree.get_object("hmirror")
+		w.set_active(self.file_properties"hmirror")
+		w=self.tree.get_object("vmirror")
+		w.set_active(self.file_properties"vmirror")
+
+		self.audio_model.clear()
+		if len(self.file_properties"audio_list")>0:
+			w=self.tree.get_object("hasaudiotracks")
+			w.show()
+			w=self.tree.get_object("noaudiotracks")
+			w.hide()
+			position=0
+			for track in self.file_properties"audio_list":
+				print "Meto pista "+str(track)
+				iterator=self.audio_model.insert(position)
+				self.audio_model.set_value(iterator,0,track)
+				position+=1
+			print "Pista seleccionada: "+str(self.file_properties"audio_stream")
+			w=self.tree.get_object("audiotrack")
+			w.set_active(self.file_properties"audio_list".index(self.file_properties"audio_stream"))
+		else:
+			w=self.tree.get_object("hasaudiotracks")
+			w.hide()
+			w=self.tree.get_object("noaudiotracks")
+			w.show()
+
+		self.refresh_subtitles()
+		
+		if ((self.global_vars"encoder_video"=="ffmpeg") or (self.global_vars"encoder_video"=="avconv")):
+			use_ffmpeg=False
+		else:
+			use_ffmpeg=True
+		
+		self.tree.get_object("turbo1stpass").set_visible(use_ffmpeg)
+		self.tree.get_object("deinterlace_md").set_visible(use_ffmpeg)
+		self.tree.get_object("deinterlace_l5").set_visible(use_ffmpeg)
+		self.tree.get_object("deinterlace_lb").set_visible(use_ffmpeg)
+		self.tree.get_object("lavcopts_label").set_visible(use_ffmpeg)
+		self.tree.get_object("lameopts_label").set_visible(use_ffmpeg)
+		self.tree.get_object("custom_params_lavcopts").set_visible(use_ffmpeg)
+		self.tree.get_object("custom_params_lameopts").set_visible(use_ffmpeg)
+		#self.tree.get_object("volume_frame").set_visible(use_ffmpeg)
+		self.tree.get_object("audiotrack_box").set_visible(use_ffmpeg)
+		self.tree.get_object("frame_field_order").set_visible(use_ffmpeg)
+		
+
+	def refresh_subtitles(self):
+
+		self.sub_model.clear()
+		position=0
+		for subtitle in self.file_properties"sub_list":
+			iterator=self.sub_model.insert(position)
+			self.sub_model.set_value(iterator,0,position)
+			name=subtitle"subtitles"
+			while True:
+				pos=name.find(os.sep)
+				if (pos==-1):
+					break
+				name=namepos+1:
+			
+			self.sub_model.set_value(iterator,1,name)
+			self.sub_model.set_value(iterator,2,subtitle"sub_codepage")
+			self.sub_model.set_value(iterator,3,subtitle"sub_language")
+			position+=1
+		w=self.tree.get_object("sub_treeview")
+		w.get_selection().select_path(0)
+		self.set_film_buttons()
+			
+
+	def set_film_buttons(self):
+
+		""" Enables or disables all the buttons, based in the current disk type and other widgets """
+
+		w1=self.tree.get_object("fileaccept")
+		w=self.tree.get_object("moviefile")
+		cfile=w.get_filename()
+		
+		w=self.tree.get_object("preview_film")
+		if (cfile=="") or (cfile==None):
+			w.set_sensitive(False)
+			w1.set_sensitive(False)
+		else:
+			w.set_sensitive(True)
+			w1.set_sensitive(True)
+
+		w0=self.tree.get_object("ismpeg")
+		w0s=w0.get_active()
+		if w0s:
+			grupo2=False
+		else:
+			grupo2=True
+
+		w1=self.tree.get_object("copy_audio")
+		w1s=w1.get_active()
+		if w1s:
+			copy_audio=False
+		else:
+			copy_audio=grupo2
+
+		w2=self.tree.get_object("isvob")
+		w2s=w2.get_active()
+		if w2s:
+			isvob=False
+		else:
+			isvob=grupo2
+
+		if (self.disctocreate!="dvd") and (self.disctocreate!="divx"):
+			w1.set_active(False)
+			w1.set_sensitive(False)
+			sound51=False
+		else:
+			w1.set_sensitive(grupo2)
+			sound51=grupo2
+
+		if w0s:
+			w2.set_sensitive(False)
+			w1.set_sensitive(False)
+		else:
+			w2.set_sensitive(True)
+			w1.set_sensitive(True)
+			if w1s:
+				w2.set_sensitive(False)
+			else:
+				w2.set_sensitive(True)
+				if w2s:
+					w0.set_sensitive(False)
+					w1.set_sensitive(False)
+				else:
+					w1.set_sensitive(True)
+					w0.set_sensitive(True)
+
+		if self.disctocreate =="vcd":
+			grupo1=False
+		else:
+			grupo1=grupo2
+		
+		if (self.disctocreate=="dvd") or (self.disctocreate=="divx"):
+			w=self.tree.get_object("sound51")
+			if w.get_active():
+				w=self.tree.get_object("audio_rate_adj")
+				w.set_lower(384)
+				w.set_upper(448)
+				if w.get_value()<384:
+					w.set_value(384)
+				#w.set_range(384,448)		
+			else:
+				w=self.tree.get_object("audio_rate_adj")
+				w.set_lower(128)
+				w.set_upper(448)
+				#w.set_range(128,448)
+
+		grupo3=grupo2
+		try:
+			if self.file_properties"olength"<60:
+				grupo3=False
+		except:
+			grupo3=False
+
+		w=self.tree.get_object("video_rate")
+		w.set_sensitive(grupo1 and isvob)
+		w=self.tree.get_object("audio_rate")
+		w.set_sensitive(grupo1 and copy_audio and isvob)
+		w=self.tree.get_object("swap_fields")
+		w.set_sensitive(grupo1 and isvob)
+		w=self.tree.get_object("gop12")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("volume_scale")
+		w.set_sensitive(grupo2 and isvob and copy_audio)
+		w=self.tree.get_object("volume_level")
+		w.set_sensitive(grupo2 and isvob and copy_audio)
+		w=self.tree.get_object("reset_volume")
+		w.set_sensitive(grupo2 and isvob and copy_audio)
+		w=self.tree.get_object("sound51")
+		if grupo1==False:
+			w.set_active(False)
+		w.set_sensitive(sound51)
+		w=self.tree.get_object("resauto")
+		w.set_sensitive(grupo1 and isvob)
+		if (w.get_active()) and (self.disctocreate=="divx"):
+			set_aspect=False
+		else:
+			set_aspect=True
+		w=self.tree.get_object("res352x240")
+		w.set_sensitive(grupo1 and isvob)
+		w=self.tree.get_object("res352x480")
+		w.set_sensitive(grupo1 and isvob)
+		w=self.tree.get_object("res480x480")
+		w.set_sensitive(grupo1 and isvob)
+		w=self.tree.get_object("res704x480")
+		w.set_sensitive(grupo1 and isvob)
+		w=self.tree.get_object("res720x480")
+		w.set_sensitive(grupo1 and isvob)
+		
+		w=self.tree.get_object("full_length")
+		w.set_sensitive(grupo3)
+		w=self.tree.get_object("first_half")
+		w.set_sensitive(grupo3)
+		w=self.tree.get_object("second_half")
+		w.set_sensitive(grupo3)
+		w=self.tree.get_object("video_pal")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("video_ntsc")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("audiodelay")
+		w.set_sensitive(copy_audio and isvob)
+		w=self.tree.get_object("blackbars")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("scalepict")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("custom_params")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("custom_params_vf")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("custom_params_lavcopts")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("custom_params_lameopts")
+		w.set_sensitive(copy_audio and isvob)
+		w2=self.tree.get_object("lameopts_label")
+		if self.disctocreate=="divx":
+			w.show()
+			w2.show()
+		else:
+			w.hide()
+			w2.hide()
+
+		w=self.tree.get_object("trell")
+		w.set_sensitive(grupo2 and isvob)
+		
+		w=self.tree.get_object("rotation0")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("rotation90")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("rotation180")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("rotation270")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("hmirror")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("vmirror")
+		w.set_sensitive(grupo2 and isvob)
+		
+		w=self.tree.get_object("mbd")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("mbd1")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("mbd2")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("twopass")
+		w.set_sensitive(grupo2 and isvob)
+		tp = w.get_active()
+		w=self.tree.get_object("turbo1stpass")
+		w.set_sensitive(grupo2 and isvob and tp)
+		w=self.tree.get_object("deinterlace")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("deinterlace_lb")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("deinterlace_md")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("deinterlace_fd")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("deinterlace_l5")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("deinterlace_yadif")
+		w.set_sensitive(grupo2 and isvob)
+		w=self.tree.get_object("audiotrack")
+		w.set_sensitive(grupo2)
+		w1=self.tree.get_object("aspect_ratio_4_3")
+		w2=self.tree.get_object("aspect_ratio_16_9")
+		if (self.disctocreate == "dvd") or (self.disctocreate == "divx"):
+			w1.set_sensitive(grupo2 and isvob and set_aspect)
+			w2.set_sensitive(grupo2 and isvob and set_aspect)
+		else:
+			w1.set_sensitive(False)
+			w2.set_sensitive(False)
+
+		w1=self.tree.get_object("sub_remove")
+		w2=self.tree.get_object("sub_add")
+		try:
+			sub_number=len(self.file_properties"sub_list")
+			if sub_number==0:
+				w1.set_sensitive(False)
+			else:
+				w1.set_sensitive(True)
+			
+			if sub_number>=32:
+				w2.set_sensitive(False)
+			else:
+				w2.set_sensitive(True)
+		except:
+			w1.set_sensitive(False)
+			w2.set_sensitive(False)
+
+
+	def set_global_values(self):
+
+		""" Repaints all the data about the current film, recalculating
+			the size needed and other params """
+		
+		if self.file_properties==None:
+			empty=True
+		else:
+			empty=False
+	
+		w=self.tree.get_object("o_size2")
+		if empty:
+			w.set_text("")
+		else:
+			w.set_text(str(self.file_properties"owidth")+"x"+str(self.file_properties"oheight"))
+
+		w=self.tree.get_object("leng2")
+		if empty:
+			w.set_text("")
+		else:
+			w.set_text(str(self.file_properties"olength"))
+		
+		w=self.tree.get_object("fps")
+		if empty:
+			w.set_text("")
+		else:
+			w.set_text(str(self.file_properties"ofps"))
+
+		w=self.tree.get_object("vrate2")
+		if empty:
+			w.set_text("")
+		else:
+			w.set_text(str(self.file_properties"ovrate"))
+
+		w=self.tree.get_object("arate2")
+		if empty:
+			w.set_text("")
+		else:
+			w.set_text(str(self.file_properties"oarate"))
+	
+		w=self.tree.get_object("video_rate")
+		vrate=w.get_value()
+		w=self.tree.get_object("audio_rate")
+		arate=w.get_value()
+	
+		w=self.tree.get_object("full_length")
+		if w.get_active():
+			divide=False
+			divide2=0
+		else:
+			divide=True
+			divide2=1
+		
+		w=self.tree.get_object("eleng2")
+		if empty:
+			w.set_text("")
+		else:
+			w2=self.tree.get_object("ismpeg")
+			w4=self.tree.get_object("isvob")
+			props={}
+			props"ofps"=self.file_properties"ofps"
+			props"ofps2"=self.file_properties"ofps2"
+			w3=self.tree.get_object("video_pal")
+			if w3.get_active():
+				props"fps"=25
+			else:
+				props"fps"=30
+			w3=self.tree.get_object("copy_audio")
+			props"copy_audio"=w3.get_active()
+			w3=self.tree.get_object("ismpeg")
+			props"ismpeg"=w3.get_active()
+			print "Props: "+str(props)
+			speed1,speed2=devede_other.get_speedup(props)
+			l=devede_other.calcula_tamano_parcial(vrate,arate,self.file_properties"filesize",self.file_properties"olength",len(self.file_properties"sub_list"),w2.get_active(),w4.get_active(),divide2,speed1,speed2)
+			#if w2.get_active():
+			#	l=int(self.file_properties"filesize"/1000000)
+			#else:
+			#	l=int(((vrate+arate)*self.file_properties"olength")/8000)
+			#	if divide:
+			#		l/=2
+			
+			#l+=int((8.0*float(len(self.file_properties"sub_list"))*self.file_properties"olength")/8000.0)
+			w.set_text(str(int(l/1000)))
+		
+		w=self.tree.get_object("f_size2")
+		if empty:
+			w.set_text("")
+		else:
+			w.set_text(str(self.file_properties"width")+"x"+str(self.file_properties"height"))		
+
+
+class ask_subtitle:
+	
+	def __init__(self,gladefile,filepath,gvars,filename=None):
+
+		self.global_vars=gvars
+		self.gladefile=gladefile
+		self.tree=devede_other.create_tree(self,"add_subtitle2",self.gladefile)
+		self.lang_list=
+		self.cpage_list=
+		
+		pos=0
+		self.lang=-1
+		self.asciie=-1
+		self.utf8e=-1
+		self.utf16e=-1
+		self.isoe=-1
+		languages=open(os.path.join(self.gladefile,"languages.lst"),"r")
+		w=self.tree.get_object("sub_language")
+		for element in languages:
+			if element:-1==self.global_vars"sub_language":
+				self.lang=pos
+			w.append_text(element:-1)
+			self.lang_list.append(element:-1)
+			pos+=1
+		languages.close()
+		w.set_active(self.lang)
+		
+		pos=0
+		self.chelement=0
+		codepages=open(os.path.join(self.gladefile,"codepages.lst"),"r")
+		w=self.tree.get_object("sub_codepage")
+		for element in codepages:
+			if element:-1=="ASCII":
+				self.asciie=pos
+			if element:-1=="UTF-8":
+				self.utf8e=pos
+			if element:-1=="UTF-16":
+				self.utf16e=pos
+			if element:-1=="ISO-8859-1":
+				self.isoe=pos
+			if element:-1==self.global_vars"sub_codepage":
+				self.chelement=pos
+			w.append_text(element:-1)
+			self.cpage_list.append(element:-1)
+			pos+=1
+		codepages.close()
+		if self.chelement!=-1:
+			w.set_active(self.chelement)
+		elif (self.utf8e!=-1):
+			w.set_active(self.utf8e)
+		else:
+			w.set_active(self.isoe)
+
+		self.window=self.tree.get_object("add_subtitle")
+		if (filepath!=""):
+			w=self.tree.get_object("subtitles_chooser")
+			w.set_current_folder(filepath)
+		if (filename!=None) and (filename!=""):
+			self.tree.get_object("subtitles_chooser").set_filename(filename)
+		self.window.show()
+		self.set_status()
+
+
+	def on_clear_subtitles_clicked(self,widget):
+
+		file=self.tree.get_object("subtitles_chooser")
+		file.unselect_all()
+
+
+	def on_subtitles_chooser_selection_changed(self,widget):
+		
+		filename=widget.get_filename()
+		if (filename!="") and (filename!=None):
+			w=self.tree.get_object("sub_codepage")
+			autotype=devede_other.check_utf().do_check(filename)
+			print "Subtitles changed to type: "+str(autotype)
+			if autotype=="ascii":
+				w.set_active(self.asciie)
+				self.autotype="ASCII"
+			elif autotype=="utf8":
+				w.set_active(self.utf8e)
+				self.autotype="UTF-8"
+			elif autotype=="utf16":
+				w.set_active(self.utf16e)
+				self.autotype="UTF-16"
+			elif self.chelement!=-1:
+				w.set_active(self.chelement)
+				self.autotype=""
+			else:
+				w.set_active(self.isoe)
+				self.autotype=""
+		self.set_status()
+
+
+	def set_status(self):
+		
+		filename=self.tree.get_object("subtitles_chooser").get_filename()
+		
+		if (filename=="") or (filename==None):
+			status=False
+		else:
+			status=True
+			
+		w=self.tree.get_object("sub_accept")
+		w.set_sensitive(status)
+
+	
+	def run(self):
+		
+		ret=self.window.run()
+		if ret==-5: # OK
+			ret_val={}
+			w=self.tree.get_object("subtitles_chooser")
+			ret_val"subtitles"=w.get_filename()
+			w=self.tree.get_object("sub_codepage")
+			ret_val"sub_codepage"=self.cpage_listw.get_active()
+			if (ret_val"sub_codepage"!=self.autotype) and (ret_val"sub_codepage":3!="UTF"):
+				self.global_vars"sub_codepage"=ret_val"sub_codepage"
+			w=self.tree.get_object("sub_language")
+			ret_val"sub_language"=self.lang_listw.get_active()
+			self.global_vars"sub_language"=ret_val"sub_language"
+			w=self.tree.get_object("sub_up")
+			ret_val"subtitles_up"=w.get_active()
+		else:
+			ret_val=None
+		self.window.hide()
+		self.window.destroy()
+		self.window=None
+		return(ret_val)

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_other.py Added

@@ -0,0 +1,755 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+###########################################################################
+# This block contains generic help functions that are used in the program #
+###########################################################################
+
+import os
+import subprocess
+import stat
+import sys
+import shutil
+import cairo
+import gtk
+import struct
+
+import devede_executor
+
+
+class check_utf(devede_executor.executor):
+	
+	""" This class allows to detect if a file is pure ASCII, UTF-8 or UTF-16, and allows
+		to convert from UTF-16 to UFT-8 """
+	
+	def check_ascii(self,filename):
+		
+		try:
+			file=open(filename,"rb")
+		except:
+			return False
+		
+		while True:
+			element=file.read(1)
+			if len(element)==0:
+				return True
+			if ord(element)>127:
+				return False
+	
+
+	def read_utf8_element(self,file,base_value,nb):
+		
+		value=base_value
+		for counter in range(nb-1):
+			element=file.read(1)
+			if element=="":
+				return False
+			if (ord(element)>191) or (ord(element)<128):
+				return False
+			value*=64 # rotate value 6 bits to the left
+			value+=ord(element)-128
+		return value
+
+	
+	def check_utf8(self,filename):
+		
+		try:
+			file=open(filename,"rb")
+		except:
+			return False
+		
+		while True:
+			el=file.read(1)
+			if el=="":
+				file.close()
+				return True
+			element=ord(el)
+	
+			if element<128:
+				continue
+			
+			if element<194: # it's a mid-sequence element or a 2-byte start sequence for an element smaller than 128
+				print "Elemento 1"
+				file.close()
+				return False # invalid element found
+			
+			if element<224: # two-byte element
+				value=self.read_utf8_element(file,element-192, 2)
+				if value==False:
+					print "Elemento 2"
+					file.close()
+					return False # invalid sequence
+				if value<128:
+					print "Elemento 3"
+					file.close()
+					return False # invalid value for a 2-byte sequence
+				continue
+				
+			if element<240: # three-byte element
+				value=self.read_utf8_element(file,element-224, 3)
+				if value==False:
+					print "Elemento 4"
+					file.close()
+					return False # invalid sequence
+				if value<2048:
+					print "Elemento 5"
+					file.close()
+					return False # invalid value for a 3-byte sequence
+				continue
+			
+			if element<245: # four-byte element
+				value=self.read_utf8_element(file,element-240, 4)
+				if value==False:
+					print "Elemento 6"
+					file.close()
+					return False # invalid sequence
+				if value<65536:
+					print "Elemento 7"
+					file.close()
+					return False # invalid value for a 4-byte sequence
+				continue
+			
+			file.close()
+			return False # invalid value
+
+
+	def read_16(self,file,format_b):
+		element=file.read(2)
+		if element=="":
+			return ""
+		if len(element)!=2:
+			return False
+		value=struct.unpack(format_b,element)0
+		return value
+
+	
+	def read_full16(self,file,format_b):
+		value=self.read_16(file, format_b)
+		if value=="":
+			return True # end of file
+		if value==False:
+			return False
+		if (value>=56320) and (value<=57343): # invalid value
+			return False
+		if (value>55295) and (value<56320): # surrogate pair
+			value-=55296
+			value2=self.read_16(file, format_b)
+			if (value2==False) or (value2==""):
+				return False
+			if (value2<56320) or (value2>57343): # invalid surrogate pair
+				return False
+			value2-=56320
+			return ((value*1024+value2)+65536)
+		else:
+			return value
+	
+	
+	def write_utf8(self,file,value):
+		
+		if value<128:
+			file.write(struct.pack("B",value))
+		elif value<2048:
+			v1=(value/64) & 31
+			v2= value     & 63
+			file.write(struct.pack("BB",v1+192,v2+128))
+		elif value<65536:
+			v1=(value/4096) & 15
+			v2=(value/64)   & 63
+			v3= value       & 63
+			file.write(struct.pack("BBB",v1+224,v2+128,v3+128))
+		else:
+			v1=(value/262143) & 7
+			v2=(value/4096)   & 63
+			v3=(value/64)     & 63
+			v4= value         & 63
+			file.write(struct.pack("BBBB",v1+240,v2+128,v3+128,v4+128))		   
+	
+	
+	def check_utf16BE(self,filename):
+		
+		try:
+			file=open(filename,"rb")
+		except:
+			return False
+		value=self.read_16(file, ">H")
+		file.close()
+		if value==65279:
+			return True
+		return False
+
+
+	def check_utf16LE(self,filename):
+		
+		try:
+		  file=open(filename,"rb")
+		except:
+			return False
+		value=self.read_16(file, "<H")
+		file.close()
+		if value==65279:
+			return True
+		return False
+	
+	
+	def check_utf16(self,filename,big_endian):
+		
+		try:
+			file=open(filename,"rb")
+		except:
+			return False
+		if big_endian:
+			format_b=">H"
+		else:
+			format_b="<H"
+		while True:
+			value=self.read_full16(file, format_b)
+			if value==True:
+				print "True"
+				return True
+			if value==False:
+				print "False"
+				return False
+			# value can be an integer too, that's why I put both IFs
+
+	
+	def convert_to_UTF8(self,infile_n,outfile_n,origin_format):
+		
+		command_line='iconv -f '+str(origin_format)+' -t UTF-8 "'+str(infile_n)+'" > "'+str(outfile_n)+'"'
+		return self.launch_shell(command_line).wait()
+	
+	
+	def convert_16_to_8(self,infile_n,outfile_n):
+		
+		if self.check_utf16BE(infile_n):
+			format_b=">H"
+		else:
+			format_b="<H"
+		
+		infile=open(infile_n,"rb")
+		outfile=open(outfile_n,"wb")
+		
+		first=True
+		while True:
+			value=self.read_full16(infile, format_b)
+			if (value==65279) and first:
+				first=False
+				continue
+			first=False
+			if (value==True) or (value==False):
+				break
+			self.write_utf8(outfile, value)
+		infile.close()
+		outfile.close()
+		return value
+	
+	
+	def do_check(self,filename):
+		
+		""" Checks if a file is pure ASCII, UTF-8, UTF-16 or Unknown """
+		
+		self.type="Unknown"
+		
+		if self.check_ascii(filename):
+			self.type="ascii"
+			return self.type
+		
+		if self.check_utf8(filename):
+			self.type="utf8"
+			return self.type
+		
+		if (self.check_utf16BE(filename)):
+			if (self.check_utf16(filename,True)):
+				self.type="utf16"
+			return self.type 
+		
+		if (self.check_utf16LE(filename)):
+			if (self.check_utf16(filename,False)):
+				self.type="utf16"
+			return self.type
+		
+		return self.type
+
+
+
+def get_speedup(videofile):
+	
+	""" configure speedup values when the original file
+		is 23.976 or 24 fps and final file is 25 fps (PAL)
+		this allows to avoid jerky jumps during reproduction """
+		
+	# First, check if the original is XX.9XX or XX.000 fps
+	
+	rational_fps=False
+	pos=videofile"ofps2".find(".")
+	if (pos!=-1) and (len(videofile"ofps2")>(pos+1)):
+		if (videofile"ofps2"pos+1=="9"):
+			rational_fps=True
+			
+	# if it's rational, we have to use a different pair of values to achieve good precission
+	
+	if (videofile"ofps"==24) and (videofile"fps"==25) and (videofile"copy_audio"==False) and (videofile"ismpeg"==False):
+		if rational_fps:
+			return 25025,24000
+		else:
+			return 25,24
+	else:
+		return 1,1
+
+
+def get_font_params(font_name):
+	
+	font_elements=
+	font_temp=font_name
+
+	font_elements=font_name.split(" ")
+	
+	if (len(font_elements))<2:
+		fontname="Sans"
+		fontstyle=cairo.FONT_WEIGHT_NORMAL
+		fontslant=cairo.FONT_SLANT_NORMAL
+		fontsize=12
+	else:
+		fontname=""
+		fontstyle=cairo.FONT_WEIGHT_NORMAL
+		fontslant=cairo.FONT_SLANT_NORMAL
+		for counter2 in range(len(font_elements)-1):
+			if font_elementscounter2=="Bold":
+				fontstyle=cairo.FONT_WEIGHT_BOLD
+			elif font_elementscounter2=="Italic":
+				fontslant=cairo.FONT_SLANT_ITALIC
+			else:
+				fontname+=" "+font_elementscounter2
+		if fontname!="":
+			fontname=fontname1:
+		else:
+			fontname="Sans"
+
+	try:
+		fontsize=float(font_elements-1)
+	except:
+		fontsize=12
+		
+	return fontname,fontstyle,fontslant,fontsize
+
+
+def calcula_tamano_parcial(vrate,arate,filesize,length,subs,ismpeg,isvob,cutting,speed1,speed2):
+
+	""" Calculates the estimated final size.
+	
+	VRATE and ARATE is the bit rate for video and audio.
+	FILESIZE is the size of the original file.
+	LENGTH is the file length in seconds
+	SUBS is the number of subs
+	ISMPEG is true if the file is already an MPEG-compliant file
+	CUTTING is different than 0 if we are cutting the file in half.
+	
+	"""
+
+	if (speed1!=speed2): # we are speeding up the film, so we must take it into account
+		length=int((float(length))*((float(speed2))/(float(speed1))))
+
+	if ismpeg or isvob:
+		l=filesize/1000
+	else:
+		l=float(((vrate+arate)*length)/8)	
+		if cutting!=0:
+			l/=2
+	l+=float((8*subs*length)/8) # add the subtitles (assume 8kbit/sec for each one)
+	return l
+
+
+def calcule_menu_size(structure,sound_duration):
+
+	# each menu needs 2692 kbits/sec * sound_duration / 8
+	return (337*sound_duration)*((len(structure)+9)/10)
+
+
+def calcula_tamano_total(structure,sound_duration,disktype):
+
+	""" Calculates the total size of the DVD """
+
+	print "Calculating size for disk :"+str(disktype)
+	total=0.0
+	for element in structure:
+		if len(element)>1:
+			for film in element1::
+				speed1,speed2=get_speedup(film)
+				total+=calcula_tamano_parcial(film"vrate",film"arate",film"filesize",film"olength",len(film"sub_list"),film"ismpeg",film"isvob",film"cutting",speed1,speed2)
+
+	if disktype=="dvd":
+		total+=calcule_menu_size(structure,sound_duration)
+
+	return total
+
+
+def check_program(programa):
+
+	""" This function allows to check that a program is available in the system, just
+	by calling it without arguments and checking the error returned """
+
+	if (sys.platform=="win32") or (sys.platform=="win64"):
+		launcher=devede_executor.executor()
+		p=launcher.launch_program(programa,win32arg=False)
+	else:
+		p=subprocess.Popen(programa+" >/dev/null 2>/dev/null",shell=True)
+
+	p.wait()
+	return p.returncode
+
+
+def load_config(global_vars):
+
+	""" Load the configuration """
+	home=get_home_directory()
+	global_vars"PAL"=True
+	global_vars"multicore"=1 # it shouldn't use multicore by default
+	global_vars"hyperthreading"=True # by default, use hyperthreading
+
+	# TODO change to allow a windows temp directory
+
+	if (sys.platform=="win32") or (sys.platform=="win64"):
+		#global_vars"temp_folder"=os.environ"TEMP"
+		global_vars"temp_folder"=os.path.join(home,"Local Settings", "Temp")
+	else:
+		global_vars"temp_folder"="/var/tmp"
+	
+	print "Temp Directory is: " , global_vars"temp_folder"
+	
+	if (sys.platform=="win32") or (sys.platform=="win64"):
+		home=os.path.join(home,"Application Data", "devede","devede.conf")
+	else:
+		home+=".devede"
+
+	print "home load: ", home
+	menuformat_found=False
+	try:
+		archivo=open(home,"r")
+		while True:
+			linea=archivo.readline()
+			print "linea: ", linea
+			if linea=="":
+				break
+			if linea-1=="\n":
+				linea=linea:-1
+			if linea=="pal":
+				global_vars"PAL"=True
+			if linea=="ntsc":
+				global_vars"PAL"=False
+			if linea:13=="video_format:":
+				if linea13:=="pal":
+					global_vars"PAL"=True
+				if linea13:=="ntsc":
+					global_vars"PAL"=False
+			if linea:12=="temp_folder:":
+				global_vars"temp_folder"=linea12:
+			if linea:10=="multicore:":
+				if linea10:=="1":
+					global_vars"multicore"=1
+				else:
+					global_vars"multicore"=global_vars"cores"
+			if linea:15=="hyperthreading:":
+				if linea15:=="1":
+					global_vars"hyperthreading"=True
+				else:
+					global_vars"hyperthreading"=False
+			if linea:13=="final_folder:":
+				global_vars"finalfolder"=linea13:
+			if linea:13=="sub_language:":
+				global_vars"sub_language"=linea13:
+			if linea:13=="sub_codepage:":
+				global_vars"sub_codepage"=linea13:
+			if linea:8=="AC3_fix:":
+				if linea8:=="1":
+					global_vars"AC3_fix"=True
+				else:
+					global_vars"AC3_fix"=False
+			if linea:15=="AC3_fix_ffmpeg:":
+				if linea15:=="1":
+					global_vars"AC3_fix_ffmpeg"=True
+				else:
+					global_vars"AC3_fix_ffmpeg"=False
+			if linea:15=="AC3_fix_avconv:":
+				if linea15:=="1":
+					global_vars"AC3_fix_avconv"=True
+				else:
+					global_vars"AC3_fix_avconv"=False
+			if linea:16=="erase_tmp_files:":
+				if linea16:=="1":
+					global_vars"erase_files"=True
+				else:
+					global_vars"erase_files"=False
+			if linea:11=="use_ffmpeg:":
+				if linea11:=="1":
+					global_vars"encoder_video"="ffmpeg"
+				else:
+					global_vars"encoder_video"="mencoder"
+			if linea:16=="use_ffmpeg_menu:":
+				if linea16:=="1":
+					global_vars"encoder_menu"="ffmpeg"
+				else:
+					global_vars"encoder_menu"="mencoder"
+			if linea:13=="encoder_menu:":
+				global_vars"encoder_menu"=linea13:
+			if linea:14=="encoder_video:":
+				global_vars"encoder_video"=linea14:
+			#if linea:==":":
+			#	global_vars""=linea:
+		archivo.close()
+	except IOError:
+		pass
+
+
+def save_config(global_vars):
+
+	""" Stores the configuration """
+
+	home=get_home_directory()
+
+	if (sys.platform=="win32") or (sys.platform=="win64"):
+		home=os.path.join(home,"Application Data", "devede")
+		if not os.path.isdir(home):
+			os.mkdir(home)
+		home=os.path.join(home, "devede.conf")
+	else:
+		home+=".devede"
+
+	if global_vars"temp_folder"-1!=os.sep:
+		global_vars"temp_folder"+=os.sep
+	try:	
+		archivo=open(home,"w")
+		if global_vars"PAL":
+			archivo.write("video_format:pal\n")
+		else:
+			archivo.write("video_format:ntsc\n")
+		archivo.write("temp_folder:"+global_vars"temp_folder"+"\n")
+		archivo.write("multicore:"+str(global_vars"multicore")+"\n")
+		if global_vars"hyperthreading":
+			archivo.write("hyperthreading:1\n")
+		else:
+			archivo.write("hyperthreading:0\n")
+		if global_vars"finalfolder"!="":
+			archivo.write("final_folder:"+str(global_vars"finalfolder")+"\n")
+		archivo.write("sub_language:"+str(global_vars"sub_language")+"\n")
+		archivo.write("sub_codepage:"+str(global_vars"sub_codepage")+"\n")
+		if global_vars"AC3_fix":
+			archivo.write("AC3_fix:1\n")
+		else:
+			archivo.write("AC3_fix:0\n")
+		if global_vars"AC3_fix_ffmpeg":
+			archivo.write("AC3_fix_ffmpeg:1\n")
+		else:
+			archivo.write("AC3_fix_ffmpeg:0\n")
+		if global_vars"AC3_fix_avconv":
+			archivo.write("AC3_fix_avconv:1\n")
+		else:
+			archivo.write("AC3_fix_avconv:0\n")
+		if global_vars"erase_files":
+			archivo.write("erase_tmp_files:1\n")
+		else:
+			archivo.write("erase_tmp_files:0\n")
+		archivo.write("encoder_video:"+global_vars"encoder_video"+"\n")
+		archivo.write("encoder_menu:"+global_vars"encoder_menu"+"\n")
+		archivo.close()
+	except IOError:
+		print "Error when writting configuration"
+		pass
+
+
+def get_new_param(parameters):
+
+	""" This function groups the parameters passed by the user into a list """
+
+	new_param=""
+	
+	while(True):
+		if (parameters.find(" ")==0):
+			parameters=parameters1: # erase blank spaces at start
+		else:
+			break
+
+	if len(parameters)==0:
+		return "",""
+	
+	p0=0
+	while True:
+		p1=parameters.find('\\',p0)
+		p2=parameters.find(' ',p0)
+		if p2==p1+1:
+			p0=p2+1
+		else:
+			if p2<0: # no next space, take all the string
+				retorno=""
+				doble=False
+				print parameters
+				for letra in parameters:
+					if (letra!='\\') or doble:
+						retorno+=letra
+						doble=False
+					else:
+						doble=True
+				return "",retorno
+			else:
+				retorno=""
+				doble=False
+				print parameters:p2
+				for letra in parameters:p2:
+					if (letra!='\\') or doble:
+						retorno+=letra
+						doble=False
+					else:
+						doble=True
+				return parametersp2+1:,retorno
+
+
+def get_home_directory():
+	
+	if (sys.platform=="win32") or (sys.platform=="win64"):
+		home=os.environ"USERPROFILE"
+	else:
+		home=os.environ.get("HOME")
+
+	if home-1!=os.sep:
+		home=home+os.sep
+
+	print home
+	return home
+
+
+def return_time(seconds,empty):
+
+	""" cuts a time in seconds into seconds, minutes and hours """
+
+	seconds2=int(seconds)
+
+	hours=str(seconds2/3600)
+	if empty:
+		if len(hours)==1:
+			hours="0"+hours
+	else:
+		if hours=="0":
+			hours=""
+	if hours!="":
+		hours+=":"
+	
+	minutes=str((seconds2/60)%60)
+	if empty or (hours!=""):
+		if len(minutes)==1:
+			minutes="0"+minutes
+	elif (minutes=="0") and (hours==""):
+			minutes=""
+	if minutes!="":
+		minutes+=":"
+
+	secs=str(seconds2%60)
+	if (len(secs)==1) and (minutes!=""):
+		secs="0"+secs
+
+	return hours+minutes+secs
+
+
+def get_max_titles(disctocreate):
+	
+	""" Returns the maximum number of titles/chapters for each type of disc """
+
+	if disctocreate=="dvd":
+		return 61
+	else:
+		return 99
+
+def get_dvd_size(tree,disctocreate):
+	
+	""" Returns the size for the currently selected disk type, and the minimum and maximum
+		videorate for the current video disk """
+	
+	if tree!=None:
+		w=tree.get_object("dvdsize")
+		active=w.get_active()
+		
+		# here we choose the size in Mbytes for the media
+		if 0==active:
+			tamano=170.0
+		elif 1==active:
+			tamano=700.0
+		elif 2==active:
+			tamano=750.0
+		elif 3==active:
+			tamano=1100.0
+		elif 4==active:
+			tamano=4200.0
+		else:
+			tamano=8000.0
+	else:
+		tamano=0
+	
+	if disctocreate=="vcd":
+		minvrate=1152
+		maxvrate=1152
+	elif (disctocreate=="svcd") or (disctocreate=="cvd"):
+		minvrate=400
+		maxvrate=2300
+	elif (disctocreate=="dvd"):
+		minvrate=400
+		maxvrate=8500
+	elif (disctocreate=="divx"):
+		minvrate=300
+		maxvrate=6000
+	
+	tamano*=0.92 # a safe margin of 8% to ensure that it never will be bigger
+				 # (it's important to have in mind the space needed by disk structures like
+				 # directories, file entries, and so on)
+	
+	return tamano,minvrate,maxvrate
+
+
+def get_picture_type(filename):
+	
+	try:
+		f=open(filename,"r")
+	except:
+		return ""
+	
+	ftype=""
+	line=f.read(4)
+
+	if (line0=="\211") and (line1:=="PNG"):
+		ftype="png"
+	
+	line2=f.read(7)
+	if (line0=="\377") and (line1=="\330") and (line2=="\377") and (line3=="\340") and (line22:6=="JFIF") and (line26=="\000"):
+		ftype="jpeg"
+		
+	f.close()
+	print "tipo: "+str(ftype)
+	return ftype
+
+
+def create_tree(sobject,filename,builderpath="",autoconnect=True):
+	
+	tree=gtk.Builder()
+	tree.set_translation_domain("devede")
+	filename=os.path.join(builderpath,filename+".ui")
+	print "Creating window "+filename
+	tree.add_from_file(filename)
+	if autoconnect:
+		tree.connect_signals(sobject)
+
+	return tree

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_settings.py Added

@@ -0,0 +1,135 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2011 (C) Raster Software Vigo (Sergio Costas)
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+import pygtk # for testing GTK version number
+pygtk.require ('2.0')
+import gtk
+import gobject
+import os
+import sys
+
+import devede_other
+
+class devede_settings:
+    
+    def on_toggled_cb(self,w):
+        
+        if (self.multicore.get_active()):
+            self.hyper.set_sensitive(True)
+        else:
+            self.hyper.set_sensitive(False)
+    
+    def set_model_from_list (self, cb, items, selected):
+        """Setup a ComboBox or ComboBoxEntry based on a list of strings."""
+        model = gtk.ListStore(str)
+        pos=-1
+        c=0
+        for i in items:
+            model.append(i)
+            if (i==selected):
+                pos=c
+            c+=1
+        cb.set_model(model)
+        cell = gtk.CellRendererText()
+        cb.pack_start(cell, True)
+        cb.add_attribute(cell, 'text', 0)
+        if (pos!=-1):
+            cb.set_active(pos)
+
+    def __init__(self,gladefile,structure,global_vars):
+        
+        self.gladefile=gladefile
+        self.structure=structure
+        self.global_vars=global_vars
+        
+        self.tree=devede_other.create_tree(self,"settings",self.gladefile,False)
+        self.tree.connect_signals(self)
+        wsettings=self.tree.get_object("wsettings_dialog")
+        
+        self.videos_combo=self.tree.get_object("combobox_videos")
+        self.menus_combo=self.tree.get_object("combobox_menus")
+        
+        self.set_model_from_list(self.videos_combo,global_vars"encoders",global_vars"encoder_video")
+        self.set_model_from_list(self.menus_combo,global_vars"encoders",global_vars"encoder_menu")
+        
+        w=self.tree.get_object("erase_files")
+        w.set_active(self.global_vars"erase_files")
+        
+        self.hyper=self.tree.get_object("hyperthreading")
+        self.multicore=self.tree.get_object("multicore")
+        if (self.global_vars"multicore"==1):
+            self.multicore.set_active(False)
+            self.hyper.set_active(False)
+            self.hyper.set_sensitive(False)
+        else:
+            self.multicore.set_active(True)
+            self.global_vars"multicore"=self.global_vars"cores"
+            self.hyper.set_sensitive(True)
+            self.hyper.set_active(self.global_vars"hyperthreading")
+        
+        self.ac3_fix=self.tree.get_object("AC3_fix")
+        self.ac3_fix.set_sensitive(True)
+        self.ac3_fix.set_active(self.global_vars"AC3_fix")
+        
+        self.ac3_fix_ffmpeg=self.tree.get_object("AC3_fix_ffmpeg")
+        self.ac3_fix_ffmpeg.set_sensitive(True)
+        self.ac3_fix_ffmpeg.set_active(self.global_vars"AC3_fix_ffmpeg")
+        
+        self.ac3_fix_avconv=self.tree.get_object("AC3_fix_avconv")
+        self.ac3_fix_avconv.set_sensitive(True)
+        self.ac3_fix_avconv.set_active(self.global_vars"AC3_fix_avconv")
+        
+        print "Path: "+str(global_vars"temp_folder")
+        path=self.tree.get_object("temporary_files")
+        path.set_current_folder(global_vars"temp_folder")
+        self.on_toggled_cb(None)
+        
+        wsettings.show()
+        value=wsettings.run()
+        wsettings.hide()
+        
+        if value!=-6:
+            wsettings.destroy()
+            return
+        
+        w=self.tree.get_object("erase_files")
+        self.global_vars"erase_files"=w.get_active()
+        
+        w=self.tree.get_object("multicore")
+        if w.get_active():
+            self.global_vars"multicore"=self.global_vars"cores"
+            self.global_vars"hyperthreading"=self.hyper.get_active()
+        else:
+            self.global_vars"multicore"=1
+            self.global_vars"hyperthreading"=False
+        
+        self.global_vars"encoder_video"=self.global_vars"encoders"self.videos_combo.get_active()
+        self.global_vars"encoder_menu"=self.global_vars"encoders"self.menus_combo.get_active()
+            
+        self.global_vars"AC3_fix"=self.ac3_fix.get_active()
+        self.global_vars"AC3_fix_ffmpeg"=self.ac3_fix_ffmpeg.get_active()
+        self.global_vars"AC3_fix_avconv"=self.ac3_fix_avconv.get_active()
+                
+        path=self.tree.get_object("temporary_files")
+        self.global_vars"temp_folder"=path.get_current_folder()
+        print "Path: "+str(self.global_vars"temp_folder")
+        
+        wsettings.destroy()
+        return

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_subtitles.py Added

@@ -0,0 +1,217 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+import signal
+import os
+import sys
+import re
+import shutil
+
+import devede_executor
+import devede_other
+
+class subtitles_adder(devede_executor.executor):
+	
+	def expand_xml(self,text):
+		
+		text=text.replace('&','&amp;')
+		text=text.replace('<','&lt;')
+		text=text.replace('>','&gt;')
+		text=text.replace('"','&quot;')
+		text=text.replace("'",'&apos;')
+		return text
+
+	
+	def __init__(self,videofile,filename,filefolder,progresbar,proglabel,disctype,title,chapter,stream):
+
+		""" This class adds the subtitles to an already converted file
+
+		VIDEOFILE contains the parameters to convert the video
+		FILENAME is the generic file name given by the user
+		FILEFOLDER is the path where all the temporary and finall files will be created
+		PROGRESBAR is the progress bar where the class will show the progress
+		PROGLABEL is the label where the class will show what is it doing
+		DISCTYPE can be dvd, vcd, svcd, cvd or divx
+		TITLE and CHAPTER are the numbers used to identify the TITLE and CHAPTER number for this file
+		STREAMS is the stream number (to allow to add several subtitles)
+		"""
+
+		devede_executor.executor.__init__(self,filename,filefolder,progresbar)
+		progresbar.pulse()
+		proglabel.set_text(_("Adding subtitles to")+"\n"+videofile"filename")
+		self.currentfile=self.create_filename(filefolder+filename,title,chapter,disctype=="divx")
+
+		subtitle_list=videofile"sub_list"stream
+
+		# generate the XML file
+
+		self.error=""
+
+		try:
+			print "Trying to create "+filefolder+filename+"_sub.xml"
+			fichero=open(filefolder+filename+"_sub.xml","w")
+		except IOError:
+			print "IOError en subtitulos"
+			self.print_error=_("Failed to write to the destination directory.\nCheck that you have privileges and free space there.")
+			self.initerror=True
+			return
+		
+		fichero.write('<subpictures format="')
+		if (videofile"fps"==25) :
+			fichero.write('PAL')
+		else:
+			fichero.write('NTSC')
+		fichero.write('">\n\t<stream>')
+		if (subtitle_list"sub_codepage"!="UTF-8"):
+			final_type="UTF-8"
+			subfilename=os.path.join(filefolder,filename+"_sub_tmp.sub")
+			self.deletesub=subfilename
+			if 0!=devede_other.check_utf().convert_to_UTF8(subtitle_list"subtitles",subfilename,subtitle_list"sub_codepage"):
+				#except IOError:
+				print "IOError al convertir a UTF8"
+				self.print_error=_("Failed to write to the destination directory.\nCheck that you have privileges and free space there.")
+				self.initerror=True
+				return
+		else:
+			self.deletesub=""
+			final_type=subtitle_list"sub_codepage"
+			subfilename=subtitle_list"subtitles"
+		fichero.write('\n\t\t<textsub filename="'+self.expand_xml(subfilename)+'"')
+
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			if os.path.isfile(os.path.join(os.environ"WINDIR","Fonts","devedesans.ttf")):
+				fichero.write('\n\t\tfont="devedesans.ttf"')
+			else:
+				fichero.write('\n\t\tfont="ARIAL.ttf"')
+		else:
+			fichero.write('\n\t\tfont="devedesans.ttf"')
+		if ((subtitle_list"sub_codepage"!="") and (subtitle_list"sub_codepage"!="ASCII")):
+			fichero.write('\n\t\tcharacterset="'+final_type+'"')
+		fichero.write('\n\t\thorizontal-alignment="center"')
+
+		if (videofile"fps"==25):
+			ancho=716
+			alto=572
+			tamanofont=videofile"subfont_size"
+		else:
+			ancho=716
+			alto=476
+			tamanofont=videofile"subfont_size"
+
+		margin_hor=int((58*ancho)/720)
+		margin_vert=int((28*alto)/576)
+		bottom_margin=margin_vert
+
+		fichero.write('\n\t\tmovie-width="'+str(ancho-4)+'"')
+		fichero.write('\n\t\tmovie-height="'+str(alto-4)+'"')
+		fichero.write('\n\t\tleft-margin="'+str(margin_hor)+'"')
+		fichero.write('\n\t\tright-margin="'+str(margin_hor)+'"')
+
+		if subtitle_list"subtitles_up":
+			tamanofont-=1
+			bottom_margin=4+(alto/8) # put it in the border of 16:9 aspect ratio
+
+		fichero.write('\n\t\tbottom-margin="'+str(bottom_margin)+'"')
+		fichero.write('\n\t\ttop-margin="'+str(margin_vert)+'"')
+
+		fichero.write('\n\t\tfontsize="'+str(tamanofont)+'.0"')
+
+		if (videofile"fps"==30):
+			if (videofile"ofps"==24) and ((disctype=="dvd") or (disctype=="divx")):
+				fps_out="24000/1001"
+			else:
+				fps_out="30000/1001"
+		else:
+			fps_out="25"
+
+		if videofile"ismpeg":
+			fps_out=videofile"ofps2"
+			print "FPS sub 1 original"
+		else:
+			print "FPS sub 1 final"
+
+		fichero.write('\n\t\tmovie-fps="'+str(fps_out)+'"')
+		speed1,speed2=devede_other.get_speedup(videofile)
+		if speed1==speed2:
+			fps_out_subs=fps_out
+			print "FPS sub 2 final"
+		else:
+			if speed2==24:
+				fps_out_subs="24"
+			else:
+				fps_out_subs=videofile"ofps2"
+			print "FPS sub 2 original"
+
+		fichero.write('\n\t\tsubtitle-fps="'+fps_out_subs+'"')
+		fichero.write('\n\t\tvertical-alignment="bottom" />')
+		fichero.write("\n\t</stream>\n</subpictures>")
+		fichero.close()
+		
+		comando=""
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			comando="spumux.exe"
+			comando.append("-m")
+			if disctype=="vcd":
+				comando.append("svcd")
+			else:
+				comando.append(disctype)
+			comando.append("-s")
+			comando.append(str(stream))
+			
+			comando.append(filefolder+filename+"_sub.xml")
+			comando.append("-i")
+			comando.append(self.currentfile)
+			comando.append("-o")
+			comando.append(self.currentfile+".sub")
+			self.print_error=_("Conversion failed.\nIt seems a bug of SPUMUX.")
+			self.launch_program(comando,output=True)
+		else:
+			comando="spumux -m "
+			if disctype=="vcd":
+				comando+="svcd"
+			else:
+				comando+=disctype
+		
+			comando+=' -s '+str(stream)+' "'+filefolder+filename+'_sub.xml"'
+		
+			self.print_error=_("Conversion failed.\nIt seems a bug of SPUMUX.")
+			self.launch_shell(comando,output=True,stdinout=self.currentfile,self.currentfile+".sub")
+
+
+	def end_process(self,eraser,erase_temporal_files):
+
+		shutil.move(self.currentfile+".sub", self.currentfile)
+		if erase_temporal_files:
+			eraser.delete_sub_xml(self.deletesub)
+			
+
+
+	def set_progress_bar(self):
+
+		self.bar.pulse()		
+		position=self.cadena.find("STAT: ")
+		if (position!=-1):
+			position2=self.cadena.find(".",position+6)
+			if position2!=-1:
+				self.bar.set_text(self.cadenaposition:position2)
+		return True

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_title_properties.py Added

@@ -0,0 +1,94 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2007 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2007 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+import pygtk # for testing GTK version number
+pygtk.require ('2.0')
+import gtk
+
+import devede_other
+import devede_dialogs
+
+class title_properties:
+	
+	def __init__(self,gladefile,structure,title):
+		
+		self.structure=structure
+		self.title=title
+		
+		self.tree=devede_other.create_tree(self,"wtitle_properties_dialog",gladefile,True)
+		self.window=self.tree.get_object("wtitle_properties_dialog")
+		w=self.tree.get_object("title_name")
+		w.set_text(structuretitle0"nombre")
+		w.grab_focus()
+		action=structuretitle0"jumpto"
+		if action=="menu":
+			w=self.tree.get_object("title_jmenu")
+		elif action=="first":
+			w=self.tree.get_object("title_jfirst")
+		elif action=="prev":
+			w=self.tree.get_object("title_jprev")
+		elif action=="loop":
+			w=self.tree.get_object("title_jthis")
+		elif action=="next":
+			w=self.tree.get_object("title_jnext")
+		elif action=="last":
+			w=self.tree.get_object("title_jlast")
+		w.set_active(True)
+		
+		self.window.show()
+		retval=self.window.run()
+		print "Salgo de propiedades "+str(retval)
+		self.window.hide()
+		
+		if retval==-5:
+			self.update_title()
+			
+		self.window.destroy()
+		self.window=None
+
+	def on_title_name_activate(self,values):
+		
+		self.window.response(-5)
+
+
+	def update_title(self):
+		
+		w=self.tree.get_object("title_name")
+		self.structureself.title0"nombre"=w.get_text()
+		
+		w=self.tree.get_object("title_jmenu")
+		if w.get_active():
+			self.structureself.title0"jumpto"="menu"
+		w=self.tree.get_object("title_jfirst")
+		if w.get_active():
+			self.structureself.title0"jumpto"="first"
+		w=self.tree.get_object("title_jprev")
+		if w.get_active():
+			self.structureself.title0"jumpto"="prev"
+		w=self.tree.get_object("title_jthis")
+		if w.get_active():
+			self.structureself.title0"jumpto"="loop"
+		w=self.tree.get_object("title_jnext")
+		if w.get_active():
+			self.structureself.title0"jumpto"="next"
+		w=self.tree.get_object("title_jlast")
+		if w.get_active():
+			self.structureself.title0"jumpto"="last"

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_video_convert.py Added

@@ -0,0 +1,570 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+import signal
+import os
+import sys
+import re
+import shutil
+import math
+
+import devede_other
+
+import devede_executor
+
+if (sys.platform == "win32") or (sys.platform=="win64"):
+	import win32file
+
+class video_converter(devede_executor.executor):
+	
+	def adjust_audiorate(self,audiorate,isdvd):
+		
+		""" Mencoder allows only a limited list of audio bitrates. This function chooses the nearest legal value """
+		
+		if isdvd:
+			values=448,384,320,256,224,192,160,128,112,96,80,64,56,48,32
+		else:
+			values=384,320,256,224,192,160,128,112,96,80,64,56,48,32
+		
+		for element in values:
+			if audiorate>=element:
+				return element
+
+		return 32
+
+	
+	def __init__(self,global_vars,videofile,filename,filefolder,progresbar,proglabel,disctype,title,chapter,threads,seconds,encpass,fix_ac3):
+
+		""" This class converts a video file to MPEG-1 or MPEG-2 format
+
+		VIDEOFILE contains the parameters to convert the video
+		FILENAME is the generic file name given by the user
+		FILEFOLDER is the path where all the temporary and finall files will be created
+		PROGRESBAR is the progress bar where the class will show the progress
+		PROGLABEL is the label where the class will show what is it doing
+		DISCTYPE can be dvd, vcd, svcd, cvd or divx
+		TITLE and CHAPTER are the numbers used to identify the TITLE and CHAPTER number for this file
+		THREADS is the number of threads to use
+		SECONDS is the number of seconds we want to convert (for previews) 
+		ENCPASS is the number of encoding pass"""
+		
+		devede_executor.executor.__init__(self,filename,filefolder,progresbar)
+		self.printout=False
+
+		self.percent2=120
+		if seconds==0:
+			self.divide=float(videofile"olength")
+			if (videofile"cutting"==1) or (videofile"cutting"==2): # if we want only one half of the file
+				self.divide/=2
+		else:
+			self.divide=float(seconds)
+
+		if self.divide==0:
+			self.divide=1
+
+		self.error=""
+		progresbar.set_fraction(0)
+		progresbar.set_text("")
+		
+		if videofile"ismpeg": # if the file hasn't to be converted, we simply copy or link it
+			self.pulse=True
+			self.print_error=_("File copy failed\nMaybe you ran out of disk space?")
+			if seconds==0:
+				texto=_("Copying the file")+"\n"
+			else:
+				texto=_("Creating preview")+"\n"
+			proglabel.set_text(texto+videofile"filename")
+			currentfile=self.create_filename(filefolder+filename,title,chapter,disctype=="divx")
+		
+			print "\ncurrentfile is: ", currentfile , "\n" 
+
+			try:
+				os.remove(currentfile)
+			except:
+				pass
+
+			if (sys.platform=="win32") or (sys.platform=="win64"):
+				# links do not work on windows, so just copy the file
+				# self.launch_shell('copy "'+videofile"path".replace('"','""')+'" "'+currentfile+'"',output=False)
+				# Only hardlinks are available on 2000 and XP, reparse points are available from vista onwards.
+				win32file.CreateHardLink(currentfile, videofile"path".replace('"','""'))
+			else:
+				if len(videofile"sub_list")==0:
+					self.launch_shell('ln -s "'+videofile"path".replace('"','\\"')+'" "'+currentfile+'"',output=False)
+				else:
+					self.launch_shell('cp "'+videofile"path".replace('"','\\"')+'" "'+currentfile+'"',output=False)
+			return
+
+		isvob=videofile"isvob"
+
+		self.pulse=False
+		if seconds==0:
+			texto=(_("Converting files from title %(title_number)s (pass %(pass_number)s)\n\n%(file_name)s") % {"title_number":str(title),"pass_number":str(encpass),"file_name":videofile"filename"} )
+			proglabel.set_text(texto) #+" "+str(title)+" Pass: "+ str(encpass) +"\n\n"+videofile"filename" )
+		else:
+			texto=_("Creating preview")
+			proglabel.set_text(texto+"\n"+videofile"filename")
+
+		addbars=False
+		framerate=int(videofile"ofps")
+		videorate=int(videofile"vrate")
+		audiorate=self.adjust_audiorate(int(videofile"arate"),disctype=="dvd")
+		
+		audio_final_rate=int(videofile"arateunc")
+		audiodelay=float(videofile"adelay")
+		final_framerate=float(videofile"fps")
+		aspect_ratio_original=videofile"oaspect"
+		aspect_ratio_final=videofile"aspect"
+		resx_final=videofile"width"
+		resy_final=videofile"height"
+		resx_original=videofile"owidth"
+		resy_original=videofile"oheight"
+		copy_audio=videofile"copy_audio"
+		sound51=videofile"sound51"
+		gop12=videofile"gop12"
+		audiostream=videofile"audio_stream"
+		swap_fields=videofile"swap_fields"
+		volume=videofile"volume"
+		if (videofile"resolution"==0) and (disctype=="divx"):
+			default_res=True
+		else:
+			default_res=False
+		
+		speed1,speed2=devede_other.get_speedup(videofile)
+		if speed1==speed2:
+			speedup=None
+		else:
+			speedup=str(speed1)+":"+str(speed2)
+	
+		if aspect_ratio_original<1.3:
+			aspect_ratio_original=float(videofile"owidth")/(float(videofile"oheight"))
+		if aspect_ratio_original<1.33333333:
+			aspect_ratio_original=1.33333333
+	
+		max_videorate=int(videorate*2)
+		min_videorate=int(videorate*0.75)
+		
+		dsize,minvid,maxvid=devede_other.get_dvd_size(None,disctype)
+		
+		if max_videorate>maxvid:
+			max_videorate=maxvid
+		if min_videorate<minvid:
+			min_videorate=minvid
+			
+		if videofile"blackbars"==0: # check if has to add black bars
+			addbars=True
+			if (videofile"rotate"==90) or (videofile"rotate"==270):
+				resx_original2=resy_original
+				resy_original2=resx_original
+			else:
+				resx_original2=resx_original
+				resy_original2=resy_original
+
+			if (resx_original2%2)==1:
+				resx_original2+=1
+			if (resy_original2%2)==1:
+				resy_original2+=1
+			resx_inter=resx_original2
+			resy_inter=int((resy_original2*aspect_ratio_original)/aspect_ratio_final)
+			if (resy_inter%2)==1:
+				resy_inter+=1
+			
+			# due to a bug in MENCODER, we put bars only up and down, never left and right,
+			# and we don't scale it if we have to add only 4 or less lines, because it is
+			# too much work for so little profit
+			
+			if ((resy_inter<resy_original) or (resy_original+5>resy_inter)):
+				addbars=False
+
+		if addbars==False:
+			resx_inter=resx_original
+			resy_inter=resy_original
+		else:
+			addx=0
+			addy=int((resy_inter-resy_original)/2)
+			if(addy%2)==1:
+				addy+=1
+
+		command_var=
+		if (sys.platform!="win32") and (sys.platform!="win64"):
+			command_var="mencoder"
+		else:
+			command_var="mencoder.exe"
+
+		if (disctype=="dvd") or (disctype=="divx"):
+			audio_desired_final_rate=48000
+		else:
+			audio_desired_final_rate=44100
+
+		afvalues=""
+
+		if isvob==False:
+			if ((audio_final_rate!=audio_desired_final_rate) and (copy_audio==False)) or (speedup!=None):
+				command_var.append("-srate")
+				command_var.append(str(audio_desired_final_rate))
+				afvalues+="lavcresample="+str(audio_desired_final_rate)
+			
+			if (copy_audio==False) and volume!=100:
+				if afvalues!="":
+					afvalues+=":"
+				afvalues+="volume="+str(10*math.log(volume/10,10))
+
+			# Add the speedup code
+
+			if speedup!=None:
+				command_var.append("-speed")
+				command_var.append(speedup)
+
+		if afvalues!="":
+			command_var.append("-af")
+			command_var.append(afvalues)
+			
+		command_var.append("-noautosub")
+		
+		command_var.append("-oac")
+		if copy_audio or isvob:
+			command_var.append("copy")
+		else:
+			if (disctype=="divx"):
+				command_var.append("mp3lame")
+			else:
+				command_var.append("lavc")
+
+		if (audiostream!=10000):
+			command_var.append("-aid")
+			command_var.append(str(audiostream))
+
+
+		
+		telecine=False
+		if final_framerate==30:
+			if (framerate==24) and ((disctype=="dvd") or (disctype=="divx")):
+				str_final_framerate="24000/1001"
+				keyintv=15
+				telecine=True
+			else:
+				str_final_framerate="30000/1001"
+				keyintv=18
+		else:
+			str_final_framerate=str(int(final_framerate))
+			keyintv=15
+		
+		if gop12:
+			keyintv=12
+		
+		command_var.append("-ovc")
+		if isvob:
+			command_var.append("copy")
+		else:
+			command_var.append("lavc")
+		
+		if (disctype!="divx"):
+			command_var.append("-of")
+			command_var.append("mpeg")
+			command_var.append("-mpegopts")
+			if disctype=="dvd":
+				if telecine and isvob==False:
+					command_var.append("format=dvd:tsaf:telecine")
+				else:
+					command_var.append("format=dvd:tsaf")
+			elif disctype=="vcd":
+				command_var.append("format=xvcd")
+			elif (disctype=="svcd") or (disctype=="cvd"):
+				command_var.append("format=xsvcd")
+			else:
+				print "Error, disc format incorrect. Talk with the creator."
+				sys.exit(1)
+
+		if seconds!=0:
+			command_var.append("-endpos")
+			command_var.append(str(seconds))
+		else:
+			if videofile"cutting"==1: # first half only
+				command_var.append("-endpos")
+				command_var.append(str(videofile"olength"/2))
+			elif videofile"cutting"==2: # second half only
+				command_var.append("-ss")
+				command_var.append(str((videofile"olength"/2)-5)) # start 5 seconds before
+
+		if (audiodelay!=0.0) and (copy_audio==False) and (isvob==False):
+			command_var.append("-delay")
+			command_var.append(str(audiodelay))
+
+		if sound51:
+			command_var.append("-channels")
+			command_var.append("6")
+
+		if (isvob==False) and (default_res==False):
+			command_var.append("-ofps")
+			command_var.append(str_final_framerate)
+
+		if disctype=="divx":
+			command_var.append("-ffourcc")
+			command_var.append("DX50")
+
+		lineatemp=""
+		acoma=False;
+		
+		if swap_fields:
+			lineatemp+="phase=a"
+			acoma=True
+		
+		extra_params=videofile"params_vf" # take the VF extra params
+		while (extra_params!=""):
+			extra_params,new_param=devede_other.get_new_param(extra_params)
+			if (new_param!="") and (new_param!=','):
+				while (len(new_param)>1) and (new_param0==','):
+					new_param=new_param1:
+				while (len(new_param)>1) and (new_param-1==','):
+					new_param=new_param:-1
+				if acoma:
+					lineatemp+=","
+				lineatemp+=new_param
+				acoma=True
+		
+		vmirror=0
+		hmirror=0
+		passlog_var = None
+		
+		if videofile"deinterlace"!="none":
+			if acoma:
+				lineatemp+=","
+			if videofile"deinterlace"!="yadif":
+				lineatemp+="pp="+videofile"deinterlace"
+			else:
+				lineatemp+="yadif=0"
+			acoma=True
+			
+		if videofile"rotate"==180:
+			vmirror=1-vmirror
+			hmirror=1-hmirror
+		
+		if videofile"vmirror":
+			vmirror=1-vmirror
+		
+		if videofile"hmirror":
+			hmirror=1-hmirror
+		
+		if vmirror==1:
+			if acoma:
+				lineatemp+=","
+			lineatemp+="flip"
+			acoma=True
+		
+		if hmirror==1:
+			if acoma:
+				lineatemp+=","
+			lineatemp+="mirror"
+			acoma=True
+		
+		print "Addbars "+str(addbars)+" resx_o "+str(resx_original)+" resy_o "+str(resy_original)
+		print "resx_i "+str(resx_inter)+" resy_i "+str(resy_inter)
+		if addbars and ((resx_inter!=resx_original) or (resy_inter!=resy_original)) and (default_res==False):
+			if acoma:
+				lineatemp+=","
+			lineatemp+="expand="+str(resx_inter)+":"+str(resy_inter)+":"+str(addx)+":"+str(addy)
+			acoma=True
+
+		if videofile"rotate"==90:
+			if acoma:
+				lineatemp+=","
+			lineatemp+="rotate=1"
+			acoma=True
+		
+		if videofile"rotate"==270:
+			if acoma:
+				lineatemp+=","
+			lineatemp+="rotate=2"
+			acoma=True
+
+		if ((resx_inter!=resx_final) or (resy_inter!=resy_final)) and (default_res==False):
+			if acoma:
+				lineatemp+=","
+			lineatemp+="scale="+str(resx_final)+":"+str(resy_final)
+			acoma=True
+		
+		if disctype!="divx":
+			if acoma:
+				lineatemp+=","
+			lineatemp+="harddup"
+			acoma=True
+
+		if (lineatemp!="") and (isvob==False):
+			command_var.append("-vf")		
+			command_var.append(lineatemp)
+
+		if isvob==False:
+			command_var.append("-lavcopts")
+			
+			lavcopts=""
+			
+			# Currently Mencoder supports up to 8 threads
+			if threads>8:
+				nthreads=8
+			else:
+				nthreads=threads
+			
+			if nthreads>1:
+				lavcopts="threads="+str(nthreads)+":"
+			lavcopts+="vcodec="
+			if disctype=="vcd":
+				lavcopts+="mpeg1video"
+			elif disctype=="divx":
+				lavcopts+="mpeg4"
+			else:
+				lavcopts+="mpeg2video"
+		
+			if videofile"trellis":
+				lavcopts+=":trell"
+		
+			if videofile"mbd"==0:
+				lavcopts+=":mbd=0"	
+			elif videofile"mbd"==1:
+				lavcopts+=":mbd=1"
+			elif videofile"mbd"==2:
+				lavcopts+=":mbd=2"
+	
+			lavcopts+=":sc_threshold=1000000000:cgop"
+
+			if disctype!="divx":
+				lavcopts+=":vstrict=0:vrc_maxrate="+str(max_videorate)
+				lavcopts+=":vrc_buf_size="
+				if (disctype=="vcd"):
+					lavcopts+="327"
+				elif (disctype=="svcd") or (disctype=="cvd"):
+					lavcopts+="917"
+				elif (disctype=="dvd"):
+					lavcopts+="1835"
+			if disctype=="vcd":
+				lavcopts+=":vrc_minrate="+str(min_videorate)
+	
+			lavcopts+=":vbitrate="+str(videorate)
+		
+			if disctype!="divx":
+				lavcopts+=":keyint="+str(keyintv)
+				if(copy_audio==False):
+					lavcopts+=":acodec="
+					if disctype=="dvd":
+						if fix_ac3:
+							lavcopts+="ac3_fixed"
+						else:
+							lavcopts+="ac3"
+					else:
+						lavcopts+="mp2"
+					lavcopts+=":abitrate="+str(audiorate)
+
+			if (default_res==False):
+				if aspect_ratio_final>1.4:
+					lavcopts+=":aspect=16/9"
+				else:
+					lavcopts+=":aspect=4/3"
+			
+			if encpass > 0:
+				lavcopts+=":vpass=" + str(encpass)
+				passlog_var = os.path.join(filefolder,filename)+".log"
+				if encpass==1:
+					try:
+						os.remove(passlog_var)
+					except:
+						 pass
+					if videofile"turbo1stpass":
+						lavcopts+=":turbo"
+				
+	
+			extra_params=videofile"params_lavc" # take the LAVC extra params
+			while (extra_params!=""):
+				extra_params,new_param=devede_other.get_new_param(extra_params)
+				if (new_param!="") and (new_param!=':'):
+					while (len(new_param)>1) and (new_param0==':'):
+						new_param=new_param1:
+					while (len(new_param)>1) and (new_param-1==':'):
+						new_param=new_param:-1
+					lavcopts+=":"+new_param
+			command_var.append(lavcopts)
+	
+		if (disctype=="divx") and (copy_audio==False) and (isvob==False):
+			lameopts="abr:br="+str(audiorate)
+			command_var.append("-lameopts")
+			extra_params=videofile"params_lame" # take the LAME extra params
+			while (extra_params!=""):
+				extra_params,new_param=devede_other.get_new_param(extra_params)
+				if (new_param!="") and (new_param!=':'):
+					while (len(new_param)>1) and (new_param0==':'):
+						new_param=new_param1:
+					while (len(new_param)>1) and (new_param-1==':'):
+						new_param=new_param:-1
+					lameopts+=":"+new_param
+			command_var.append(lameopts)
+	
+		currentfile=self.create_filename(filefolder+filename,title,chapter,disctype=="divx")
+
+		if (passlog_var != None):
+			command_var.append("-passlogfile")
+			command_var.append(passlog_var)
+
+		command_var.append("-o")
+		command_var.append(currentfile)
+		command_var.append(videofile"path")
+
+		extra_params=videofile"params" # take the extra params
+		while (extra_params!=""):
+			extra_params,new_param=devede_other.get_new_param(extra_params)
+			if new_param!="":
+				command_var.append(new_param)
+
+		self.print_error=_("Conversion failed.\nIt seems a bug of Mencoder.")
+		if (videofile"params"!="") or (videofile"params_vf"!="") or (videofile"params_lavc"!="") or (videofile"params_lame"!=""):
+			self.print_error+="\n"+_("Also check the extra params passed to Mencoder for syntax errors.")
+		self.error_not_done=True
+		self.launch_program(command_var,read_chars=300)
+		
+
+
+	def end_process(self,eraser,erase_temporal_files):
+
+		return
+
+
+	def set_progress_bar(self):
+
+		if self.pulse:
+			self.bar.pulse()
+			return True
+
+		pos=self.cadena.find("Pos:")
+		if pos==-1:
+			return False # don't erase the string
+		pos2=self.cadena.find("s",pos+3)
+		if pos2==-1:
+			return False
+		valuetemp=float(self.cadenapos+4:pos2)
+		value=(100.0*valuetemp)/self.divide
+		if (value!=self.percent2) or (self.percent2==120):
+			if (value)>100.0:
+				value=100.0
+			self.bar.set_fraction(value/100.0)
+			self.bar.set_text(str(int(value))+"%")
+			self.percent2=value
+			if self.error_not_done:
+				self.error_not_done=False
+				self.print_error=_("Conversion failed\nMaybe you ran out of disk space?")
+		return True

devede-3.23.0.tar.bz2/build/lib.linux-x86_64-2.7/devede_xml_menu.py Added

@@ -0,0 +1,1133 @@
+#!/usr/bin/env python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+import gtk
+import cairo
+import time
+import sys
+import os
+import devede_executor
+import devede_other
+
+class xml_files(devede_executor.executor):
+	
+	""" This class creates the XML files and the menues """
+	
+	def __init__(self,pbar,filename,filefolder,structure,global_vars,proglabel,extcr=None):
+	
+		devede_executor.executor.__init__(self,filename,filefolder,pbar)
+		
+		self.height2=0.05
+		self.height=0.0391604010025
+		
+		self.proglabel=proglabel
+		self.print_error=_("Failed to create the menues.")
+		self.output=False
+		self.structure=structure
+		self.AC3_fix=global_vars"AC3_fix"
+		self.AC3_fix_ffmpeg=global_vars"AC3_fix_ffmpeg"
+		self.AC3_fix_avconv=global_vars"AC3_fix_avconv"
+		self.encoder_video=global_vars"encoder_video"
+		self.encoder_menu=global_vars"encoder_menu"
+		self.with_menu=global_vars"with_menu"
+		if (len(structure)==1) and (len(structure0)==2) and (not self.with_menu):
+			self.onlyone=True
+		else:
+			self.onlyone=False
+		
+		self.do_menu=global_vars"do_menu"
+		self.menu_bg=global_vars"menu_bg"
+		self.menu_sound=global_vars"menu_sound"
+		self.menu_sound_duration=global_vars"menu_sound_duration"
+		self.font_name=global_vars"fontname"
+		self.mplexed=True
+		self.installpath=global_vars"install_path"
+		self.title_text=global_vars"menu_title_text"
+		self.title_color=global_vars"menu_title_color"
+		self.title_shadow=global_vars"menu_title_shadow"
+		self.title_fontname=global_vars"menu_title_fontname"
+
+		# for menu, use the same format than the global format
+		self.menu_PAL=global_vars"PAL"
+		print "Menu PAL: "+str(self.menu_PAL)
+		self.bgcolor=global_vars"menu_bgcolor"
+		self.fontcolor=global_vars"menu_font_color"
+		self.activecolor=global_vars"menu_selc_color"
+		self.shadowcolor=global_vars"menu_shadow_color"
+		self.inactivecolor=65535-self.activecolor0,65535-self.activecolor1,65535-self.activecolor2,self.activecolor3
+
+		self.align=global_vars"menu_alignment"
+		self.halign=global_vars"menu_halignment"
+		self.radius=0.0375
+
+		self.top_margin=0.75*global_vars"menu_top_margin"
+		self.bottom_margin=0.75*global_vars"menu_bottom_margin"
+		self.left_margin=global_vars"menu_left_margin"
+		self.right_margin=global_vars"menu_right_margin"
+		self.extcr=extcr
+		
+		self.elements_per_menu=int((0.75-(self.top_margin+self.bottom_margin))/self.height2)
+		self.lines_per_menu=self.elements_per_menu
+		print "Elementos por menu: "+str(self.elements_per_menu)
+		
+		if (len(self.structure))>self.elements_per_menu:
+			self.elements_per_menu-=1
+		
+		counter=0
+		if self.with_menu:
+			self.nmenues=0
+			while (len(self.structurecounter:)!=0):
+				counter+=self.elements_per_menu
+				self.nmenues+=1
+		else:
+			self.nmenues=1
+		
+		self.margin_x=0.1
+		self.shadow_offset=0.0025
+		
+		self.print_error=None
+
+
+	def do_menus(self):
+		return self.with_menu
+
+
+	def wait_end(self):
+		
+		if self.print_error!=None:
+			return -1
+		
+		retval=devede_executor.executor.wait_end(self)
+		if retval!=0:
+			self.print_error=_("Menu generation failed.")
+			return retval
+		self.create_menu2(self.counter,self.nelement)
+		if self.print_error!=None:
+			return -1
+		retval=devede_executor.executor.wait_end(self)
+		if retval!=0:
+			self.print_error=_("Can't add the buttons to the menus.\nIt seems a bug of SPUMUX.")
+		return retval
+			
+
+
+	def get_elements_per_menu(self):
+		
+		return (self.elements_per_menu)
+
+	
+	def create_files(self):
+		
+		if self.create_xml():
+			return _("Failed to write to the destination directory.\nCheck that you have privileges and free space there.")
+	
+	
+	def expand_xml(self,text):
+		
+		text=text.replace('&','&amp;')
+		text=text.replace('<','&lt;')
+		text=text.replace('>','&gt;')
+		text=text.replace('"','&quot;')
+		text=text.replace("'",'&apos;')
+		return text
+	
+	
+	def create_xml(self):
+
+		""" Creates the XML file for DVDAuthor """
+
+		# calculate the position for each title
+		
+		title_list=
+		counter=1
+		for element in self.structure:
+			title_list.append(counter)
+			counter+=((len(element))-1)
+
+		try:
+			fichero=open(self.filefolder+self.filename+".xml","w")
+			fichero.write('<dvdauthor dest="'+self.expand_xml(self.filefolder+self.filename)+'">\n')
+			
+			if self.onlyone:
+				fichero.write('\t<vmgm />\n')
+			else:
+			
+				fichero.write('\t<vmgm>\n')
+				
+				# MENU
+				
+				# in the FPC we do a jump to the first menu in the first titleset if we wanted MENU
+				# or we jump to the second titleset if we didn't want MENU at startup
+				
+				fichero.write('\t\t<fpc>\n')
+				fichero.write('\t\t\tg0=100;\n')
+				if self.do_menu and self.with_menu:
+					fichero.write('\t\t\tg1=0;\n')
+				else:
+					fichero.write('\t\t\tg1=100;\n')
+				fichero.write('\t\t\tg2=1024;\n')
+				fichero.write('\t\t\tjump menu 1;\n')
+				fichero.write('\t\t</fpc>\n')
+				
+				# in the VMGM menu we create a code to jump to the title specified in G0
+				# but if the title is 100, we jump to the menus. There we show the menu number
+				# contained in G1
+				
+				fichero.write("\t\t<menus>\n")
+					
+				fichero.write('\t\t\t<video format="')
+				if self.menu_PAL:
+					fichero.write("pal")
+				else:
+					fichero.write("ntsc")
+				fichero.write('" aspect="4:3"> </video>\n')
+	
+				fichero.write('\t\t\t<pgc>\n')
+				fichero.write('\t\t\t\t<pre>\n')
+				
+				counter=1
+				for element in self.structure:
+					for element2 in element1::
+						fichero.write('\t\t\t\t\tif (g0 eq '+str(counter)+') {\n')
+						fichero.write('\t\t\t\t\t\tjump titleset '+str(1+counter)+' menu;\n')
+						fichero.write('\t\t\t\t\t}\n')
+						counter+=1
+				fichero.write('\t\t\t\t\tif (g0 eq 100) {\n')
+				fichero.write('\t\t\t\t\t\tg2=1024;\n')
+				fichero.write('\t\t\t\t\t\tjump titleset 1 menu;\n')
+				fichero.write('\t\t\t\t\t}\n')
+				fichero.write('\t\t\t\t</pre>\n')
+				# fake video (one black picture with one second of sound) to ensure 100% compatibility
+				fichero.write('\t\t\t\t<vob file="')
+				if self.menu_PAL:
+					fichero.write(self.expand_xml(str(os.path.join(self.installpath,"base_pal.mpg"))))
+				else:
+					fichero.write(self.expand_xml(str(os.path.join(self.installpath,"base_ntsc.mpg"))))
+				fichero.write('"></vob>\n')
+				fichero.write('\t\t\t</pgc>\n')
+				fichero.write('\t\t</menus>\n')
+				fichero.write("\t</vmgm>\n")
+				
+				fichero.write("\n")
+				
+				# the first titleset contains all the menus. G1 allows us to jump to the desired menu
+				
+				fichero.write('\t<titleset>\n')
+				fichero.write('\t\t<menus>\n')
+				fichero.write('\t\t\t<video format="')
+				if self.menu_PAL:
+					fichero.write("pal")
+				else:
+					fichero.write("ntsc")
+				fichero.write('" aspect="4:3"> </video>\n')
+				
+				button_counter=0
+				for menu_number in range(self.nmenues):
+					fichero.write('\t\t\t<pgc>\n')
+					fichero.write('\t\t\t\t<pre>\n')
+					# first we recover the currently selected button
+					fichero.write('\t\t\t\t\ts8=g2;\n')
+					if menu_number==0: # here we add some code to jump to each menu
+						for menu2 in range(self.nmenues-1):
+							fichero.write('\t\t\t\t\tif (g1 eq '+str(menu2+1)+') {\n')
+							fichero.write('\t\t\t\t\t\tjump menu '+str(menu2+2)+';\n')
+							fichero.write('\t\t\t\t\t}\n')
+						
+						# this code is to fix a bug in some players
+						fichero.write('\t\t\t\t\tif (g1 eq 100) {\n')
+						fichero.write('\t\t\t\t\t\tjump title 1;\n')#menu '+str(self.nmenues+1)+';\n')
+						fichero.write('\t\t\t\t\t}\n')
+						
+					fichero.write('\t\t\t\t</pre>\n')
+					fichero.write('\t\t\t\t<vob file="')
+					if self.with_menu:
+						fichero.write(self.expand_xml(str(os.path.join(self.filefolder,self.filename)))+'_menu2_'+str(menu_number)+'.mpg"')
+					else:
+						if self.menu_PAL:
+							fichero.write(self.expand_xml(str(os.path.join(self.installpath,"base_pal.mpg")))+'"')
+						else:
+							fichero.write(self.expand_xml(str(os.path.join(self.installpath,"base_ntsc.mpg")))+'"')
+					fichero.write('></vob>\n')
+					
+					if self.with_menu:
+						cantidad=len(self.structureself.elements_per_menu*menu_number:(menu_number+1)*self.elements_per_menu)
+						for nbutton in range(cantidad):
+							fichero.write('\t\t\t\t<button name="boton')
+							fichero.write(str(menu_number))
+							fichero.write('x')
+							fichero.write(str(nbutton))
+							fichero.write('"> g0='+str(title_listbutton_counter)+'; jump vmgm menu; </button>\n')
+							button_counter+=1
+							
+						if (menu_number!=0):
+							fichero.write('\t\t\t\t<button name="boton')
+							fichero.write(str(menu_number))
+							fichero.write('p"> g1=')
+							fichero.write(str(menu_number-1))
+							fichero.write('; g2=1024; jump menu ')
+							fichero.write(str(menu_number))
+							fichero.write('; </button>\n')
+							
+						if (menu_number!=self.nmenues-1) and (self.nmenues>1):
+							fichero.write('\t\t\t\t<button name="boton')
+							fichero.write(str(menu_number))
+							fichero.write('n"> g1=')
+							fichero.write(str(menu_number+1))
+							fichero.write('; g2=1024; jump menu ')
+							fichero.write(str(menu_number+2))
+							fichero.write('; </button>\n')
+					
+					fichero.write('\t\t\t\t<post>\n')
+					fichero.write('\t\t\t\t\tg2=s8;\n')
+					fichero.write('\t\t\t\t\tg1='+str(menu_number)+';\n')
+					fichero.write('\t\t\t\t\tjump menu '+str(menu_number+1)+';\n')
+					fichero.write('\t\t\t\t</post>\n')
+					fichero.write('\t\t\t</pgc>\n')
+				
+				fichero.write('\t\t</menus>\n')
+				fichero.write('\t\t<titles>\n')
+				fichero.write('\t\t\t<video format="')
+				if self.menu_PAL:
+					fichero.write("pal")
+				else:
+					fichero.write("ntsc")
+				fichero.write('" aspect="4:3"> </video>\n')
+				fichero.write('\t\t\t<pgc>\n')
+				fichero.write('\t\t\t\t<vob file="')
+				if self.menu_PAL:
+					fichero.write(self.expand_xml(str(os.path.join(self.installpath,"base_pal.mpg"))))
+				else:
+					fichero.write(self.expand_xml(str(os.path.join(self.installpath,"base_ntsc.mpg"))))
+				fichero.write('"></vob>\n')
+				fichero.write('\t\t\t\t<post>\n')
+				fichero.write('\t\t\t\t\tg0=1;\n')
+				fichero.write('\t\t\t\t\tg1=0;\n')
+				fichero.write('\t\t\t\t\tg2=1024;\n')
+				fichero.write('\t\t\t\t\tcall vmgm menu entry title;\n')
+				fichero.write('\t\t\t\t</post>\n')
+				fichero.write('\t\t\t</pgc>\n')
+				fichero.write('\t\t</titles>\n')
+				fichero.write("\t</titleset>\n")
+	
+				fichero.write("\n")
+				
+			# Now we create the titleset for each video
+			
+			total_t=len(self.structure)
+			titleset=1
+			titles=0
+			counter=0
+			for element in self.structure:
+				files=0
+				num_chapters=len(element)-1
+				action=element0"jumpto"
+				for element2 in element1::
+					fichero.write("\n")
+					
+					if element2"ismpeg":
+
+						# if it's already an MPEG-2 compliant file, we use the original values
+						if element2"ofps"==25:
+							pal_ntsc="pal"
+							ispal=True
+						else:
+							pal_ntsc="ntsc"
+							ispal=False
+						if element2"oaspect">1.6:
+							faspect='16:9'
+							fwide=True
+						else:
+							faspect='4:3'
+							fwide=False
+					else:
+						# but if we are converting it, we use the desired values
+						if element2"fps"==25:
+							pal_ntsc="pal"
+							ispal=True
+						else:
+							pal_ntsc="ntsc"
+							ispal=False
+						if element2"aspect">1.6:
+							faspect='16:9'
+							fwide=True
+						else:
+							faspect='4:3'
+							fwide=False
+					
+					fichero.write("\t<titleset>\n")
+					if not self.onlyone:
+						fichero.write("\t\t<menus>\n")
+						fichero.write('\t\t\t<video format="'+pal_ntsc+'" aspect="'+faspect+'"')
+						if fwide:
+							fichero.write(' widescreen="nopanscan"')
+						fichero.write('> </video>\n')
+						
+						fichero.write("\t\t\t<pgc>\n")
+						fichero.write("\t\t\t\t<pre>\n")
+						fichero.write('\t\t\t\t\tif (g0 eq 100) {\n')
+						fichero.write('\t\t\t\t\t\tjump vmgm menu entry title;\n')
+						fichero.write('\t\t\t\t\t}\n')
+						fichero.write('\t\t\t\t\tg0=100;\n')
+						fichero.write('\t\t\t\t\tg1='+str(titles/self.elements_per_menu)+';\n')
+						fichero.write('\t\t\t\t\tjump title 1;\n')
+						fichero.write('\t\t\t\t</pre>\n')
+						# fake video to ensure compatibility
+						fichero.write('\t\t\t\t<vob file="')
+						if ispal:
+							fichero.write(self.expand_xml(str(os.path.join(self.installpath,"base_pal"))))
+						else:
+							fichero.write(self.expand_xml(str(os.path.join(self.installpath,"base_ntsc"))))
+						if fwide:
+							fichero.write("_wide")
+						fichero.write('.mpg"></vob>\n')
+						fichero.write("\t\t\t</pgc>\n")
+						fichero.write("\t\t</menus>\n")
+
+					fichero.write("\t\t<titles>\n")
+					fichero.write('\t\t\t<video format="'+pal_ntsc+'" aspect="'+faspect+'"')
+					if fwide:
+						fichero.write(' widescreen="nopanscan"')
+					fichero.write('> </video>\n')
+					
+					for element3 in element2"sub_list":
+						fichero.write('\t\t\t<subpicture lang="'+self.expand_xml(str(element3"sub_language":2.lower()))+'" />\n')
+					fichero.write('\t\t\t<pgc>\n')
+					if (element2"force_subs") and (len(element2"sub_list")!=0):
+						fichero.write('\t\t\t\t<pre>\n')
+						fichero.write('\t\t\t\t\tsubtitle=64;\n')
+						fichero.write('\t\t\t\t</pre>\n')
+
+					currentfile=self.create_filename(self.filefolder+self.filename,titles+1,files+1,False)
+					fichero.write('\t\t\t\t<vob file="'+self.expand_xml(currentfile)+'" ')
+					fichero.write('chapters="0')
+					if (element2"olength">5):
+						if (element2"lchapters"!=0): # add chapters
+							toadd=int(element2"lchapters")
+							seconds=toadd*60
+							while seconds<(element2"olength"-4):
+								thetime=devede_other.return_time(seconds,False)
+								fichero.write(","+thetime)
+								seconds+=(toadd*60)
+						fichero.write(','+devede_other.return_time((element2"olength"-2),False))
+					fichero.write('" />\n')
+					
+					if not self.onlyone:
+						fichero.write('\t\t\t\t<post>\n')
+						files+=1
+						fichero.write('\t\t\t\t\tg1='+str(titles/self.elements_per_menu)+';\n')
+						if (files==num_chapters) and (action=="menu"): # last chapter
+							fichero.write('\t\t\t\t\tg0=100;\n')
+							fichero.write('\t\t\t\t\tcall vmgm menu entry title;\n')
+						else:
+							fichero.write('\t\t\t\t\tg0=')
+							if (files==num_chapters): # last chapter; do ACTION
+								if action=="prev":
+									if titles==0:
+										prev_t=total_t-1
+									else:
+										prev_t=titles-1
+									fichero.write(str(title_listprev_t))
+								elif action=="loop":
+									fichero.write(str(title_listtitles))
+								elif action=="next":
+									if titles==total_t-1:
+										next_t=0
+									else:
+										next_t=titles+1
+									fichero.write(str(title_listnext_t))
+								elif action=="last":
+									fichero.write(str(title_listtotal_t-1))
+								else:
+									fichero.write('1') # first
+							else:
+								 # jump to next chapter in title
+								fichero.write(str(title_listtitles+files))
+							fichero.write(';\n')
+							fichero.write('\t\t\t\t\tcall vmgm menu entry title;\n')
+						fichero.write('\t\t\t\t</post>\n')
+					fichero.write("\t\t\t</pgc>\n")
+					fichero.write("\t\t</titles>\n")
+					fichero.write("\t</titleset>\n")
+					counter+=1
+				titles+=1
+			fichero.write("</dvdauthor>")
+			fichero.close()
+			return False
+		except IOError:
+			return True
+
+	
+	def create_menu1(self,counter,nelement,threads):
+	
+		""" Creates all the menu elements """
+	
+		self.threads=threads
+		self.counter=counter
+		self.nelement=nelement
+		if self.proglabel!=None:
+			self.proglabel.set_text((_("Creating menu %(menu_number)d")) % {"menu_number":nelement+1})
+		print "Menu1 "+str(counter)+" "+str(nelement)
+		
+		# create the XML file for the menu NELEMENT
+		if self.create_menu_stream(counter,nelement):
+			self.print_error=_("Failed to write to the destination directory.\nCheck that you have privileges and free space there.")
+			return None
+		# create the background picture for the menu NELEMENT
+		if None==self.create_menu_bg(counter,nelement,0):
+			self.print_error=_("Can't find the menu background.\nCheck the menu options.")
+			return None
+		# create the ACTIVE picture for the menu NELEMENT
+		if None==self.create_menu_bg(counter,nelement,1):
+			self.print_error=_("Failed to write to the destination directory.\nCheck that you have privileges and free space there.")
+			return None
+		# create the INACTIVE picture for the menu NELEMENT
+		if None==self.create_menu_bg(counter,nelement,2):
+			self.print_error=_("Failed to write to the destination directory.\nCheck that you have privileges and free space there.")
+			return None
+		# create the SELECTED picture for the menu NELEMENT
+		if None==self.create_menu_bg(counter,nelement,3):
+			self.print_error=_("Failed to write to the destination directory.\nCheck that you have privileges and free space there.")
+			return None
+		# creates an MPEG file with the sound and the background picture
+		if self.create_menu_mpg(nelement):
+			self.print_error=_("Menu generation failed.")
+
+		return None
+		
+	def create_menu2(self,counter,nelement):
+		
+		""" Mixes all files to create the NELEMENT menu MPEG file with the buttons embedded """
+
+		if self.menu_mplex_buttons(nelement):
+			self.print_error=_("Can't add the buttons to the menus.\nIt seems a bug of SPUMUX.")
+			
+		return None
+
+			
+	def create_menu_stream(self,first_element,nelement):
+
+		""" Creates the menu XML file """
+
+		cantidad=len(self.structurefirst_element:first_element+self.elements_per_menu)
+		if self.align!=0:
+			offset=(self.elements_per_menu-cantidad)/self.align
+		else:
+			offset=0
+			
+		if self.menu_PAL:
+			formato="pal"
+		else:
+			formato="ntsc"
+
+		try:
+			fichero=open(self.filefolder+self.filename+"_menu_"+str(nelement)+".xml","w")
+			fichero.write('<subpictures>\n<stream>\n<spu force="yes" start="00:00:00.00"')# transparent="000000"')
+			fichero.write(' image="'+self.expand_xml(self.filefolder+self.filename)+'_menu'+str(nelement)+'_bg_inactive_out.png"')
+			fichero.write(' highlight="'+self.expand_xml(self.filefolder+self.filename)+'_menu'+str(nelement)+'_bg_active_out.png"')
+			fichero.write(' select="'+self.expand_xml(self.filefolder+self.filename)+'_menu'+str(nelement)+'_bg_select_out.png" >\n')
+			
+			counter=first_element
+			if (self.align==0):
+				pos_y=self.top_margin
+			elif self.align==1:
+				pos_y=0.75-self.bottom_margin-self.height2*float(len(self.structurecounter:counter+self.lines_per_menu))
+			else:
+				pos_y=(self.top_margin+(0.75-self.bottom_margin)-self.height2*float(len(self.structurecounter:counter+self.lines_per_menu)))/2
+			pos_y3=0.75-self.bottom_margin-self.height2#pos_y+self.height2*float((len(self.structurecounter:counter+self.lines_per_menu)))
+			pos_y/=0.75
+			pos_y3/=0.75
+			inc_y=self.height2/0.75
+			
+			if self.menu_PAL:
+				pos_y*=576.0
+				pos_y3*=576.0
+				inc_y*=576.0
+			else:
+				pos_y*=480.0
+				pos_y3*=480.0
+				inc_y*=480.0
+			
+			if (nelement!=0):
+				has_previous=True
+			else:
+				has_previous=False
+			
+			if ((nelement!=self.nmenues-1) and (self.nmenues>1)):
+				has_next=True
+			else:
+				has_next=False
+			
+			for contador in range(cantidad):
+				fichero.write('<button name="boton'+str(nelement)+"x"+str(contador))
+				fichero.write('" x0="0" y0="'+str(int(pos_y))+'" x1="719" y1="'+str(int(pos_y+inc_y-2))+'"')
+				pos_y+=inc_y
+				if contador!=0:
+					fichero.write(' up="boton'+str(nelement)+"x")
+					fichero.write(str(contador-1))
+					fichero.write('"')
+				if contador<cantidad-1:
+					fichero.write(' down="boton'+str(nelement)+"x")
+					fichero.write(str(contador+1))
+					fichero.write('"')
+				else:
+					if (nelement!=0):
+						fichero.write(' down="boton'+str(nelement)+'p"')
+					elif ((nelement!=self.nmenues-1) and (self.nmenues>1)):
+						fichero.write(' down="boton'+str(nelement)+'n"')
+				if has_next:
+					fichero.write(' right="boton'+str(nelement)+'n"')
+				if has_previous:
+					fichero.write(' left="boton'+str(nelement)+'p"')
+				fichero.write(' > </button>\n')
+			
+			if has_previous:
+				fichero.write('<button name="boton'+str(nelement)+'p"')
+				fichero.write(' x0="0" y0="'+str(int(pos_y3))+'" x1="'+str(int((self.left_margin+self.right_margin)/2))+'" y1="'+str(int(pos_y3+inc_y-2))+'"')
+				fichero.write(' up="boton'+str(nelement)+'x'+str(cantidad-1)+'"')
+				if has_next:
+					fichero.write(' right="boton'+str(nelement)+'n"')
+				fichero.write(' > </button>\n')
+
+			if has_next:
+				fichero.write('<button name="boton'+str(nelement)+'n"')
+				fichero.write(' x0="'+str(int((self.left_margin+2+self.right_margin)/2))+'" y0="'+str(int(pos_y3))+'" x1="719" y1="'+str(int(pos_y3+inc_y-2))+'"')
+				fichero.write(' up="boton'+str(nelement)+'x'+str(cantidad-1)+'"')
+				if has_previous:
+					fichero.write(' left="boton'+str(nelement)+'p"')
+				fichero.write(' > </button>\n')
+			fichero.write("</spu>\n</stream>\n</subpictures>\n")
+			fichero.close()
+			
+			return False
+		except IOError:
+			return True
+	
+	
+	def menu_set_bg(self,cr,x,y,width,bgcolor,fgcolor=None,shcolor=None):
+
+		""" paints the rounded rectangles used as background for titles and buttons """
+
+		radius=self.radius
+		border=0.0048
+		linea=0.0024
+		# I created the button image for this size, so I must respect it :(
+		#xb,yb,width,height,cx,cy=cr.text_extents("Título 1")
+
+		height=self.height
+
+		if width==1:
+			half_button=False
+		else:
+			half_button=True
+		
+		width-=self.left_margin+self.right_margin#2*self.margin_x
+		
+		if half_button: # we want half button
+			if x==0:
+				xi=self.left_margin+radius
+				xf=((self.left_margin+1-self.right_margin)/2.0)-radius
+			else:
+				xi=((self.left_margin+1-self.right_margin)/2.0)+radius
+				xf=1-self.right_margin-radius
+		else:
+			xi=self.left_margin+radius
+			xf=1-self.right_margin-radius
+
+		cr.set_line_width(linea)
+	
+		cor=float(bgcolor0)/65535.0
+		cog=float(bgcolor1)/65535.0
+		cob=float(bgcolor2)/65535.0
+		coa=float(bgcolor3)/65535.0
+		cr.set_source_rgba(cor,cog,cob,coa)
+
+		cr.move_to(xi,y-border)
+		cr.line_to(xf,y-border)
+		cr.curve_to(xf+radius,y-border,xf+radius,y+height+border,xf,y+height+border)
+		cr.line_to(xi,y+height+border)
+		cr.curve_to(xi-radius,y+height+border,xi-radius,y-border,xi,y-border)
+		cr.fill()
+
+		arrowx=(xi+xf)/2
+		if x==0:
+			arrowx+=0.0175
+			s=True
+		else:
+			s=False
+			arrowx-=0.0175
+
+		self.menu_paint_arrow(cr, arrowx+self.shadow_offset, y+self.shadow_offset, s, height, shcolor)
+		self.menu_paint_arrow(cr, arrowx, y, s, height, fgcolor)
+
+	
+	def menu_paint_arrow(self,cr,x,y,s,height,color):
+	
+		if color==None:
+			return
+	
+		cor=float(color0)/65535.0
+		cog=float(color1)/65535.0
+		cob=float(color2)/65535.0
+		coa=float(color3)/65535.0
+		cr.set_source_rgba(cor,cog,cob,coa)
+
+		cr.move_to(x,y)
+		if s:
+			cr.line_to(x-0.035,y+height/2)
+		else:
+			cr.line_to(x+0.035,y+height/2)
+		cr.line_to(x,y+height)
+		cr.line_to(x,y)
+		cr.fill()
+
+		
+	def menu_set_text(self,cr,x,y,halign,texto,bgcolor,fontcolor,myfontname="Sans",myfontstyle=cairo.FONT_WEIGHT_BOLD,myfontslant=cairo.FONT_SLANT_NORMAL,myfontsize=12,vcenter=True):
+
+		fontsize2=myfontsize*0.00315
+
+		cr.select_font_face(myfontname,myfontslant,myfontstyle)
+
+		# I created the button image for this size, so I must respect it :(
+		#xb,yb,width,height,cx,cy=cr.text_extents("Título 1")
+		height=self.height
+	
+		cr.set_font_size(fontsize2)
+		xb,y2,width,h2,cx,cy2=cr.text_extents(texto)
+
+		#if ((bgcolor0<512) and (bgcolor1<512) and (bgcolor2<512)):
+		#	bgcolor0=512
+		#	bgcolor1=512
+		#	bgcolor2=512
+			
+		#if ((fontcolor0<512) and (fontcolor1<512) and (fontcolor2<512)):
+		#	fontcolor0=512
+		#	fontcolor1=512
+		#	fontcolor2=512
+		
+		cor=float(fontcolor0)/65535.0
+		cog=float(fontcolor1)/65535.0
+		cob=float(fontcolor2)/65535.0
+		coa=float(fontcolor3)/65535.0
+		cr.set_source_rgba(cor,cog,cob,coa)
+		if halign==2: # center
+			nx=((self.left_margin+1-self.right_margin)-width)/2
+		elif halign==0: # left
+			nx=self.left_margin+self.radius
+		elif halign==1: # right
+			nx=1.0-self.right_margin-width-self.radius
+		
+		nx+=x
+		
+		if vcenter:
+			ny=y-y2+(height-h2)/2.0
+		else:
+			ny=y-y2+(height-h2)
+
+		cr.move_to(nx,ny)		
+		cr.show_text(texto)
+
+
+	def create_menu_bg(self,counter,element,paint_bg=0,preview=False):
+
+		""" Paints the menu in a Cairo surface.	PAINT_BG can be:
+			0: paints everything for the base picture
+			1: paints the HIGHLIGHT picture
+			2: paints the ACTIVE picture
+			3: paints the SELECT picture		
+		"""
+
+		if paint_bg==0:
+			try:
+				print "Uso "+str(self.menu_bg)
+				extra_pixbuf = gtk.gdk.pixbuf_new_from_file(self.menu_bg)
+				extra_x = extra_pixbuf.get_width()
+				extra_y = extra_pixbuf.get_height()
+
+				sf_base = cairo.ImageSurface(0,extra_x,extra_y)
+
+				extra_ct = cairo.Context(sf_base)
+				extra_ct2 = gtk.gdk.CairoContext(extra_ct)
+
+				extra_ct2.set_source_pixbuf(extra_pixbuf,0,0)
+				extra_ct2.paint()
+				extra_ct2.stroke()
+			except:
+				return None
+
+		if self.menu_PAL:
+			y=576.0
+		else:
+			y=480.0
+
+		sf=cairo.ImageSurface(cairo.FORMAT_ARGB32,720,int(y))
+		cr=cairo.Context(sf)
+		if paint_bg!=0: # if we are creating something different than the base, we use a 1bit surface
+			fo=cairo.FontOptions()
+			fo.set_antialias(cairo.ANTIALIAS_NONE)
+			cr.set_font_options(fo)
+			cr.set_antialias(cairo.ANTIALIAS_NONE)
+		else:
+			cr.set_source_rgb(1.0,1.0,1.0)
+			cr.paint()
+
+		cr.identity_matrix()
+		
+		if paint_bg==0:
+			wbase=float(sf_base.get_width())
+			hbase=float(sf_base.get_height())
+			cr.scale(720.0/wbase,y/hbase)
+			cr.set_source_surface(sf_base)
+			cr.paint()
+			cr.identity_matrix()
+		
+
+		cr.scale(sf.get_width(),1.33*sf.get_height()) # picture gets from 0 to 1 in X and from 0 to 0.75 in Y
+
+		if (self.align==0):
+			pos_y=self.top_margin
+		elif self.align==1:
+			pos_y=0.75-self.bottom_margin-self.height2*float(len(self.structurecounter:counter+self.lines_per_menu))
+		else:
+			pos_y=(self.top_margin+(0.75-self.bottom_margin)-self.height2*float(len(self.structurecounter:counter+self.lines_per_menu)))/2
+		pos_y3=0.75-self.bottom_margin-self.height2
+		#pos_y3=pos_y+self.height2*float((self.lines_per_menu)-1)
+		
+		fontname,fontstyle,fontslant,fontsize=devede_other.get_font_params(self.font_name)
+
+		shadowcolor=self.shadowcolor
+		if paint_bg!=2:
+			pos_y2=pos_y
+			if paint_bg==0:
+				bgcolor=self.bgcolor
+				fontcolor=self.fontcolor
+				arrowcolor=self.fontcolor
+				arrowshadowcolor=shadowcolor
+			elif paint_bg==1:
+				bgcolor=0,0,0,0
+				fontcolor=self.activecolor
+				arrowcolor=self.activecolor
+				strokecolor=self.activecolor
+				arrowshadowcolor=None
+			elif paint_bg==2:
+				bgcolor=0,0,0,0
+				fontcolor=self.fontcolor
+				arrowcolor=self.fontcolor
+				strokecolor=self.fontcolor
+				arrowshadowcolor=None
+			else:
+				bgcolor=0,0,0,0
+				fontcolor=self.inactivecolor
+				arrowcolor=self.inactivecolor
+				strokecolor=self.inactivecolor
+				arrowshadowcolor=None
+				
+			for entrada in self.structurecounter:counter+self.elements_per_menu:
+				print pos_y
+				self.menu_set_bg(cr, 0, pos_y, 1, bgcolor)
+				if paint_bg==0: # print the shadow first
+					self.menu_set_text(cr,self.shadow_offset,pos_y+self.shadow_offset,self.halign,entrada0"nombre",bgcolor,shadowcolor,fontname,fontstyle,fontslant,fontsize)
+				self.menu_set_text(cr,0,pos_y,self.halign,entrada0"nombre",bgcolor,fontcolor,fontname,fontstyle,fontslant,fontsize)
+				pos_y+=self.height2
+
+			print "Paint_bg "+str(paint_bg)+" title text: "+str(self.title_text)
+			if (paint_bg==0) and (self.title_text!=""):
+				print "pongo titulo "+self.title_text
+				fontname,fontstyle,fontslant,fontsize=devede_other.get_font_params(self.title_fontname)
+				self.menu_set_text(cr,self.shadow_offset, 0.075+self.shadow_offset,2,self.title_text, 0,0,0,0, self.title_shadow, fontname, fontstyle, fontslant, fontsize, False)
+				self.menu_set_text(cr,0, 0.075,2,self.title_text, 0,0,0,0, self.title_color, fontname, fontstyle, fontslant, fontsize, False)
+
+			# check if we have to paint the NEXT MENU button
+			if (element!=self.nmenues-1) and (self.nmenues>1):
+				self.menu_set_bg(cr, 1, pos_y3, 0.4, bgcolor,arrowcolor,arrowshadowcolor)
+			# check if we have to paint the PREVIOUS MENU button
+			if (element!=0) or ((self.extcr!=None) and (self.nmenues>1)):
+				self.menu_set_bg(cr, 0, pos_y3, 0.4, bgcolor,arrowcolor,arrowshadowcolor)
+
+		if self.extcr==None:
+			if paint_bg==0:
+				sf.write_to_png(self.filefolder+self.filename+"_menu"+str(element)+"_bg.png")
+			elif paint_bg==1:
+				sf.write_to_png(self.filefolder+self.filename+"_menu"+str(element)+"_bg_active_out.png")
+			elif paint_bg==2:
+				sf.write_to_png(self.filefolder+self.filename+"_menu"+str(element)+"_bg_inactive_out.png")
+			else:
+				sf.write_to_png(self.filefolder+self.filename+"_menu"+str(element)+"_bg_select_out.png")
+		return sf
+
+	
+	def create_menu_mpg_ffmpeg(self,counter):
+
+		self.mplexed=False
+		command_var=
+		command_var.append("ffmpeg")
+		#command_var.append("avconv")
+	
+		currentfile=self.filefolder+self.filename+"_menu_"+str(counter)+".mpg"
+	
+		audio=self.menu_sound
+		command_var.append("-loop")
+		command_var.append("1")
+		
+		command_var.append("-f")
+		command_var.append("image2")
+		command_var.append("-i")
+		command_var.append(self.filefolder+self.filename+"_menu"+str(counter)+"_bg.png")
+		command_var.append("-i")
+		command_var.append(audio)
+	
+		command_var.append("-y")
+		command_var.append("-target")
+		if self.menu_PAL:
+			command_var.append("pal-dvd")
+		else:
+			command_var.append("ntsc-dvd")
+		command_var.append("-acodec")
+		if self.AC3_fix_ffmpeg:
+			command_var.append("ac3_fixed")
+		else:
+			command_var.append("ac3")
+		command_var.append("-s")
+		if self.menu_PAL:
+			command_var.append("720x576")
+		else:
+			command_var.append("720x480")
+		command_var.append("-g")
+		command_var.append("12")
+#		command_var.append("-bf")
+#		command_var.append("2")
+#		command_var.append("-strict")
+#		command_var.append("1")
+#		command_var.append("-ac")
+#		command_var.append("2")
+#		command_var.append("-trellis")
+#		command_var.append("1")
+#		command_var.append("-mbd")
+#		command_var.append("2")
+		command_var.append("-b")
+		command_var.append("2500k")
+		command_var.append("-ab")
+		command_var.append("192000")
+#		command_var.append("-maxrate")
+#		command_var.append("4000k")
+#		command_var.append("-minrate")
+#		command_var.append("2200k")
+		command_var.append("-aspect")
+		command_var.append("4:3")
+
+		command_var.append("-t")
+		command_var.append(str(1+self.menu_sound_duration))
+
+		#audio="/home/raster/Escritorio/lazy.mp3"
+		
+		command_var.append(currentfile)
+		origDir=os.getcwd()
+		print "Lanzo "+str(command_var)
+
+		self.launch_program(command_var)
+	
+
+	def create_menu_mpg_avconv(self,counter):
+
+		self.mplexed=False
+		command_var=
+		command_var.append("avconv")
+		#command_var.append("avconv")
+	
+		currentfile=self.filefolder+self.filename+"_menu_"+str(counter)+".mpg"
+	
+		audio=self.menu_sound
+		command_var.append("-loop")
+		command_var.append("1")
+		
+		command_var.append("-f")
+		command_var.append("image2")
+		command_var.append("-i")
+		command_var.append(self.filefolder+self.filename+"_menu"+str(counter)+"_bg.png")
+		command_var.append("-i")
+		command_var.append(audio)
+	
+		command_var.append("-y")
+		command_var.append("-target")
+		if self.menu_PAL:
+			command_var.append("pal-dvd")
+		else:
+			command_var.append("ntsc-dvd")
+		command_var.append("-acodec")
+		if self.AC3_fix_avconv:
+			command_var.append("ac3_fixed")
+		else:
+			command_var.append("ac3")
+		command_var.append("-s")
+		if self.menu_PAL:
+			command_var.append("720x576")
+		else:
+			command_var.append("720x480")
+		command_var.append("-g")
+		command_var.append("12")
+#		command_var.append("-bf")
+#		command_var.append("2")
+#		command_var.append("-strict")
+#		command_var.append("1")
+#		command_var.append("-ac")
+#		command_var.append("2")
+#		command_var.append("-trellis")
+#		command_var.append("1")
+#		command_var.append("-mbd")
+#		command_var.append("2")
+		command_var.append("-b:v")
+		command_var.append("2500k")
+		command_var.append("-b:a")
+		command_var.append("192k")
+#		command_var.append("-maxrate")
+#		command_var.append("4000k")
+#		command_var.append("-minrate")
+#		command_var.append("2200k")
+		command_var.append("-aspect")
+		command_var.append("4:3")
+
+		command_var.append("-t")
+		command_var.append(str(1+self.menu_sound_duration))
+
+		#audio="/home/raster/Escritorio/lazy.mp3"
+		
+		command_var.append(currentfile)
+		origDir=os.getcwd()
+		print "Lanzo "+str(command_var)
+
+		self.launch_program(command_var)
+
+
+	
+	def create_menu_mpg(self,counter):
+	
+		print "Creating menus"
+	
+		if (self.encoder_menu=="ffmpeg"):
+			self.create_menu_mpg_ffmpeg(counter)
+			return
+	
+		if (self.encoder_menu=="avconv"):
+			self.create_menu_mpg_avconv(counter)
+			return
+	
+		self.mplexed=False
+		command_var=
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			command_var="mencoder.exe"
+		else:
+			command_var="mencoder"
+	
+		currentfile=self.filefolder+self.filename+"_menu_"+str(counter)+".mpg"
+	
+		command_var.append("-srate")
+		command_var.append("48000")
+		command_var.append("-af")
+		command_var.append("lavcresample=48000")
+		command_var.append("-oac")
+		command_var.append("lavc")
+		command_var.append("-ovc")
+		command_var.append("lavc")
+		command_var.append("-of")
+		command_var.append("mpeg")
+		command_var.append("-mpegopts")
+		command_var.append("format=dvd:tsaf")
+		command_var.append("-ofps")
+		audio=self.menu_sound
+		#audio="/home/raster/Escritorio/lazy.mp3"
+		if self.menu_PAL:
+			command_var.append("25")
+		else:
+			command_var.append("30000/1001")
+
+		wide="4/3"
+		command_var.append("-vf")
+		if self.menu_PAL:
+			command_var.append("scale=720:576,harddup")
+		else:
+			command_var.append("scale=720:480,harddup")
+		command_var.append("-lavcopts")
+		if self.threads>8:
+			nthreads=8
+		else:
+			nthreads=self.threads
+		
+		if nthreads>1:
+			lavcopts="threads="+str(nthreads)+":"
+		else:
+			lavcopts=""
+		lavcopts+="vcodec=mpeg2video:sc_threshold=1000000000:cgop:trell:mbd=2:vstrict=0:"
+		lavcopts+="vrc_maxrate=4000:vrc_buf_size=1835:vbitrate=2500:keyint=12:"
+		lavcopts+="acodec="
+		if self.AC3_fix:
+			lavcopts+="ac3_fixed"
+		else:
+			lavcopts+="ac3"
+		lavcopts+=":abitrate=192:aspect="+wide
+		command_var.append(lavcopts)
+		command_var.append("-o")
+		command_var.append(currentfile)
+		command_var.append("-audiofile")
+		command_var.append(audio)
+		command_var.append("-mf")
+		command_var.append("type=png:fps=1/"+str(self.menu_sound_duration))
+		origDir=os.getcwd()
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			temp=os.path.split(self.filefolder+self.filename+"_menu"+str(counter)+"_bg.png")
+			picDir=temp0
+			picName=temp1
+			command_var.append("mf://"+picName)
+			os.chdir(picDir)
+		else:
+			command_var.append("mf://"+self.filefolder+self.filename+"_menu"+str(counter)+"_bg.png")
+		print "Lanzo "+str(command_var)
+
+		self.launch_program(command_var)
+		
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			os.chdir(origDir)
+
+	
+	def menu_mplex_buttons(self,counter):
+	
+		self.mplexed=True
+		if (sys.platform=="win32") or (sys.platform=="win64"):
+			comando="spumux.exe"
+			# The -i -o is with a custom patched version of
+			# dvdauthor.  Best and easiest way of making it work
+			comando.append(os.path.join(self.filefolder,self.filename+"_menu_"+str(counter)+".xml"))
+			comando.append("-i")
+			comando.append(os.path.join(self.filefolder,self.filename+"_menu_"+str(counter)+".mpg"))
+			comando.append("-o")
+			comando.append(os.path.join(self.filefolder,self.filename+"_menu2_"+str(counter)+".mpg"))
+			self.launch_program(comando)
+		else:
+			comando="spumux"
+			
+			comando+=' "' +os.path.join(self.filefolder,self.filename+'_menu_'+str(counter)+'.xml"')
+
+			print "Launch: "+comando
+			self.launch_shell(comando,stdinout=os.path.join(self.filefolder,self.filename+"_menu_"+str(counter)+".mpg"),os.path.join(self.filefolder,self.filename+"_menu2_"+str(counter)+".mpg"))
+
+
+	def end_process(self,eraser,erase_temporary_files):
+		
+		if erase_temporary_files and self.mplexed:
+			eraser.delete_menu_temp()

devede-3.23.0.tar.bz2/build/scripts-2.7 Added

devede-3.23.0.tar.bz2/build/scripts-2.7/devede Added

@@ -0,0 +1,414 @@
+#!/usr/bin/python
+# -*- coding: UTF-8 -*-
+
+# Copyright 2006-2009 (C) Raster Software Vigo (Sergio Costas)
+# Copyright 2006-2009 (C) Peter Gill - win32 parts
+
+# This file is part of DeVeDe
+#
+# DeVeDe is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# DeVeDe is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program.  If not, see <http://www.gnu.org/licenses/>.
+
+
+import sys
+import os
+import pygtk # for testing GTK version number
+pygtk.require ('2.0')
+import gtk
+import gobject
+import subprocess
+import locale
+import gettext
+import stat
+import shutil
+import pickle
+import cairo
+
+print "DeVeDe 3.23.0 beta1"
+if (sys.platform!="win32") and (sys.platform!="win64"):
+	try:
+		print "Locale: "+str(os.environ"LANG")
+	except:
+		print "Locale not defined"
+
+# append the directories where we install the devede's own modules
+tipo=-1
+
+try:
+	os.stat("/usr/share/devede/wmain.ui")
+	tipo=0
+	found=True
+except:
+	found=False
+
+if found==False:
+	try:
+		os.stat("/usr/local/share/devede/wmain.ui")
+		tipo=1
+		found=True
+	except:
+		found=False
+
+if tipo==0:
+	#gettext.bindtextdomain('devede', '/usr/share/locale')
+	#Note also before python 2.3 you need the following if
+	#you need translations from non python code (glibc,libglade etc.)
+	#there are other access points to this function
+	#gtk.glade.bindtextdomain("devede","/usr/share/locale")
+	#arbol=gtk.Builder("/usr/share/devede/devede.glade",domain="devede")
+	# append the directories where we install the devede's own modules
+
+	share_locale="/usr/share/locale"
+	glade="/usr/share/devede"
+	sys.path.append("/usr/lib/devede")
+	font_path="/usr/share/devede"
+	pic_path="/usr/share/devede"
+	other_path="/usr/share/devede"
+	help_path="/usr/share/doc/devede"
+	print "Using package-installed files"
+	
+elif tipo==1:
+	# if the files aren't at /usr, try with /usr/local
+	#gettext.bindtextdomain('devede', '/usr/share/locale')
+	#Note also before python 2.3 you need the following if
+	#you need translations from non python code (glibc,libglade etc.)
+	#there are other access points to this function
+	#gtk.glade.bindtextdomain("devede","/usr/share/locale")
+	#arbol=gtk.Builder("/usr/local/share/devede/devede.glade",domain="devede")
+
+	share_locale="/usr/share/locale" # Are you sure?
+	# if the files aren't at /usr, try with /usr/local
+	glade="/usr/local/share/devede"
+	sys.path.append("/usr/local/lib/devede")
+	font_path="/usr/local/share/devede"
+	pic_path="/usr/local/share/devede"
+	other_path="/usr/local/share/devede"
+	help_path="/usr/local/share/doc/devede"
+	print "Using local-installed files"
+	
+else:
+	print "Can't locate extra files. Aborting."
+	sys.exit(1)
+
+
+#####################
+#   GetText Stuff   #
+#####################
+
+gettext.bindtextdomain('devede',share_locale)
+try:
+	locale.setlocale(locale.LC_ALL,"")
+except locale.Error:
+	pass
+gettext.textdomain('devede')
+gettext.install("devede",localedir=share_locale) # None is sys default locale
+#   Note also before python 2.3 you need the following if
+#   you need translations from non python code (glibc,libglade etc.)
+#   there are other access points to this function
+#gtk.glade.bindtextdomain("devede",share_locale)
+
+arbol=gtk.Builder()
+arbol.set_translation_domain("devede")
+
+#   To actually call the gettext translation functions
+#   just replace your strings "string" with gettext("string")
+#   The following shortcut are usually used:
+_ = gettext.gettext
+
+try:
+	import devede_other
+except:
+	print "Failed to load modules DEVEDE_OTHER. Exiting"
+	sys.exit(1)
+try:
+	import devede_convert
+except:
+	print "Failed to load modules DEVEDE_CONVERT. Exiting"
+	sys.exit(1)
+try:
+	import devede_newfiles
+except:
+	print "Failed to load module DEVEDE_NEWFILES. Exiting"
+	sys.exit(1)
+try:
+	import devede_xml_menu
+except:
+	print "Failed to load module DEVEDE_XML_MENU"
+	sys.exit(1)
+
+try:
+	import devede_disctype
+except:
+	print "Failed to load module DEVEDE_DISCTYPE"
+	sys.exit(1)
+
+try:
+	import devede_fonts
+except:
+	print "Failed to load module DEVEDE_FONTS"
+	sys.exit(1)
+
+
+home=devede_other.get_home_directory()
+
+#locale.setlocale(locale.LC_ALL,"")
+#gettext.textdomain('devede')
+#_ = gettext.gettext
+
+# global variables used (they are stored in a single dictionary to
+# avoid true global variables):
+# there are these two that aren't stored in the dictionary because they are very widely used:
+# arbol
+# structure
+
+global_vars={}
+
+if pic_path-1!=os.sep:
+	pic_path+=os.sep
+
+def get_number(line):
+		
+	pos=line.find(":")
+	if pos==-1:
+		return -1
+	
+	return int(linepos+1:)
+
+def get_cores():
+	
+	""" Returns the number of cores available in the system """
+	
+	try:
+		import multiprocessing
+		hyper=multiprocessing.cpu_count()
+	except:
+		hyper=1
+	
+	if (sys.platform=="win32") or (sys.platform=="win64"):
+		logical_cores = win32api.GetSystemInfo()5 #Logical Cores
+		return (logical_cores,logical_cores)
+
+	failed=False
+	try:
+		proc=open("/proc/cpuinfo","r")
+	except:
+		failed=True
+		
+		
+	if failed:
+		# If can't read /proc/cpuinfo, try to use the multiprocessing module
+		
+		return (hyper,hyper) # if we can't open /PROC/CPUINFO, return only one CPU (just in case)
+	
+	siblings=1 # default values
+	cpu_cores=1 # for siblings and cpu cores
+	notfirst=False
+	ncores=0
+	nvirtcores=0
+	while(True):
+		line=proc.readline()
+		
+		if (((line:9=="processor") and notfirst) or (line=="")):
+			
+			# each entry is equivalent to CPU_CORES/SIBLINGS real cores
+			# (always 1 except in HyperThreading systems, where it counts 1/2)
+			
+			ncores+=(float(cpu_cores))/(float(siblings))
+			siblings=1
+			cpu_cores=1
+
+		if line=="":
+			break
+			
+		if line:9=="processor":
+			notfirst=True
+			nvirtcores+=1
+		elif (line:8=="siblings"):
+			siblings=get_number(line)
+		elif (line:9=="cpu cores"):
+			cpu_cores=get_number(line)
+
+	if (nvirtcores==0):
+		nvirtcores=1
+	if(ncores<=1.0):
+		return (1,nvirtcores)
+	else:
+		return (int(ncores),nvirtcores)
+
+global_vars"PAL"=True
+global_vars"disctocreate"=""
+global_vars"path"=pic_path
+global_vars"install_path"=other_path
+global_vars"menu_widescreen"=False
+global_vars"gladefile"=glade
+global_vars"erase_temporary_files"=True
+global_vars"number_actions"=1
+global_vars"expand_advanced"=False
+global_vars"erase_files"=True
+global_vars"action_todo"=2
+global_vars"filmpath"=""
+global_vars"help_path"=help_path
+global_vars"finalfolder"=""
+global_vars"sub_codepage"="ISO-8859-1"
+global_vars"sub_language"="EN (ENGLISH)"
+global_vars"with_menu"=True
+global_vars"AC3_fix"=False
+global_vars"AC3_fix_ffmpeg"=False
+global_vars"AC3_fix_avconv"=False
+(a,b)=get_cores()
+global_vars"cores"=a
+global_vars"hypercores"=b
+global_vars"encoder_video"="ffmpeg"
+global_vars"encoder_menu"="mencoder"
+global_vars"warning_ffmpeg"=False
+global_vars"shutdown_after_disc"=False
+
+global_vars"menu_top_margin"=0.125
+global_vars"menu_bottom_margin"=0.125
+global_vars"menu_left_margin"=0.1
+global_vars"menu_right_margin"=0.1
+global_vars"encoders"=
+#global_vars""=""
+
+print "Cores: "+str(global_vars"cores")+" Virtual cores: "+str(global_vars"hypercores")
+
+if font_path-1!=os.sep:
+	font_path+=os.sep
+font_path+="devedesans.ttf"
+global_vars"font_path"=font_path
+
+print "Entro en fonts"
+fonts_found=devede_fonts.prepare_devede_font(home,font_path)
+print "Salgo de fonts"
+
+devede_other.load_config(global_vars) # load configuration
+
+errors="" # check for installed programs
+if (sys.platform=="win32") or (sys.platform=="win64"):
+	try:
+		devede_other.check_program("mplayer.exe", "-v")
+	except:
+		errors+="mplayer\n"
+	try:
+		devede_other.check_program("mencoder.exe", "-msglevel", "help")
+	except:
+		errors+="mencoder\n"
+	try:
+		devede_other.check_program("dvdauthor.exe", "--help")
+	except:
+		errors+="dvdauthor\n"
+	try:
+		devede_other.check_program("vcdimager.exe", "--help")
+	except:
+		errors+="vcdimager\n"
+	try:
+		devede_other.check_program("iconv.exe", "--help")
+	except:
+		errors+="iconv\n"
+	
+	try:
+		devede_other.check_program("mkisofs.exe")
+		mkisofs=True
+		global_vars"iso_creator"="mkisofs.exe"
+	except:
+		mkisofs=False
+
+	if mkisofs==False:
+		try:
+			devede_other.check_program("genisoimage.exe")
+			global_vars"iso_creator"="genisoimage.exe"
+		except:
+			errors+="genisoimage/mkisofs\n"
+
+	try:
+		devede_other.check_program("spumux.exe", "--help")
+	except:
+		errors+="spumux\n"
+
+else:
+
+	if 127==devede_other.check_program("mplayer -v"):
+		errors+="mplayer\n"
+	if 0==devede_other.check_program("mencoder -msglevel help"):
+		global_vars"encoders".append("mencoder")
+	if 0==devede_other.check_program("ffmpeg --help"):
+		global_vars"encoders".append("ffmpeg")
+	if 0==devede_other.check_program("avconv --help"):
+		global_vars"encoders".append("avconv")
+	if 127==devede_other.check_program("dvdauthor --help"):
+		errors+="dvdauthor\n"
+	if 127==devede_other.check_program("vcdimager --help"):
+		errors+="vcdimager\n"
+	if 127==devede_other.check_program("iconv --help"):
+		errors+="iconv\n"
+	if 127==devede_other.check_program("mkisofs -help"):
+		if 127==devede_other.check_program("genisoimage -help"):
+			errors+="genisoimage/mkisofs\n"
+		else:
+			global_vars"iso_creator"="genisoimage"
+	else:
+		global_vars"iso_creator"="mkisofs"
+
+	if 127==devede_other.check_program("spumux --help"):
+		errors+="spumux\n"
+
+
+
+def program_exit(widget):
+	
+	gtk.main_quit()
+
+
+if len(global_vars"encoders")==0:
+	errors+="Mencoder, FFmpeg and/or AVconv"
+
+if errors!="":
+	arbol.add_from_file(os.path.join(glade,"wprograms.ui"))
+	w=arbol.get_object("programs_label")
+	w.set_text(errors)
+	wprograms=arbol.get_object("wprograms")
+	wprograms.show()
+	w=arbol.get_object("program_exit")
+	w.connect("clicked",program_exit)
+	wprograms.connect("destroy",program_exit)
+elif fonts_found==False:
+	arbol.add_from_file(os.path.join(glade,"wnofonts.ui"))
+	wprograms=arbol.get_object("wnofonts")
+	wprograms.show()
+	w=arbol.get_object("fonts_program_exit")
+	w.connect("clicked",program_exit)
+	wprograms.connect("destroy",program_exit)
+else:
+	new_file=devede_disctype.disctype(global_vars)
+
+found_v=False
+found_m=False
+for i in global_vars"encoders":
+	if i==global_vars"encoder_video":
+		found_v=True
+	if i==global_vars"encoder_menu":
+		found_m=True
+
+l=len(global_vars"encoders")
+if found_v==False:
+	global_vars"encoder_video"=global_vars"encoders"l-1
+if found_m==False:
+	global_vars"encoder_menu"=global_vars"encoders"l-1
+
+gtk.main()
+print "Saving configuration"
+devede_other.save_config(global_vars)
+print "Exiting"
+print "Have a nice day"
+sys.stdout.flush()
+sys.stderr.flush()

devede-3.22.0.tar.bz2/changes.txt -> devede-3.23.0.tar.bz2/changes.txt Changed

devede-3.22.0.tar.bz2/devede -> devede-3.23.0.tar.bz2/devede Changed

@@ -34,7 +34,7 @@
 import pickle
 import cairo
 
-print "DeVeDe 3.22.0"
+print "DeVeDe 3.23.0 beta1"
 if (sys.platform!="win32") and (sys.platform!="win64"):
 	try:
 		print "Locale: "+str(os.environ"LANG")
@@ -45,26 +45,15 @@
 tipo=-1
 
 try:
-	fichero=open("./interface/wmain.ui","r")
-	fichero.close()
-	tipo=2
+	os.stat("/usr/share/devede/wmain.ui")
+	tipo=0
 	found=True
 except:
-	found=False	
+	found=False
 
 if found==False:
 	try:
-		fichero=open("/usr/share/devede/wmain.ui","r")
-		fichero.close()
-		tipo=0
-		found=True
-	except:
-		found=False
-
-if found==False:
-	try:
-		fichero=open("/usr/local/share/devede/wmain.ui","r")
-		fichero.close()
+		os.stat("/usr/local/share/devede/wmain.ui")
 		tipo=1
 		found=True
 	except:
@@ -107,25 +96,6 @@
 	help_path="/usr/local/share/doc/devede"
 	print "Using local-installed files"
 	
-elif tipo==2:
-	# if the files aren't at /usr/local, try with ./
-	#gettext.bindtextdomain('devede', './po/')
-	#Note also before python 2.3 you need the following if
-	#you need translations from non python code (glibc,libglade etc.)
-	#there are other access points to this function
-	#gtk.glade.bindtextdomain("devede","/usr/share/locale")
-	#arbol=gtk.Builder("./devede.glade",domain="devede")
-	
-	# if the files aren't at /usr/local, try with ./
-	share_locale="./po/"
-	glade="./interface"
-	sys.path.append(os.getcwd())#("./")
-	font_path=os.getcwd()#"./"
-	pic_path=os.path.join(font_path, "pixmaps") #pic_path=font_path
-	other_path=os.path.join(font_path,"pixmaps")
-	help_path=os.path.join(font_path,"doc")
-	print "Using direct files"
-	
 else:
 	print "Can't locate extra files. Aborting."
 	sys.exit(1)
@@ -293,11 +263,13 @@
 global_vars"sub_language"="EN (ENGLISH)"
 global_vars"with_menu"=True
 global_vars"AC3_fix"=False
+global_vars"AC3_fix_ffmpeg"=False
+global_vars"AC3_fix_avconv"=False
 (a,b)=get_cores()
 global_vars"cores"=a
 global_vars"hypercores"=b
-global_vars"use_ffmpeg"=True
-global_vars"use_ffmpeg_menu"=False
+global_vars"encoder_video"="ffmpeg"
+global_vars"encoder_menu"="mencoder"
 global_vars"warning_ffmpeg"=False
 global_vars"shutdown_after_disc"=False
 
@@ -305,6 +277,7 @@
 global_vars"menu_bottom_margin"=0.125
 global_vars"menu_left_margin"=0.1
 global_vars"menu_right_margin"=0.1
+global_vars"encoders"=
 #global_vars""=""
 
 print "Cores: "+str(global_vars"cores")+" Virtual cores: "+str(global_vars"hypercores")
@@ -366,10 +339,12 @@
 
 	if 127==devede_other.check_program("mplayer -v"):
 		errors+="mplayer\n"
-	if 127==devede_other.check_program("mencoder -msglevel help"):
-		errors+="mencoder\n"
-	if 127==devede_other.check_program("ffmpeg --help"):
-		errors+="ffmpeg\n"
+	if 0==devede_other.check_program("mencoder -msglevel help"):
+		global_vars"encoders".append("mencoder")
+	if 0==devede_other.check_program("ffmpeg --help"):
+		global_vars"encoders".append("ffmpeg")
+	if 0==devede_other.check_program("avconv --help"):
+		global_vars"encoders".append("avconv")
 	if 127==devede_other.check_program("dvdauthor --help"):
 		errors+="dvdauthor\n"
 	if 127==devede_other.check_program("vcdimager --help"):
@@ -388,11 +363,15 @@
 		errors+="spumux\n"
 
 
+
 def program_exit(widget):
 	
 	gtk.main_quit()
 
 
+if len(global_vars"encoders")==0:
+	errors+="Mencoder, FFmpeg and/or AVconv"
+
 if errors!="":
 	arbol.add_from_file(os.path.join(glade,"wprograms.ui"))
 	w=arbol.get_object("programs_label")
@@ -412,6 +391,20 @@
 else:
 	new_file=devede_disctype.disctype(global_vars)
 
+found_v=False
+found_m=False
+for i in global_vars"encoders":
+	if i==global_vars"encoder_video":
+		found_v=True
+	if i==global_vars"encoder_menu":
+		found_m=True
+
+l=len(global_vars"encoders")
+if found_v==False:
+	global_vars"encoder_video"=global_vars"encoders"l-1
+if found_m==False:
+	global_vars"encoder_menu"=global_vars"encoders"l-1
+
 gtk.main()
 print "Saving configuration"
 devede_other.save_config(global_vars)

devede-3.23.0.tar.bz2/devede_avconv_convert.py Added

devede-3.22.0.tar.bz2/devede_convert.py -> devede-3.23.0.tar.bz2/devede_convert.py Changed

@@ -46,6 +46,7 @@
 import devede_other
 import devede_video_convert
 import devede_ffmpeg_convert
+import devede_avconv_convert
 import devede_subtitles
 import devede_xml_menu
 import devede_delete
@@ -115,17 +116,20 @@
 		estado=''
 		freespace=''
 		if (sys.platform!="win32") and (sys.platform!="win64"):
-			print "Checking "+str(filefolder)
-			estado=os.statvfs(filefolder) # eg. f="C:\Documents and Settings\User name\Desktop"
-			freespace=95*estado.f_bsize*estado.f_bavail/100000
+			try:
+				print "Checking "+str(filefolder)
+				estado=os.statvfs(filefolder) # eg. f="C:\Documents and Settings\User name\Desktop"
+				freespace=95*estado.f_bsize*estado.f_bavail/100000
+			except ImportError:
+				print "Error when checking free space"
+				freespace=0
 		else:
 			try:
 				test_drive = os.path.splitdrive(filefolder)0 + "\\" # So it will also work on Windows 2000 
 				spc, bps, fc, tc = win32api.GetDiskFreeSpace(test_drive)
 				freespace=fc * spc * bps
-
 			except ImportError:
-				pass
+				freespace=0
 		print "Free space in "+str(filefolder)+": "+str(freespace)
 		print "estatus ", estado, "\n"
 	
@@ -184,7 +188,7 @@
 		self.global_vars=global_vars
 		
 		self.has_mp3lame=True
-		if (global_vars"disctocreate"=="divx") and (global_vars"use_ffmpeg"):
+		if (global_vars"disctocreate"=="divx") and ((global_vars"encoder_video"=="ffmpeg") or (global_vars"encoder_video"=="avconv")):
 			if (False==self.check_mp3lame()):
 				return
 		
@@ -497,8 +501,10 @@
 			else:
 				encpass = int(action01)
 			print "Segundos "+str(self.seconds)
-			if (self.global_vars"use_ffmpeg"):
-				self.runner=devede_ffmpeg_convert.video_converter_ffmpeg(self.global_vars,self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, encpass,self.global_vars"AC3_fix")
+			if (self.global_vars"encoder_video"=="ffmpeg"):
+				self.runner=devede_ffmpeg_convert.video_converter_ffmpeg(self.global_vars,self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, encpass,self.global_vars"AC3_fix_ffmpeg")
+			elif (self.global_vars"encoder_video"=="avconv"):
+				self.runner=devede_avconv_convert.video_converter_ffmpeg(self.global_vars,self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, encpass,self.global_vars"AC3_fix_avconv")
 			else:
 				self.runner=devede_video_convert.video_converter(self.global_vars,self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, encpass,self.global_vars"AC3_fix")
 			return True
@@ -506,8 +512,10 @@
 		if action0=="C2":
 			title=action1
 			chapter=action2
-			if (self.global_vars"use_ffmpeg"):
-				self.runner=devede_ffmpeg_convert.video_converter_ffmpeg(self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, 2,self.global_vars"AC3_fix")
+			if (self.global_vars"encoder_video"=="ffmpeg"):
+				self.runner=devede_ffmpeg_convert.video_converter_ffmpeg(self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, 2,self.global_vars"AC3_fix_ffmpeg")
+			elif (self.global_vars"encoder_video"=="avconv"):
+				self.runner=devede_avconv_convert.video_converter(self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, 2,self.global_vars"AC3_fix_avconv")
 			else:
 				self.runner=devede_video_convert.video_converter(self.structuretitlechapter+1,self.filename,self.filefolder,self.partial,self.label,self.global_vars"disctocreate",title+1,chapter+1,cores,self.seconds, 2,self.global_vars"AC3_fix")
 			return True

devede-3.22.0.tar.bz2/devede_dvdmenu.py -> devede-3.23.0.tar.bz2/devede_dvdmenu.py Changed

devede-3.22.0.tar.bz2/devede_ffmpeg_convert.py -> devede-3.23.0.tar.bz2/devede_ffmpeg_convert.py Changed

devede-3.22.0.tar.bz2/devede_newfiles.py -> devede-3.23.0.tar.bz2/devede_newfiles.py Changed

devede-3.22.0.tar.bz2/devede_other.py -> devede-3.23.0.tar.bz2/devede_other.py Changed

@@ -482,6 +482,16 @@
 					global_vars"AC3_fix"=True
 				else:
 					global_vars"AC3_fix"=False
+			if linea:15=="AC3_fix_ffmpeg:":
+				if linea15:=="1":
+					global_vars"AC3_fix_ffmpeg"=True
+				else:
+					global_vars"AC3_fix_ffmpeg"=False
+			if linea:15=="AC3_fix_avconv:":
+				if linea15:=="1":
+					global_vars"AC3_fix_avconv"=True
+				else:
+					global_vars"AC3_fix_avconv"=False
 			if linea:16=="erase_tmp_files:":
 				if linea16:=="1":
 					global_vars"erase_files"=True
@@ -489,14 +499,18 @@
 					global_vars"erase_files"=False
 			if linea:11=="use_ffmpeg:":
 				if linea11:=="1":
-					global_vars"use_ffmpeg"=True
+					global_vars"encoder_video"="ffmpeg"
 				else:
-					global_vars"use_ffmpeg"=False
+					global_vars"encoder_video"="mencoder"
 			if linea:16=="use_ffmpeg_menu:":
 				if linea16:=="1":
-					global_vars"use_ffmpeg_menu"=True
+					global_vars"encoder_menu"="ffmpeg"
 				else:
-					global_vars"use_ffmpeg_menu"=False
+					global_vars"encoder_menu"="mencoder"
+			if linea:13=="encoder_menu:":
+				global_vars"encoder_menu"=linea13:
+			if linea:14=="encoder_video:":
+				global_vars"encoder_video"=linea14:
 			#if linea:==":":
 			#	global_vars""=linea:
 		archivo.close()
@@ -540,20 +554,23 @@
 			archivo.write("AC3_fix:1\n")
 		else:
 			archivo.write("AC3_fix:0\n")
+		if global_vars"AC3_fix_ffmpeg":
+			archivo.write("AC3_fix_ffmpeg:1\n")
+		else:
+			archivo.write("AC3_fix_ffmpeg:0\n")
+		if global_vars"AC3_fix_avconv":
+			archivo.write("AC3_fix_avconv:1\n")
+		else:
+			archivo.write("AC3_fix_avconv:0\n")
 		if global_vars"erase_files":
 			archivo.write("erase_tmp_files:1\n")
 		else:
 			archivo.write("erase_tmp_files:0\n")
-		if global_vars"use_ffmpeg":
-			archivo.write("use_ffmpeg:1\n")
-		else:
-			archivo.write("use_ffmpeg:0\n")
-		if global_vars"use_ffmpeg_menu":
-			archivo.write("use_ffmpeg_menu:1\n")
-		else:
-			archivo.write("use_ffmpeg_menu:0\n")
+		archivo.write("encoder_video:"+global_vars"encoder_video"+"\n")
+		archivo.write("encoder_menu:"+global_vars"encoder_menu"+"\n")
 		archivo.close()
 	except IOError:
+		print "Error when writting configuration"
 		pass

devede-3.22.0.tar.bz2/devede_settings.py -> devede-3.23.0.tar.bz2/devede_settings.py Changed

@@ -36,6 +36,23 @@
         else:
             self.hyper.set_sensitive(False)
     
+    def set_model_from_list (self, cb, items, selected):
+        """Setup a ComboBox or ComboBoxEntry based on a list of strings."""
+        model = gtk.ListStore(str)
+        pos=-1
+        c=0
+        for i in items:
+            model.append(i)
+            if (i==selected):
+                pos=c
+            c+=1
+        cb.set_model(model)
+        cell = gtk.CellRendererText()
+        cb.pack_start(cell, True)
+        cb.add_attribute(cell, 'text', 0)
+        if (pos!=-1):
+            cb.set_active(pos)
+
     def __init__(self,gladefile,structure,global_vars):
         
         self.gladefile=gladefile
@@ -46,6 +63,12 @@
         self.tree.connect_signals(self)
         wsettings=self.tree.get_object("wsettings_dialog")
         
+        self.videos_combo=self.tree.get_object("combobox_videos")
+        self.menus_combo=self.tree.get_object("combobox_menus")
+        
+        self.set_model_from_list(self.videos_combo,global_vars"encoders",global_vars"encoder_video")
+        self.set_model_from_list(self.menus_combo,global_vars"encoders",global_vars"encoder_menu")
+        
         w=self.tree.get_object("erase_files")
         w.set_active(self.global_vars"erase_files")
         
@@ -64,12 +87,14 @@
         self.ac3_fix=self.tree.get_object("AC3_fix")
         self.ac3_fix.set_sensitive(True)
         self.ac3_fix.set_active(self.global_vars"AC3_fix")
-
-        self.use_ffmpeg=self.tree.get_object("use_ffmpeg")
-        self.use_ffmpeg.set_active(self.global_vars"use_ffmpeg")
-        self.use_ffmpeg_menu=self.tree.get_object("use_ffmpeg_menu")
-        self.use_ffmpeg_menu.set_active(self.global_vars"use_ffmpeg_menu")
-            
+        
+        self.ac3_fix_ffmpeg=self.tree.get_object("AC3_fix_ffmpeg")
+        self.ac3_fix_ffmpeg.set_sensitive(True)
+        self.ac3_fix_ffmpeg.set_active(self.global_vars"AC3_fix_ffmpeg")
+        
+        self.ac3_fix_avconv=self.tree.get_object("AC3_fix_avconv")
+        self.ac3_fix_avconv.set_sensitive(True)
+        self.ac3_fix_avconv.set_active(self.global_vars"AC3_fix_avconv")
         
         print "Path: "+str(global_vars"temp_folder")
         path=self.tree.get_object("temporary_files")
@@ -95,11 +120,13 @@
             self.global_vars"multicore"=1
             self.global_vars"hyperthreading"=False
         
-        self.global_vars"use_ffmpeg"=self.use_ffmpeg.get_active()
-        self.global_vars"use_ffmpeg_menu"=self.use_ffmpeg_menu.get_active()
+        self.global_vars"encoder_video"=self.global_vars"encoders"self.videos_combo.get_active()
+        self.global_vars"encoder_menu"=self.global_vars"encoders"self.menus_combo.get_active()
             
         self.global_vars"AC3_fix"=self.ac3_fix.get_active()
-        
+        self.global_vars"AC3_fix_ffmpeg"=self.ac3_fix_ffmpeg.get_active()
+        self.global_vars"AC3_fix_avconv"=self.ac3_fix_avconv.get_active()
+                
         path=self.tree.get_object("temporary_files")
         self.global_vars"temp_folder"=path.get_current_folder()
         print "Path: "+str(self.global_vars"temp_folder")

devede-3.22.0.tar.bz2/devede_xml_menu.py -> devede-3.23.0.tar.bz2/devede_xml_menu.py Changed

@@ -43,8 +43,10 @@
 		self.output=False
 		self.structure=structure
 		self.AC3_fix=global_vars"AC3_fix"
-		self.use_ffmpeg=global_vars"use_ffmpeg"
-		self.use_ffmpeg_menu=global_vars"use_ffmpeg_menu"
+		self.AC3_fix_ffmpeg=global_vars"AC3_fix_ffmpeg"
+		self.AC3_fix_avconv=global_vars"AC3_fix_avconv"
+		self.encoder_video=global_vars"encoder_video"
+		self.encoder_menu=global_vars"encoder_menu"
 		self.with_menu=global_vars"with_menu"
 		if (len(structure)==1) and (len(structure0)==2) and (not self.with_menu):
 			self.onlyone=True
@@ -886,8 +888,6 @@
 		
 		command_var.append("-f")
 		command_var.append("image2")
-		command_var.append("-t")
-		command_var.append(str(1+self.menu_sound_duration))
 		command_var.append("-i")
 		command_var.append(self.filefolder+self.filename+"_menu"+str(counter)+"_bg.png")
 		command_var.append("-i")
@@ -899,6 +899,11 @@
 			command_var.append("pal-dvd")
 		else:
 			command_var.append("ntsc-dvd")
+		command_var.append("-acodec")
+		if self.AC3_fix_ffmpeg:
+			command_var.append("ac3_fixed")
+		else:
+			command_var.append("ac3")
 		command_var.append("-s")
 		if self.menu_PAL:
 			command_var.append("720x576")
@@ -927,6 +932,9 @@
 		command_var.append("-aspect")
 		command_var.append("4:3")
 
+		command_var.append("-t")
+		command_var.append(str(1+self.menu_sound_duration))
+
 		#audio="/home/raster/Escritorio/lazy.mp3"
 		
 		command_var.append(currentfile)
@@ -935,15 +943,91 @@
 
 		self.launch_program(command_var)
 	
+
+	def create_menu_mpg_avconv(self,counter):
+
+		self.mplexed=False
+		command_var=
+		command_var.append("avconv")
+		#command_var.append("avconv")
+	
+		currentfile=self.filefolder+self.filename+"_menu_"+str(counter)+".mpg"
+	
+		audio=self.menu_sound
+		command_var.append("-loop")
+		command_var.append("1")
+		
+		command_var.append("-f")
+		command_var.append("image2")
+		command_var.append("-i")
+		command_var.append(self.filefolder+self.filename+"_menu"+str(counter)+"_bg.png")
+		command_var.append("-i")
+		command_var.append(audio)
+	
+		command_var.append("-y")
+		command_var.append("-target")
+		if self.menu_PAL:
+			command_var.append("pal-dvd")
+		else:
+			command_var.append("ntsc-dvd")
+		command_var.append("-acodec")
+		if self.AC3_fix_avconv:
+			command_var.append("ac3_fixed")
+		else:
+			command_var.append("ac3")
+		command_var.append("-s")
+		if self.menu_PAL:
+			command_var.append("720x576")
+		else:
+			command_var.append("720x480")
+		command_var.append("-g")
+		command_var.append("12")
+#		command_var.append("-bf")
+#		command_var.append("2")
+#		command_var.append("-strict")
+#		command_var.append("1")
+#		command_var.append("-ac")
+#		command_var.append("2")
+#		command_var.append("-trellis")
+#		command_var.append("1")
+#		command_var.append("-mbd")
+#		command_var.append("2")
+		command_var.append("-b:v")
+		command_var.append("2500k")
+		command_var.append("-b:a")
+		command_var.append("192k")
+#		command_var.append("-maxrate")
+#		command_var.append("4000k")
+#		command_var.append("-minrate")
+#		command_var.append("2200k")
+		command_var.append("-aspect")
+		command_var.append("4:3")
+
+		command_var.append("-t")
+		command_var.append(str(1+self.menu_sound_duration))
+
+		#audio="/home/raster/Escritorio/lazy.mp3"
+		
+		command_var.append(currentfile)
+		origDir=os.getcwd()
+		print "Lanzo "+str(command_var)
+
+		self.launch_program(command_var)
+
+
 	
 	def create_menu_mpg(self,counter):
 	
 		print "Creating menus"
 	
-		if (self.use_ffmpeg_menu):
+		if (self.encoder_menu=="ffmpeg"):
 			self.create_menu_mpg_ffmpeg(counter)
 			return
 	
+		if (self.encoder_menu=="avconv"):
+			self.create_menu_mpg_avconv(counter)
+			return
+	
 		self.mplexed=False
 		command_var=
 		if (sys.platform=="win32") or (sys.platform=="win64"):

devede-3.22.0.tar.bz2/interface/aboutdialog1.ui -> devede-3.23.0.tar.bz2/interface/aboutdialog1.ui Changed

@@ -1,15 +1,16 @@
-<?xml version="1.0"?>
+<?xml version="1.0" encoding="UTF-8"?>
 <interface>
   <requires lib="gtk+" version="2.16"/>
   
   <object class="GtkAboutDialog" id="aboutdialog1">
+    <property name="can_focus">False</property>
     <property name="border_width">5</property>
     <property name="window_position">center</property>
     <property name="destroy_with_parent">True</property>
     <property name="icon">devede.svg</property>
     <property name="type_hint">normal</property>
     <property name="program_name">DeVeDe</property>
-    <property name="version">3.22.0</property>
+    <property name="version">3.23.0</property>
     <property name="copyright">(C)2006-2012 Raster Software Vigo,
 Peter Gill and Gustavo Sanchez</property>
     <property name="website">http://www.rastersoft.com/programas/devede.html</property>
@@ -41,14 +42,14 @@
 Lars-Erik Aunevik Labori
 Laszlo Csordas
 Marco de Freitas
-Martin &#x160;&#xED;n
+Martin Šín
 Maurizio Daniele
 Maxim Winckelmans
 Miguel Bouzada
 Patrick Monnerat
 Qla
 V. Fotiadis
-&#x5927;&#x5B9D;</property>
+大宝</property>
     <property name="artists">Ben Trein
 Jonah Naylor
 Jonathan Estrella</property>
@@ -56,19 +57,22 @@
     <child internal-child="vbox">
       <object class="GtkVBox" id="dialog-vbox1">
         <property name="visible">True</property>
-        <child>
-          <placeholder/>
-        </child>
+        <property name="can_focus">False</property>
         <child internal-child="action_area">
           <object class="GtkHButtonBox" id="dialog-action_area1">
             <property name="visible">True</property>
+            <property name="can_focus">False</property>
           </object>
           <packing>
             <property name="expand">False</property>
+            <property name="fill">True</property>
             <property name="pack_type">end</property>
             <property name="position">0</property>
           </packing>
         </child>
+        <child>
+          <placeholder/>
+        </child>
       </object>
     </child>
   </object>

devede-3.22.0.tar.bz2/interface/settings.ui -> devede-3.23.0.tar.bz2/interface/settings.ui Changed

@@ -2,6 +2,40 @@
 <interface>
   <requires lib="gtk+" version="2.16"/>
   
+  <object class="GtkListStore" id="liststore1">
+    <columns>
+      
+      <column type="gchararray"/>
+    </columns>
+    <data>
+      <row>
+        <col id="0" translatable="yes">Mencoder</col>
+      </row>
+      <row>
+        <col id="0" translatable="yes">FFmpeg</col>
+      </row>
+      <row>
+        <col id="0" translatable="yes">AVconv</col>
+      </row>
+    </data>
+  </object>
+  <object class="GtkListStore" id="liststore2">
+    <columns>
+      
+      <column type="gchararray"/>
+    </columns>
+    <data>
+      <row>
+        <col id="0" translatable="yes">Mencoder</col>
+      </row>
+      <row>
+        <col id="0" translatable="yes">FFmpeg</col>
+      </row>
+      <row>
+        <col id="0" translatable="yes">AVconv</col>
+      </row>
+    </data>
+  </object>
   <object class="GtkDialog" id="wsettings_dialog">
     <property name="can_focus">False</property>
     <property name="border_width">5</property>
@@ -139,6 +173,7 @@
                               <packing>
                                 <property name="expand">True</property>
                                 <property name="fill">True</property>
+                                <property name="padding">17</property>
                                 <property name="position">1</property>
                               </packing>
                             </child>
@@ -150,14 +185,58 @@
                           </packing>
                         </child>
                         <child>
-                          <object class="GtkCheckButton" id="use_ffmpeg">
-                            <property name="label" translatable="yes">Use FFMPEG instead of Mencoder for videos</property>
+                          <object class="GtkTable" id="table1">
                             <property name="visible">True</property>
-                            <property name="can_focus">True</property>
-                            <property name="receives_default">False</property>
-                            <property name="use_action_appearance">False</property>
-                            <property name="draw_indicator">True</property>
-                            <signal name="toggled" handler="on_toggled_cb" swapped="no"/>
+                            <property name="can_focus">False</property>
+                            <property name="n_rows">2</property>
+                            <property name="n_columns">2</property>
+                            <child>
+                              <object class="GtkComboBox" id="combobox_videos">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="model">liststore2</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="right_attach">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkComboBox" id="combobox_menus">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="model">liststore1</property>
+                              </object>
+                              <packing>
+                                <property name="left_attach">1</property>
+                                <property name="right_attach">2</property>
+                                <property name="top_attach">1</property>
+                                <property name="bottom_attach">2</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkLabel" id="label4">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="yes">Encoder for videos:</property>
+                              </object>
+                              <packing>
+                                <property name="x_options">GTK_FILL</property>
+                                <property name="x_padding">4</property>
+                              </packing>
+                            </child>
+                            <child>
+                              <object class="GtkLabel" id="label5">
+                                <property name="visible">True</property>
+                                <property name="can_focus">False</property>
+                                <property name="label" translatable="yes">Encoder for menus:</property>
+                              </object>
+                              <packing>
+                                <property name="top_attach">1</property>
+                                <property name="bottom_attach">2</property>
+                                <property name="x_options">GTK_FILL</property>
+                              </packing>
+                            </child>
                           </object>
                           <packing>
                             <property name="expand">True</property>
@@ -165,21 +244,6 @@
                             <property name="position">3</property>
                           </packing>
                         </child>
-                        <child>
-                          <object class="GtkCheckButton" id="use_ffmpeg_menu">
-                            <property name="label" translatable="yes">Use FFMPEG instead of Mencoder for menu</property>
-                            <property name="visible">True</property>
-                            <property name="can_focus">True</property>
-                            <property name="receives_default">False</property>
-                            <property name="use_action_appearance">False</property>
-                            <property name="draw_indicator">True</property>
-                          </object>
-                          <packing>
-                            <property name="expand">True</property>
-                            <property name="fill">True</property>
-                            <property name="position">4</property>
-                          </packing>
-                        </child>
                       </object>
                     </child>
                   </object>
@@ -275,13 +339,54 @@
                     <property name="can_focus">False</property>
                     <property name="left_padding">12</property>
                     <child>
-                      <object class="GtkCheckButton" id="AC3_fix">
-                        <property name="label" translatable="yes">AC3_FIXED workaround to fix discs without sound when using Mencoder beta</property>
+                      <object class="GtkVBox" id="vbox2">
                         <property name="visible">True</property>
-                        <property name="can_focus">True</property>
-                        <property name="receives_default">False</property>
-                        <property name="use_action_appearance">False</property>
-                        <property name="draw_indicator">True</property>
+                        <property name="can_focus">False</property>
+                        <child>
+                          <object class="GtkCheckButton" id="AC3_fix">
+                            <property name="label" translatable="yes">AC3_FIXED workaround to fix discs without sound when using Mencoder</property>
+                            <property name="visible">True</property>
+                            <property name="can_focus">True</property>
+                            <property name="receives_default">False</property>
+                            <property name="use_action_appearance">False</property>
+                            <property name="draw_indicator">True</property>
+                          </object>
+                          <packing>
+                            <property name="expand">True</property>
+                            <property name="fill">True</property>
+                            <property name="position">0</property>
+                          </packing>
+                        </child>
+                        <child>
+                          <object class="GtkCheckButton" id="AC3_fix_ffmpeg">
+                            <property name="label" translatable="yes">AC3_FIXED workaround to fix discs without sound when using FFmpeg</property>
+                            <property name="visible">True</property>
+                            <property name="can_focus">True</property>
+                            <property name="receives_default">False</property>
+                            <property name="use_action_appearance">False</property>
+                            <property name="draw_indicator">True</property>
+                          </object>
+                          <packing>
+                            <property name="expand">True</property>
+                            <property name="fill">True</property>
+                            <property name="position">1</property>
+                          </packing>
+                        </child>
+                        <child>
+                          <object class="GtkCheckButton" id="AC3_fix_avconv">
+                            <property name="label" translatable="yes">AC3_FIXED workaround to fix discs without sound when using AVconv</property>
+                            <property name="visible">True</property>
+                            <property name="can_focus">True</property>
+                            <property name="receives_default">False</property>
+                            <property name="use_action_appearance">False</property>
+                            <property name="draw_indicator">True</property>
+                          </object>
+                          <packing>
+                            <property name="expand">True</property>
+                            <property name="fill">True</property>
+                            <property name="position">2</property>
+                          </packing>
+                        </child>
                       </object>
                     </child>
                   </object>

devede-3.22.0.tar.bz2/interface/wprograms.ui -> devede-3.23.0.tar.bz2/interface/wprograms.ui Changed

@@ -1,10 +1,11 @@
-<?xml version="1.0"?>
+<?xml version="1.0" encoding="UTF-8"?>
 <interface>
-  
+  <requires lib="gtk+" version="2.16"/>
   
   <object class="GtkWindow" id="wprograms">
     <property name="width_request">500</property>
     <property name="height_request">300</property>
+    <property name="can_focus">False</property>
     <property name="border_width">5</property>
     <property name="title" translatable="yes">Error</property>
     <property name="resizable">False</property>
@@ -17,11 +18,12 @@
         <property name="width_request">370</property>
         <property name="height_request">173</property>
         <property name="visible">True</property>
-        <property name="orientation">vertical</property>
+        <property name="can_focus">False</property>
         <property name="spacing">2</property>
         <child>
           <object class="GtkLabel" id="label56">
             <property name="visible">True</property>
+            <property name="can_focus">False</property>
             <property name="label" translatable="yes">Can't find the following programs:</property>
             <property name="justify">center</property>
             <property name="wrap">True</property>
@@ -43,11 +45,13 @@
             <child>
               <object class="GtkViewport" id="viewport1">
                 <property name="visible">True</property>
+                <property name="can_focus">False</property>
                 <property name="events">GDK_POINTER_MOTION_MASK | GDK_POINTER_MOTION_HINT_MASK | GDK_BUTTON_PRESS_MASK | GDK_BUTTON_RELEASE_MASK</property>
                 <property name="resize_mode">queue</property>
                 <child>
                   <object class="GtkLabel" id="programs_label">
                     <property name="visible">True</property>
+                    <property name="can_focus">False</property>
                     <property name="justify">center</property>
                     <property name="wrap">True</property>
                   </object>
@@ -56,13 +60,16 @@
             </child>
           </object>
           <packing>
+            <property name="expand">True</property>
+            <property name="fill">True</property>
             <property name="position">1</property>
           </packing>
         </child>
         <child>
           <object class="GtkLabel" id="label58">
             <property name="visible">True</property>
-            <property name="label" translatable="yes">DeVeDe needs them in order to work. If you want to use DeVeDe, you must install all of them.</property>
+            <property name="can_focus">False</property>
+            <property name="label" translatable="yes">DeVeDe needs them in order to work. If you want to use DeVeDe, you must install them.</property>
             <property name="justify">center</property>
             <property name="wrap">True</property>
           </object>
@@ -76,9 +83,11 @@
         <child>
           <object class="GtkHSeparator" id="hseparator5">
             <property name="visible">True</property>
+            <property name="can_focus">False</property>
           </object>
           <packing>
             <property name="expand">False</property>
+            <property name="fill">True</property>
             <property name="padding">3</property>
             <property name="position">3</property>
           </packing>
@@ -86,6 +95,7 @@
         <child>
           <object class="GtkHButtonBox" id="hbuttonbox3">
             <property name="visible">True</property>
+            <property name="can_focus">False</property>
             <property name="border_width">5</property>
             <child>
               <object class="GtkButton" id="program_exit">
@@ -93,8 +103,9 @@
                 <property name="visible">True</property>
                 <property name="can_focus">True</property>
                 <property name="receives_default">False</property>
+                <property name="use_action_appearance">False</property>
                 <property name="use_stock">True</property>
-                <signal name="clicked" handler="gtk_main_quit"/>
+                <signal name="clicked" handler="gtk_main_quit" swapped="no"/>
               </object>
               <packing>
                 <property name="expand">False</property>
@@ -105,6 +116,8 @@
             </child>
           </object>
           <packing>
+            <property name="expand">True</property>
+            <property name="fill">True</property>
             <property name="position">4</property>
           </packing>
         </child>

devede-3.22.0.tar.bz2/interface/wprogress.ui -> devede-3.23.0.tar.bz2/interface/wprogress.ui Changed

devede-3.23.0.tar.bz2/locale Added

devede-3.23.0.tar.bz2/locale/ca Added

devede-3.23.0.tar.bz2/locale/ca/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/ca/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/cs_CZ Added

devede-3.23.0.tar.bz2/locale/cs_CZ/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/cs_CZ/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/da Added

devede-3.23.0.tar.bz2/locale/da/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/da/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/de_DE Added

devede-3.23.0.tar.bz2/locale/de_DE/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/de_DE/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/el Added

devede-3.23.0.tar.bz2/locale/el/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/el/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/es Added

devede-3.23.0.tar.bz2/locale/es/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/es/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/fr Added

devede-3.23.0.tar.bz2/locale/fr/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/fr/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/gl Added

devede-3.23.0.tar.bz2/locale/gl/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/gl/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/hu_HU Added

devede-3.23.0.tar.bz2/locale/hu_HU/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/hu_HU/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/it_IT Added

devede-3.23.0.tar.bz2/locale/it_IT/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/it_IT/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/nb_NO Added

devede-3.23.0.tar.bz2/locale/nb_NO/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/nb_NO/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/nl Added

devede-3.23.0.tar.bz2/locale/nl/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/nl/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/pl Added

devede-3.23.0.tar.bz2/locale/pl/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/pl/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/pt_BR Added

devede-3.23.0.tar.bz2/locale/pt_BR/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/pt_BR/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/pt_PT Added

devede-3.23.0.tar.bz2/locale/pt_PT/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/pt_PT/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/ru Added

devede-3.23.0.tar.bz2/locale/ru/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/ru/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/sk Added

devede-3.23.0.tar.bz2/locale/sk/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/sk/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/sv Added

devede-3.23.0.tar.bz2/locale/sv/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/sv/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/tr Added

devede-3.23.0.tar.bz2/locale/tr/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/tr/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/zh_CN Added

devede-3.23.0.tar.bz2/locale/zh_CN/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/zh_CN/LC_MESSAGES/devede.mo Added

devede-3.23.0.tar.bz2/locale/zh_TW Added

devede-3.23.0.tar.bz2/locale/zh_TW/LC_MESSAGES Added

devede-3.23.0.tar.bz2/locale/zh_TW/LC_MESSAGES/devede.mo Added

devede-3.22.0.tar.bz2/uninstall.sh -> devede-3.23.0.tar.bz2/uninstall.sh Changed

devede-3.22.0.tar.bz2/version.txt -> devede-3.23.0.tar.bz2/version.txt Changed